Homework Answers
Add Answer to:
Please draw the top section compounds and name the bottom half.
Please include IUPAC as well...
1. Give the correct IUPAC name of the following compounds. (2 pts each) Name: 3-bromo benzoic...
1. Give the correct IUPAC name of the following compounds. (2 pts each) Name: 3-bromo benzoic acid çi Name: CH3CH2CH2CHCO-K+ © HOCCH2CHCOH Name: 2-methyl-1,4-branddie ce id CH3 NHCH3 Name: HN(CH3)3*CI- Name: CH3 CH3CHNHCH3 Name: 2. Draw the structural formula for the following compounds. (2 pts each) (a) 3-ethylpentanoic acid o Hok (b) methylammonium nitrate (c) cyclohexylamine (d) sodium o-methylbenzoate
2. Name the following compounds according to IUPAC conventions: 3. Draw the structural formulas and write...
2. Name the following compounds according to IUPAC conventions: 3. Draw the structural formulas and write the IUPAC names for all possible: a. trinitrotoluenes c. dichloronitrobenzenes b. dimethylanisoles d. dibromobenzoic acids
Give the IUPAC name for each of the following compounds. Include R/S or cis/trans designation at...
Give the IUPAC name for each of the following compounds. Include R/S or cis/trans designation at the stereogenic center(s) in the name. CHE CH, O Brº on CH₃ IsoTCH Name: (35,75,95) - 3- bromo - 1 CH₂ CH3 **use cis/trans ONLY** Name: lution of an enantiomerically pure sample of (R)- 3-chloropentanoic acid is made by dissolving 2
1. Name the following compounds, IUPAC or Common. ин H₂C CH₂ 2. Draw the structure of...
1. Name the following compounds, IUPAC or Common. ин H₂C CH₂ 2. Draw the structure of the following compounds. a. 3-methyl-3phenylbutanal
Name or draw the following compounds. Please? Section 3: Nomenclature Name the following compounds using lUPAC...
Name or draw the following compounds. Please?
Section 3: Nomenclature Name the following compounds using lUPAC nomenclature- or-provide the correct structure for the provided name. 32. 36. Br Cl 33. 5-fluoro-2-methylphenol 37. 34. 38. Ethyl 3-hydroxybutanoate 35. он 39. 4-hydroxy-4-methyl-2-pentanone
. 1) Draw ChemSketch or hand-drawn and name the posible aldehyde and ketone Isomers with CHO...
. 1) Draw ChemSketch or hand-drawn and name the posible aldehyde and ketone Isomers with CHO molecular formula 2 Based on your textbook, show the vidation reaction of each isomer. If there is no reaction, type R . for the following compounds 1. Provide molecular formula 2. Provide IUPAC 3. Show addition of hydrogen reaction draw structures of the products and provide IUPAC name for the products O a 0 1) Draw (ChemSketch or hand-drawn) and name all the possible...
1. Give IUPAC names for the following compounds: O H.C =CH-C-NH2 H,00 H.CO 2. Draw structures...
1. Give IUPAC names for the following compounds: O H.C =CH-C-NH2 H,00 H.CO 2. Draw structures corresponding to each of the given names. Ethyl 4-aminobenzoate acetic formic anhydride 3. What is the order of decreasing reactivity towards nucleophilic acyl substitution for the carboxylic acid derivatives? (most reactive first) H,C-4-0--CHHC-2-N(CH) Hc--OCH, (CH),CH----OCH,
11-14 please Provide the systematic IUPAC name for each of the following compounds. Indicate RIS configurations...
11-14 please
Provide the systematic IUPAC name for each of the following compounds. Indicate RIS configurations of any stereocenters (excluding Problem-I), as well as absolute (E/Z) configurations iT applicable. For the first two molecules, draw the Newman projection about the indicated carbon bonds (--) Excluding Problem 11.) он 12.) Br 13.) 14) н.с
Provide the systematic IUPAC name for each of the following compounds. Indicate RIS configurations of any stereocenters (excluding Problem-I), as well as absolute (E/Z) configurations iT applicable....
POSTLAB QUESTIONS Name Date Instructor Organic Models and Nomenclature 1. Name the following compounds using the...
POSTLAB QUESTIONS Name Date Instructor Organic Models and Nomenclature 1. Name the following compounds using the IUPAC nomenclature system: a. CH CH.CH,CH,CH, Peptone b. CH CH CHCHCH, I methu Pentare CH, CH, c. CH CH CCH CH 2. Draw the constitutional (structural) isomers of C,H, 3. Draw the structure of trans-2-butene, and then sketch the product that would result if this compound reacted with bromine, Br, Postlab Questions: Organic Models and Nomencla 4. Circle the functional groups on the molecules...
1) Name the following carboxylic acids (use both IUPAC and common names): ОН ОН (b) (c)...
