Give the IUPAC name for the following compound
Give the IUPAC name for the following compound H H₃G CH3 도 H CH2CH3 CH(CH3)2 I
IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i. a. CH3CH2CHCH2CHCH2CH2CH3 CH3 CH2CH3 CH2CH3 CH3 b. CH3CH2CCH_CH2CHCHCH2CH2CH3 CH2CH3 CH2CH3 C. CH3CH,CH,C(CH3)2C(CH3)2CH2CH3 d. CH3CH2C(CH2CH3)2CH(CH3)CH(CH2CH2CH3)2 e. (CH3CH2),CCH(CH3)CH2CH2CH3 f. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3 g. (CH2CH2CH2)4C more on mo .
Problem 47. 'rovide proper IUPAC names for each compound. CH2CH2CH3 CH2CHCH2CHCHCH; CH2CH3 CH3 48. Provide a name for the structure below. (IUPAC) CH3 419. Provide a name for the compound below. ĆUPAC) CH; CH,CECCHCH,CH2CH3 50. Provide the correct IUPAC name for the following compound. NOZ G CH 57. Give an acceptable name for the following substance. I UPAC HOCH,CH,OH S. Provide the IUPAC name for the structure below. H NO2 1. 53. Provide the IUPAC name for the following structure....
Give the IUPAC name for each compound 11.39 Give the IUPAC name for each compound. CH3 CH3 (CH3CH2)2C-CHCHCH2CHCH b. CH2 CCH2CH3 CH2CH2CH2CH2CH3 CH3 CH3 с. Cн,сс-Сн,— СH—С—сH,CH, CH2CH3
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH For the list above I currently put the following as the IUPAC names. If any are wrong can you please correct them! Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 IUPAC Name: 3,3,4-trimethylhexane IUPAC Name: 3-methyl-4-ol-heptane CH3C(CH3)CH2 IUPAC Name: 2-methylpropene CH2O IUPAC Name: methanal CH3CH(NH2)CH3 IUPAC Name: isopropylamine CH3OCH2CH2CH3 IUPAC Name: methoxyethane (ethyl methyl ether) CH(CH3)2COOH IUPAC Name: 2-methylpropanoic acid
Give an IUPAC name for the compound below. CH(CH3)2
PAC name for each cycloalkane. Give the IUPAC na 12.52 Give CH2CH3 ombo DPH CH,CH,CH3 C. "CH,CH2CH2CH3 CH,CH,CH3 CH2CH3 Bilan polis orvoor on loro –CH2CH2CH2CH3 d. CH4 CH2CH2
Problem 17.3 Give the IUPAC name for each compound. 1. PhCH(CH3)2 CH2CH3 , O CHCH ОН 3 CH3 Br 4. сі
Give the correct IUPAC name for the following compound, CH3 CEC CH3-CH, CH, CH3 O a. 3-methyl-3-hexene Ob. 3-methyl-trans-3-hexene Oc. 2-ethyl-trans-2-pentene O d. 3-methyl-cis-3-hexene Oe. 2-ethyl-2-pentene QUESTION 6 The systematic name for the following is CH3CH2-C-CH-CH3 CH3 a. 2-methyl-3-pentanal b.2-methyl-3-pentanone c. ethyl isopropyl ketone d. 2-methyl-3-propanol e. 2-methyl-3-propanone
Practice: Give IUPAC names for the following compounds. a. (CH3)3CCH2CH(CH2CH3)2 C. CH3(CH2)2CH(CH2CH2CH3)CH(CH3)2
Be sure to answer all parts. Give the IUPAC name for the following compound. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3