Homework Answers
Add Answer to:
Can you please show and explain how you got your answer
please
5. Write a balanced...
The electrochemical cell described by the balanced chemical reaction has a standard cell potential of -0.2...
The electrochemical cell described by the balanced chemical reaction has a standard cell potential of -0.2 V. Calculate the equilibrium constant (Kc) for the reaction at 298 K. Round your answer to 3 significant figures. H2SO3(aq) + H2O(l) → H2(g) + SO42-(aq) + 2H+(aq) The electrochemical cell described by the cell notation has a standard cell potential of -0.10 V. Calculate the value (kJ) for the ΔG˚ of the cell. Round your answer to 3 significant figures. Pt(s) l Cr3+(aq),...
Using the Nernst equation, calculate the cell potential for the following reaction (T=298 K): Cr2O72- (aq)...
Using the Nernst equation, calculate the cell potential for the following reaction (T=298 K): Cr2O72- (aq) + 14 H+ (aq) 6 I- (aq) → 2 Cr3+ (aq) + 3 I2 (s) + 7 H2O (l) given that Cr2O72- = 1.7 M H+ = 1 M I- = 1 M Cr3+ = 0.002 M
I balanced them and got the following: 5c6h12o6+24No3- +24H+----->30Co2+12N2+42h2o and c6h12o6+4Cr2o7(2-)+32H+---6Co2+8Cr(3+)+22h2o the 2- and 3+ are...
I balanced them and got the following:
5c6h12o6+24No3- +24H+----->30Co2+12N2+42h2o
and
c6h12o6+4Cr2o7(2-)+32H+---6Co2+8Cr(3+)+22h2o
the 2- and 3+ are superscripts. thank you
Balance the following reactions using a half-reaction method: (H- or H20 might need to be added) C6H1206 +NO N2 +CO2 C6H1206+ Cr207 Cr CO2+ H20 Solve the following using the reactions you balanced above (Make an assumption if it is needed) a. How much N2 will be produced (L) when 6 liters of a CsH120 solution is degraded to CO2 and...
In the reaction of dichromate ion and iodide ion: Cr2O72-(aq) + 14 H+(aq) + 6 I-(aq)...
In the reaction of dichromate ion and iodide ion: Cr2O72-(aq) + 14 H+(aq) + 6 I-(aq) ---> 2 Cr3+(aq) + 7 H2O(l)+ 3 I2 (s) the oxidizing agent is ? and the reducing agent is ?
please answer 8-10 Canvas -→ XCIO Question 8 Which element is oxidized in the following reaction?...
please answer 8-10
Canvas -→ XCIO Question 8 Which element is oxidized in the following reaction? Cr2O72-(aq) + 61"(aq) + 14 H*(aq) + 2 Cr3+ (aq) + 312(s) + 7 H2O(1) eo None of these. This is not a redox reaction OH Ocr Question 9 Balance the following redox reaction, which occurs in acidic solution, using the smallest w Te(s) + NO3(aq) - TeOz(s) + NO(g) unbalanced When this equation is appropriately balanced, what is the coefficient on water and...
Can you please solve and provide the answer please c. 10. Calculate the standard cell potential...
Can
you please solve and provide the answer please
c. 10. Calculate the standard cell potential El using the given given data for the electrochemical cell constructed using the following reaction: Mn (s) + Ca**(aq) → Mnº(aq) + Ca(s). Half-reaction Standard reduction potential Mn* (aq) +2 e Mn(s) -1.185 V ca" (aq) +2 e Cd(s) -0.403 v a. +1.588 V d. +1.967 V b. +0.782 v e. -0.782 v -1.588 v 11. What is the value of the equilibrium constant...
explain how you got it 9. Complete and balance the following equations. (a) Mg(s) + O2(g)...
explain how you got it
9. Complete and balance the following equations. (a) Mg(s) + O2(g) → _ (b) Sr(s) + H2O(l) → _ (aq) +_ () (c) Li(s) + N2(g) – – (d) Rb(s) + O2(g) → _ (e) Na(s) + 18-crown-6(1) ► Ni catalyst (f) CH4(g) + H2O(g) → 800 °C _(g) +
please help the standrad reduction provided down What is the calculated value of the cell potential...
please help the standrad reduction provided down
What is the calculated value of the cell potential at 298K for an electrochemical cell with the following reaction, when the Cu2+ concentration is 9.24x10 + M and the Cr3+ concentration is 1.47 M? 3Cu2+ (aq) + 2Cr(s) Answer: 3Cu(s) + 2Cr +(aq) v The cell reaction as written above is spontaneous for the concentrations given: What is the calculated value of the cell potential at 298K for an electrochemical cell with the...
help with these please Use the References to access important values if needed for this question....
help with these please
Use the References to access important values if needed for this question. What is the calculated value of the cell potential at 298K for an electrochemical cell with the following reaction, when the Cu2 concentration is 9.24x104 M and the Cr3 concentration is 1.47 M ? 3Cu2 (aq)+2Cr(s)3Cu(s) + 2Cr (aq) V Answer: The cell reaction as written above is spontaneous for the concentrations given: What is the binding energy in kJ/mol nucleons for silver-107? kJ/mol...
I balanced them and got the following:
5c6h12o6+24No3- +24H+----->30Co2+12N2+42h2o
and
c6h12o6+4Cr2o7(2-)+32H+---6Co2+8Cr(3+)+22h2o
the 2- and 3+ are superscripts. thank you
Balance the following reactions using a half-reaction method: (H- or H20 might need to be added) C6H1206 +NO N2 +CO2 C6H1206+ Cr207 Cr CO2+ H20 Solve the following using the reactions you balanced above (Make an assumption if it is needed) a. How much N2 will be produced (L) when 6 liters of a CsH120 solution is degraded to CO2 and...
please answer 8-10
Canvas -→ XCIO Question 8 Which element is oxidized in the following reaction? Cr2O72-(aq) + 61"(aq) + 14 H*(aq) + 2 Cr3+ (aq) + 312(s) + 7 H2O(1) eo None of these. This is not a redox reaction OH Ocr Question 9 Balance the following redox reaction, which occurs in acidic solution, using the smallest w Te(s) + NO3(aq) - TeOz(s) + NO(g) unbalanced When this equation is appropriately balanced, what is the coefficient on water and...
Can
you please solve and provide the answer please
c. 10. Calculate the standard cell potential El using the given given data for the electrochemical cell constructed using the following reaction: Mn (s) + Ca**(aq) → Mnº(aq) + Ca(s). Half-reaction Standard reduction potential Mn* (aq) +2 e Mn(s) -1.185 V ca" (aq) +2 e Cd(s) -0.403 v a. +1.588 V d. +1.967 V b. +0.782 v e. -0.782 v -1.588 v 11. What is the value of the equilibrium constant...
explain how you got it
9. Complete and balance the following equations. (a) Mg(s) + O2(g) → _ (b) Sr(s) + H2O(l) → _ (aq) +_ () (c) Li(s) + N2(g) – – (d) Rb(s) + O2(g) → _ (e) Na(s) + 18-crown-6(1) ► Ni catalyst (f) CH4(g) + H2O(g) → 800 °C _(g) +
please help the standrad reduction provided down
What is the calculated value of the cell potential at 298K for an electrochemical cell with the following reaction, when the Cu2+ concentration is 9.24x10 + M and the Cr3+ concentration is 1.47 M? 3Cu2+ (aq) + 2Cr(s) Answer: 3Cu(s) + 2Cr +(aq) v The cell reaction as written above is spontaneous for the concentrations given: What is the calculated value of the cell potential at 298K for an electrochemical cell with the...
help with these please
Use the References to access important values if needed for this question. What is the calculated value of the cell potential at 298K for an electrochemical cell with the following reaction, when the Cu2 concentration is 9.24x104 M and the Cr3 concentration is 1.47 M ? 3Cu2 (aq)+2Cr(s)3Cu(s) + 2Cr (aq) V Answer: The cell reaction as written above is spontaneous for the concentrations given: What is the binding energy in kJ/mol nucleons for silver-107? kJ/mol...
Most questions answered within 3 hours.
-
Suppose there are 1000 students in a business administration
program. 620 students are in an IT...
asked 1 minute ago -
Let G be an undirected graph and let X be a subset of the
vertices of...
asked 1 minute ago -
An empty truck traveling at 10 km/h has kinetic energy. How much
kinetic energy does it...
asked 32 seconds from now -
Physicians add a special dimension to a governing board. What
are the important things to consider...
asked 14 minutes ago -
Rank the following titrations in order of increasing pH at the
halfway point to equivalence (1...
asked 10 minutes ago -
Mr. Smalley, who had been diagnosed as manic-depressive and had
been in and out of mental...
asked 12 minutes ago -
A circular (0.8 m diameter) footing with q=50 kN/m^2 is placed
on the ground surface. Compute...
asked 17 minutes ago -
Calculate the effective radiation dosage in rems for a 75 ‑kg
person who is exposed to...
asked 19 minutes ago -
Determine the heat of combustion (ΔH2) for propane
(C3H8) using the bond energy table. HINT: you’ll...
asked 30 minutes ago -
1 Give the host id in binary for the following IP addresses
(assuming classful):
a) 130.11.6.9...
asked 32 minutes ago -
A concert loudspeaker suspended high off the ground emits 32 W
of sound power. A small...
asked 35 minutes ago -
WRITE A JAVA PROGRAM THAT READS DATA FROM A .CSV FILE
!!
PLEASE SEE INSTRUCTIONS BELOW...
asked 40 minutes ago