Homework Answers
Add Answer to:
When Nz is removed from the following system at equilibrium O in order to restare equilibrium,...
please help 10. What effect do the listed changes have on the position of the equilibrium in the reaction of carbon...
please help
10. What effect do the listed changes have on the position of the equilibrium in the reaction of carbon with hydrogen? C + 2How → CHILE AH -18 kcal/mol (-75 kd/mol) A. Increasing temperature: A increasing the temperature shifts the equilibrium to the right, favoring, product B. Increasing the temperature shifts the equilibrium to the left, favoring reactants. B. Increasing pressure by decreasing volume: A B. Increasing the pressure shifts the equilibrium to the left, favoring reactants Increasing...
If the equilibrium constant for a reaction is >1, reactants are more prominent at equilibrium. O...
If the equilibrium constant for a reaction is >1, reactants are more prominent at equilibrium. O True O False Question 2 1 pts In your own words, explain how Transition lenses are an example of Le Chatelier's principle. In your answer, address: a. What is being added or removed? b. Is it a product or reactant in the chemical reaction? How does this relate to Le Chatelier's principle? c. How does this effect the color of the lenses? Canvas will...
A) No change in the equilibrium C) More information is needed to answer the question. B)...
A) No change in the equilibrium C) More information is needed to answer the question. B) Equilibrium shifts to the right. D) Equilibrium shifts to the left E) None of the answers is correct. Q(17) Which species is amphiprotic? A) H3PO B) H2PO D) None of these C) PO Q(18) Ni(CO)4)Nie)+ 4 COlaAdding nickel (solid) to this reaction will cause the equilibrium to A) Shift toward the products C) remain unchanged E) it depends on the amount added B) Shift...
The Temperature Dependence of Chemical Equilibrium For an equilibrium reaction: A+B Kcto the following graph was...
The Temperature Dependence of Chemical Equilibrium For an equilibrium reaction: A+B Kcto the following graph was obtained. Ink 0.002 0.006 0.008 0.01 0.004 1/1 Ink = -AH° + AS RTR Given the above relationship, use the graph to identify which of the following statements are "true" or "false" in this specific case. All statements refer to the forward reaction (proceeding left to right, as given) corresponding to the equilibrium constant K. The reaction is exothermic. As the temperature is decreased,...
A reaction that has a positive AH and a positive AS will be spontaneous at high...
A reaction that has a positive AH and a positive AS will be spontaneous at high temperatures spontaneous at low temperatures spontaneous at all temperatures nonspontaneous at all temperatures QUESTION 6 Which of the following statements is FALSE? Keg for a reaction written in reverse is the reciprocal of the key for the forward reaction A reaction quotient (Q) larger than Keq means that the reaction will shift toward reactants Chemical equilibrium indicates that reactants and products are present in...
5) Determine the value of Kc for the following reaction if the equilibrium concentrations are as...
5) Determine the value of Kc for the following reaction if the equilibrium concentrations are as follows: [NO2]eq = 0.85 M and [NO]eq=0.38 M. 2 NO2(g) - N2048) A) 2.2 B) 1.9 C) 0.022 D) 0.22 E) 0.53 6) Which of the following statements is true? A) If Q=K, it means the reaction is not at equilibrium. B) If Q<K, it means the forward reaction will proceed to the right) to form more reactants. C) IFO <K, it means the...
6) Which of the following statements is true? A) If Q = K, it means the reaction is not at equilibrium B) If Q<...
6) Which of the following statements is true? A) If Q = K, it means the reaction is not at equilibrium B) If Q< K, it means the forward reaction will proceed (to the right) to form more reactants. C) If Q< K, it means the reverse reaction will proceed (to the left) to form more reactants. D) If Q> K, it means the forward reaction will proceed (to the right) to form more reactants E) If Q> K, it...
For an equilibrium reaction: А + В С +D the following graph was obtained. 90 80...
For an equilibrium reaction: А + В С +D the following graph was obtained. 90 80 70 6е 50 40 зе 20 10 -10 -20 e.002 0.01 0.004 0.006 0.008 1/T Ink -AHo RT ASO + R Given the above relationship, use the graph to identify which of the following statements are "true" or "false" in this specific case. All statements refer to the forward reaction (proceeding left to right, as given) corresponding to the equilibrium constant K. deltaSo for...
answer all 6) cernents is true? equilibrium co the right 5) Determine the value of Ke...
answer all
6) cernents is true? equilibrium co the right 5) Determine the value of Ke for the following reaction if the equilibrium concentrations are as follows: (NO Joy -0.85 M and [NO_Jeg -0.38 M. 2 NO:(8) - N,Od D) 0.22 E) 0.53 A) 2.2 C) 0.022 B) 19 6) Which of the following statements is true? A) 10-K, it means the reaction is not at equilibrium. B) TOK, it means the forward reaction will proceed to the right to...
KINETICS AND EQUILIBRIUM Using an equilibrium constant to predict the direction of spont... A chemi... origineer...
KINETICS AND EQUILIBRIUM Using an equilibrium constant to predict the direction of spont... A chemi... origineer is studying the following reaction: 2NO(9)+2H,(0) N (9)+2H,0(9) At the temperature the engineer picks, the equilibrium constant for this reaction is 0.39. The engineer charges ("fills") four reaction vessels with nitrogen monoxide and hydrogen, and lets the reaction begin. He then measures the composition of the mixture inside each vessel from time to time. His first set of measurements are shown in the table...
please help
10. What effect do the listed changes have on the position of the equilibrium in the reaction of carbon with hydrogen? C + 2How → CHILE AH -18 kcal/mol (-75 kd/mol) A. Increasing temperature: A increasing the temperature shifts the equilibrium to the right, favoring, product B. Increasing the temperature shifts the equilibrium to the left, favoring reactants. B. Increasing pressure by decreasing volume: A B. Increasing the pressure shifts the equilibrium to the left, favoring reactants Increasing...
If the equilibrium constant for a reaction is >1, reactants are more prominent at equilibrium. O True O False Question 2 1 pts In your own words, explain how Transition lenses are an example of Le Chatelier's principle. In your answer, address: a. What is being added or removed? b. Is it a product or reactant in the chemical reaction? How does this relate to Le Chatelier's principle? c. How does this effect the color of the lenses? Canvas will...
A) No change in the equilibrium C) More information is needed to answer the question. B) Equilibrium shifts to the right. D) Equilibrium shifts to the left E) None of the answers is correct. Q(17) Which species is amphiprotic? A) H3PO B) H2PO D) None of these C) PO Q(18) Ni(CO)4)Nie)+ 4 COlaAdding nickel (solid) to this reaction will cause the equilibrium to A) Shift toward the products C) remain unchanged E) it depends on the amount added B) Shift...
The Temperature Dependence of Chemical Equilibrium For an equilibrium reaction: A+B Kcto the following graph was obtained. Ink 0.002 0.006 0.008 0.01 0.004 1/1 Ink = -AH° + AS RTR Given the above relationship, use the graph to identify which of the following statements are "true" or "false" in this specific case. All statements refer to the forward reaction (proceeding left to right, as given) corresponding to the equilibrium constant K. The reaction is exothermic. As the temperature is decreased,...
A reaction that has a positive AH and a positive AS will be spontaneous at high temperatures spontaneous at low temperatures spontaneous at all temperatures nonspontaneous at all temperatures QUESTION 6 Which of the following statements is FALSE? Keg for a reaction written in reverse is the reciprocal of the key for the forward reaction A reaction quotient (Q) larger than Keq means that the reaction will shift toward reactants Chemical equilibrium indicates that reactants and products are present in...
5) Determine the value of Kc for the following reaction if the equilibrium concentrations are as follows: [NO2]eq = 0.85 M and [NO]eq=0.38 M. 2 NO2(g) - N2048) A) 2.2 B) 1.9 C) 0.022 D) 0.22 E) 0.53 6) Which of the following statements is true? A) If Q=K, it means the reaction is not at equilibrium. B) If Q<K, it means the forward reaction will proceed to the right) to form more reactants. C) IFO <K, it means the...
6) Which of the following statements is true? A) If Q = K, it means the reaction is not at equilibrium B) If Q< K, it means the forward reaction will proceed (to the right) to form more reactants. C) If Q< K, it means the reverse reaction will proceed (to the left) to form more reactants. D) If Q> K, it means the forward reaction will proceed (to the right) to form more reactants E) If Q> K, it...
For an equilibrium reaction: А + В С +D the following graph was obtained. 90 80 70 6е 50 40 зе 20 10 -10 -20 e.002 0.01 0.004 0.006 0.008 1/T Ink -AHo RT ASO + R Given the above relationship, use the graph to identify which of the following statements are "true" or "false" in this specific case. All statements refer to the forward reaction (proceeding left to right, as given) corresponding to the equilibrium constant K. deltaSo for...
answer all
6) cernents is true? equilibrium co the right 5) Determine the value of Ke for the following reaction if the equilibrium concentrations are as follows: (NO Joy -0.85 M and [NO_Jeg -0.38 M. 2 NO:(8) - N,Od D) 0.22 E) 0.53 A) 2.2 C) 0.022 B) 19 6) Which of the following statements is true? A) 10-K, it means the reaction is not at equilibrium. B) TOK, it means the forward reaction will proceed to the right to...
KINETICS AND EQUILIBRIUM Using an equilibrium constant to predict the direction of spont... A chemi... origineer is studying the following reaction: 2NO(9)+2H,(0) N (9)+2H,0(9) At the temperature the engineer picks, the equilibrium constant for this reaction is 0.39. The engineer charges ("fills") four reaction vessels with nitrogen monoxide and hydrogen, and lets the reaction begin. He then measures the composition of the mixture inside each vessel from time to time. His first set of measurements are shown in the table...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 36 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago