Homework Answers
The Kinetics of the reaction 2 A -> 4X +Y is 1st order in A and...
The Kinetics of the reaction 2 A -> 4X +Y is 1st order in A and overall 1st order. The half- life of this reaction is 2.4 hours at 30 degrees C. A. Starting with 100g of A, how many grams will remain after period of 9.6 hours? B. Starting with 300g of A, how many grams will remain after a period of 17 hours? C. What period of time id required to reduce 4.2x10^11 molecules of A to 1.1...
#1 please sactions and kinetic 6.50 x 10's INOCHOD. = 3.00 M 1. (30 pts) Kinetics...
#1 please
sactions and kinetic 6.50 x 10's INOCHOD. = 3.00 M 1. (30 pts) Kinetics Consider the following reactions and kinetic information: 1 2N,Os(9) - 4NO2(g) + O2(g), 1st order, k = 6.50 x 10's. [ NOsJo = 2.00 M. il CH CHO - CH + CO, 2nd order, k = 6.50 x 10'M's, (CH3CHOJo = 3.00 M Will more dinitrogen pentoxide (1) or more acetaldehyde (ll) remain after 2500 s? 2. 25 pel The Reaction Pendi (28) Sketch...
A first order reaction initially contains 1.00 x 1020 molecules. If the reaction has a half-life...
A first order reaction initially contains 1.00 x 1020 molecules. If the reaction has a half-life of 20.0 minutes, how many molecules remain unreacted after 80.0 minutes? 73.77 molecules ( 1 | 4 7 +/- 2 5 8 . 3 6 9 0 x100 aditional resources
[time] [Z] 4. Suppose the data shown are for the second order reaction: → products. What...
[time] [Z] 4. Suppose the data shown are for the second order reaction: → products. What is the value of the rate constant k? O min 50.000 atm 6.250 3.333 2.273. 5. For a first order reaction (G - products) with k = 0.173 min', suppose a chemist runs the reaction starting with an initial concentration [G]. = 12.0 M. a. How many minutes will it take for [G] to decrease to 4.70 M? b. What [G] will remain after...
Question 1: Answer the following questions regarding half-lives. Assume first-order half life kinetics (2 pts total)....
Question 1: Answer the following questions regarding half-lives. Assume first-order half life kinetics (2 pts total). A. The half-life of Co-60 is about 5.25 years. Starting with a 42 g sample, how much remains after 21.0 years have passed (1 pt)? B. The Spider that bit Miles Morales secretes an unknown radioactive chemical that decays via first order kinetics. Originally 27.0 mg, only 5.3 mg remains after 32 days. What is this compound's half-life (1 pt)?
At 25°C, some second-order reaction 2 X (g)→ Y (g) + Z (g) has a half-life...
At 25°C, some second-order reaction 2 X (g)→ Y (g) + Z (g) has a half-life of 4.62 hours when the initial concentration of X is 3.47 M. How much X will be left after 5.6 hours?
After complete reaction, how many molecules of ammonia are produced?
After complete reaction, how many molecules of ammonia are
produced?
Nitrogen and hydrogen combine at high temperature, in the presence of a catalyst, to produce ammonia. N2(g)+3H2(g) ? 2NH3(g) Assume 4 molecules of nitrogen and 9 molecules of hydrogen are present. After complete reaction, how many molecules of ammonia are produced? ___________ Number How many molecules of H2 remain? Number How many molecules of N2 remain? Number _________ What is the limiting reactant? nitrogen hydrogen
Nitrogen and hydrogen combine at...
X-X dimer forms ·X radicals at high temperature in a first-order reaction, for which the rate...
X-X dimer forms ·X radicals at high temperature in a first-order reaction, for which the rate constant k = 2.31 h-1. (blank 1) What is the half-life for the reaction? (blank 2) How much of a sample of XX (MW = 45.03 g/mol) with mass of 5.44 g placed in a reaction vessel of 500. mL volume at the high temperature will remain after 0.700 hours? Answer to 3 sig figs with appropriate units in both answers.
3. A reaction 2A 2B + C is known to follow second-order kinetics, with k =...
3. A reaction 2A 2B + C is known to follow second-order kinetics, with k = 7.20x10*M's' at 25.0 °C. (20 points) During one experiment, the initial concentration of A is [A]. = 0.120 M (a) Calculate the half-life (1,2), in hours, for this experiment. (b) Calculate the initial reaction rate (in M/s) for this reaction (4 points) (c) How long will it take (in hours) for the concentration of C to reach [C] = 0.0540 M (6 points) (d)...
The yellow molecules (Y) react with the blue molecules (B2) to form malecules ot Y2R in...
The yellow molecules (Y) react with the blue molecules (B2) to form malecules ot Y2R in the container shown helow. Fach circle represents one mole of material, and the atomic masses of Y and B are 37.2 and 70.1, espectively. How many grams of Ys and B are in the container? Ys g Bz How many moles of Y2B molecules can be produced? mol Y2B How many grams of Y2B could he produced? g Y2B How many moles of Ys...
#1 please
sactions and kinetic 6.50 x 10's INOCHOD. = 3.00 M 1. (30 pts) Kinetics Consider the following reactions and kinetic information: 1 2N,Os(9) - 4NO2(g) + O2(g), 1st order, k = 6.50 x 10's. [ NOsJo = 2.00 M. il CH CHO - CH + CO, 2nd order, k = 6.50 x 10'M's, (CH3CHOJo = 3.00 M Will more dinitrogen pentoxide (1) or more acetaldehyde (ll) remain after 2500 s? 2. 25 pel The Reaction Pendi (28) Sketch...
A first order reaction initially contains 1.00 x 1020 molecules. If the reaction has a half-life of 20.0 minutes, how many molecules remain unreacted after 80.0 minutes? 73.77 molecules ( 1 | 4 7 +/- 2 5 8 . 3 6 9 0 x100 aditional resources
[time] [Z] 4. Suppose the data shown are for the second order reaction: → products. What is the value of the rate constant k? O min 50.000 atm 6.250 3.333 2.273. 5. For a first order reaction (G - products) with k = 0.173 min', suppose a chemist runs the reaction starting with an initial concentration [G]. = 12.0 M. a. How many minutes will it take for [G] to decrease to 4.70 M? b. What [G] will remain after...
Question 1: Answer the following questions regarding half-lives. Assume first-order half life kinetics (2 pts total). A. The half-life of Co-60 is about 5.25 years. Starting with a 42 g sample, how much remains after 21.0 years have passed (1 pt)? B. The Spider that bit Miles Morales secretes an unknown radioactive chemical that decays via first order kinetics. Originally 27.0 mg, only 5.3 mg remains after 32 days. What is this compound's half-life (1 pt)?
After complete reaction, how many molecules of ammonia are
produced?
Nitrogen and hydrogen combine at high temperature, in the presence of a catalyst, to produce ammonia. N2(g)+3H2(g) ? 2NH3(g) Assume 4 molecules of nitrogen and 9 molecules of hydrogen are present. After complete reaction, how many molecules of ammonia are produced? ___________ Number How many molecules of H2 remain? Number How many molecules of N2 remain? Number _________ What is the limiting reactant? nitrogen hydrogen
Nitrogen and hydrogen combine at...
3. A reaction 2A 2B + C is known to follow second-order kinetics, with k = 7.20x10*M's' at 25.0 °C. (20 points) During one experiment, the initial concentration of A is [A]. = 0.120 M (a) Calculate the half-life (1,2), in hours, for this experiment. (b) Calculate the initial reaction rate (in M/s) for this reaction (4 points) (c) How long will it take (in hours) for the concentration of C to reach [C] = 0.0540 M (6 points) (d)...
The yellow molecules (Y) react with the blue molecules (B2) to form malecules ot Y2R in the container shown helow. Fach circle represents one mole of material, and the atomic masses of Y and B are 37.2 and 70.1, espectively. How many grams of Ys and B are in the container? Ys g Bz How many moles of Y2B molecules can be produced? mol Y2B How many grams of Y2B could he produced? g Y2B How many moles of Ys...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 55 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago