Classify the molecule shown a. Steroid b. Glycerophospholipid c. Fatty acid d. Triacylglycerol e. Sphingomyelin
19) The structure is that of a CH3-(CH2)14-0-0-(CH2)25-CH3 A) fatty acid B) steroid C) wax D) triacylglycerol E) glycerophospholipid 20) What type of lipid is the following compound? CH,OC(CH2) 16CH3 10 CHOC(CH2) 14CH3 CHOC(CH2)18CH A) steroid B) bile salt C) glycerophospholipid D) triacylglycerol E) wax
erone sphingomyelin whale blubber stearic acid Faty acid Soap Triacylglycerol Wax GPL Steroid Submit Request Answer
How is this molecule classified? НО НО ОН ОН ОН O prostaglandin fatty acid Osphingosine steroid glycerophospholipid The hydrolysis of an unknown lipid produces one glycerol molecule, two stearic acid molecules, choline, and an (unspecified) anion. What kind of lipid was the unknown? O a wax O a triacylglycerol O a glycerophospholipid O a fatty acid O a sphingomyelin What is the correct number for the ketone functional group in this structure? CH, NH, НО CH, | / NH7 Н-...
What type of lipid is propylene glycol? (phospholipid, steroid, fatty acid, wax, triacylglycerol, or neither) If it contain either one, draw its structure and tell what is the basic form.
Globotriaosylceramide (Gb3/CD77) is what type of lipid? a. sphingomylin b. cerebroside c. steroid d. glycerophospholipid e. isoprenoid d. triacylglyceride e eicosanoid
8.5 pts) Choose the saturated triacylglycerol from the compounds below. HC-0- HC-00 HC-0 1.C- 0-C 9. (5 pts) Choose the unsaturated triacylglycerol from the compounds below. H. CO HC-0-0 H. COC HC-0-0 10. (5 pts) Identify the components (glycerol, fatty acid, phosphate, amino alcohol, steroid nucleus, sphingosine) contained in each of the following lipids. glycerophospholipid sphingomyelin aldosterone Linoleic acid 11. (5 pts) Match each lipoprotein (1-4) with its description (a-d). 1. chylomicron 2. VLDL 3. LDL 4. HDL a. "good"...
please do a b and c
1) Draw the structure of a. 16:2(A1") fatty acid b. 18:5(4.11,13.15) fatty acid c. The glycerophospholipid composing above fatty acids and ethanolamine as a head-group constituent
1) Draw the structure of a. 16:2(A1") fatty acid b. 18:5(4.11,13.15) fatty acid c. The glycerophospholipid composing above fatty acids and ethanolamine as a head-group constituent
Draw the fatty acid products of the saponification of the triacylglycerol (triglyceride) shown.
Question 22 (1 point) 0-CH3 Classify this molecule: CH3-C-CH2-CH3 0-CH3 none are correct carbohydrate TG (triglyceride/triacylglycerol) amino acid fatty acid
What type of lipid contains the structural core shown here? A) fatty acid B) steroid C) wax D) triglyceride E) sphingolipid What is the process of forming ketone bodies known as? A) ketogenesis B) ketone oxidation C) ketone cycle D) ketone transport chain E) ketolysis How many cycles of ß-oxidation are required to completely break down CH3(CH2)14CO2H? A) 1 B) 7 C) 8. D) 14 E) 16 What glycolytic intermediate is glycerol, formed by hydrolysis of triacylglycerols, first converted to...