1) Name the following carboxylic acids (use both IUPAC and common names): ОН ОН (b) (c) ОН ОН (d) Br ОН ОН NH2 2) Draw the condensed and line structures for the following compounds (a) 3,4-dimethylhexanoic acid (b) Phenylacetic acid (c) 3,4-dinitrobenzoic acid (d) 2,2,3-triflurobutanoic acid (e) 3-hydroxybutanoic acid (1) o-hydroxybenzoic acid (g) a-aminopropionic acid 3) Name the following dicarboxylic acids (use both IUPAC and common names) Он (а) НО ОН НО. (b) он ОН ОН (d) ОН он ОН...
1. Give the correct IUPAC name of the following compounds. (2 pts each) Name: 3-bromo benzoic acid çi Name: CH3CH2CH2CHCO-K+ © HOCCH2CHCOH Name: 2-methyl-1,4-branddie ce id CH3 NHCH3 Name: HN(CH3)3*CI- Name: CH3 CH3CHNHCH3 Name: 2. Draw the structural formula for the following compounds. (2 pts each) (a) 3-ethylpentanoic acid o Hok (b) methylammonium nitrate (c) cyclohexylamine (d) sodium o-methylbenzoate
2. Name the following compounds according to IUPAC conventions: 3. Draw the structural formulas and write the IUPAC names for all possible: a. trinitrotoluenes c. dichloronitrobenzenes b. dimethylanisoles d. dibromobenzoic acids
Give the IUPAC name for each of the following compounds. Include R/S or cis/trans designation at the stereogenic center(s) in the name. CHE CH, O Brº on CH₃ IsoTCH Name: (35,75,95) - 3- bromo - 1 CH₂ CH3 **use cis/trans ONLY** Name: lution of an enantiomerically pure sample of (R)- 3-chloropentanoic acid is made by dissolving 2
1. Name the following compounds, IUPAC or Common. ин H₂C CH₂ 2. Draw the structure of the following compounds. a. 3-methyl-3phenylbutanal
Name or draw the following compounds. Please?
Section 3: Nomenclature Name the following compounds using lUPAC nomenclature- or-provide the correct structure for the provided name. 32. 36. Br Cl 33. 5-fluoro-2-methylphenol 37. 34. 38. Ethyl 3-hydroxybutanoate 35. он 39. 4-hydroxy-4-methyl-2-pentanone
. 1) Draw ChemSketch or hand-drawn and name the posible aldehyde and ketone Isomers with CHO molecular formula 2 Based on your textbook, show the vidation reaction of each isomer. If there is no reaction, type R . for the following compounds 1. Provide molecular formula 2. Provide IUPAC 3. Show addition of hydrogen reaction draw structures of the products and provide IUPAC name for the products O a 0 1) Draw (ChemSketch or hand-drawn) and name all the possible...
1. Give IUPAC names for the following compounds: O H.C =CH-C-NH2 H,00 H.CO 2. Draw structures corresponding to each of the given names. Ethyl 4-aminobenzoate acetic formic anhydride 3. What is the order of decreasing reactivity towards nucleophilic acyl substitution for the carboxylic acid derivatives? (most reactive first) H,C-4-0--CHHC-2-N(CH) Hc--OCH, (CH),CH----OCH,
11-14 please
Provide the systematic IUPAC name for each of the following compounds. Indicate RIS configurations of any stereocenters (excluding Problem-I), as well as absolute (E/Z) configurations iT applicable. For the first two molecules, draw the Newman projection about the indicated carbon bonds (--) Excluding Problem 11.) он 12.) Br 13.) 14) н.с
Provide the systematic IUPAC name for each of the following compounds. Indicate RIS configurations of any stereocenters (excluding Problem-I), as well as absolute (E/Z) configurations iT applicable....
POSTLAB QUESTIONS Name Date Instructor Organic Models and Nomenclature 1. Name the following compounds using the IUPAC nomenclature system: a. CH CH.CH,CH,CH, Peptone b. CH CH CHCHCH, I methu Pentare CH, CH, c. CH CH CCH CH 2. Draw the constitutional (structural) isomers of C,H, 3. Draw the structure of trans-2-butene, and then sketch the product that would result if this compound reacted with bromine, Br, Postlab Questions: Organic Models and Nomencla 4. Circle the functional groups on the molecules...
1) Name the following carboxylic acids (use both IUPAC and common names): ОН ОН (b) (c) ОН ОН (d) Br ОН ОН NH2 2) Draw the condensed and line structures for the following compounds (a) 3,4-dimethylhexanoic acid (b) Phenylacetic acid (c) 3,4-dinitrobenzoic acid (d) 2,2,3-triflurobutanoic acid (e) 3-hydroxybutanoic acid (1) o-hydroxybenzoic acid (g) a-aminopropionic acid 3) Name the following dicarboxylic acids (use both IUPAC and common names) Он (а) НО ОН НО. (b) он ОН ОН (d) ОН он ОН...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 10 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago