Homework Answers
Add Answer to:
, A profit-maximizing monopolist produces electricity. Its cost function is given by C(a)-6q The price of...
1. A monopolist faces demand given by P=18-0.50(MR-18-Q) and produces with a constant marginal cost of...
1. A monopolist faces demand given by P=18-0.50(MR-18-Q) and produces with a constant marginal cost of $10. Assume that there are no fixed costs. i. Solve for the profit-maximizing quantity and price. What is the firm's profit? ii. If this was a competitive market, what would the equilibrium price and quantity be? iii. Graph D, MR, and MC curves for the monopolist. Show the area that represents the social gain if the monopolist was forced to produce and price at...
Suppose a profit maximizing monopolist has total cost and marginal cost as follow:
Suppose a profit maximizing monopolist has total cost and marginal
cost as follow:1. Suppose a profit-maximizing monopolist has total cost and marginal cost as follow: \(\mathrm{TC}=0.1 Q^{2}+Q+10\) and \(\mathrm{MC}=0.2 Q+1\). It faces the demand curve \(\mathrm{Q}=35-5^{\mathrm{P}} .(35\) points \()\)a) What are the price, output, and profit for this monopolist?b) Carefully draw the diagram that illustrates your answers.c) What are the equilibrium price, output, and total profit if this is a perfectly competitive market?d) Compare the results between monopoly and perfect...
Consider a single-price monopolist (i.e. the monopolist cannot price discriminate) facing the following market demand curve:...
Consider a single-price monopolist (i.e. the monopolist cannot price discriminate) facing the following market demand curve: P = 120 − Q. The monopolist has constant marginal cost of $20 and zero fixed cost. (a) Determine the monopolist’s profit maximizing quantity, denoted QM, and profit maximizing price, denoted PM. (b) Determine the quantity and price that would result in the market if this instead were a competitive market, denoted QC and PC, respectively. (c) Draw a picture of the market demand...
draw a graph depicting the MR, MC and demand curves for the monopolist. label the profit-maximizing...
draw a graph depicting the MR, MC and demand curves for the monopolist. label the profit-maximizing quantity of output and the price the monopolist will charge
2. Consider a market with one firm. The firm's cost function is c(g)-2, and the market...
2. Consider a market with one firm. The firm's cost function is c(g)-2, and the market demand is Q 1000-P (a) Suppose the monopolist does not exereise any market power and behaves like a competitive firm. Find the equilibrium price, the quantity produced and the firm's profit. (b) Suppose the monopolist exercises market power but does not price dis- criminate (that is, the firm uses MR MC pricing strategy). Find the price the firm charges, the quantity produced, and the...
1. A monopolist has costs given by C = Q and faces demand curve P =...
1. A monopolist has costs given by C = Q and faces demand curve P = 12 - Q. a. Provide a labeled diagram that shows the monopolist's MC, AC, P and MR curves. b. Illustrate and calculate the profit maximizing level of output, price and profits. Calculate the elasticity of demand at the monopoly equilibrium price. Confirm that MR =P(1 + 1/n] d. illustrate and calculate the efficiency loss. e. Calculate the per-unit subsidy required to eliminate the efficiency...
5. A monopolist faces a demand curve P = 60 – 2Q and initially faces a...
5. A monopolist faces a demand curve P = 60 – 2Q and initially faces a constant marginal cost MC = 4. (a) Calculate the profit-maximizing monopoly quantity and price, and compute the monopolist's total rev- enue and profits at the optimal price. (b) Suppose that the monopolist's marginal cost in- creases to MC = 8. Verify that the monopolist's total revenue goes down. (c) Suppose that all firms in a perfectly competitive equilibrium had a constant marginal cost MC...
A monopolist faces a market demand curve given by
A monopolist faces a market demand curve given by Q=70-P a. If the monopolist can produce at constant average and marginal costs ofAC-MC-6, what output level will the monopolist choose to maximize profits? What is the price at this output level? What are the monopolist's profits? b. Assume instead that the monopolist has a cost structure where total costs are described by C(Q) = 0.25Q2 - 5Q + 300. With the monopolist facing the same market demand and marginal revenue, what price-quantity combination will be chosen now...
10. The monopoly firm's profit-maximizing price is: determined for the quantity of output at which MR...
10. The monopoly firm's profit-maximizing price is: determined for the quantity of output at which MR > MC by the greatest amount. given by the point on the ATC curve for the profit-maximizing quantity. given by the point on the demand curve for the profit-maximizing quantity. found where MR > MC at the monopolist's profit-maximizing quantity of output.
20y25 Consider a product that has a cost function c(y) (А-р) Demand for this product is...
20y25 Consider a product that has a cost function c(y) (А-р) Demand for this product is represented by the demand curve: y (NOTE: this the demand curve, not the inverse demand curve) 1) Write the profit maximization problem for a monopolist 2) Use the envelope theorem to determine whether the monopolist's profits will increase or decrease with b. C 3)What is the elasticity of demand (in terms of p)? What restriction must be on the elasticity of demand for a...
1. A monopolist faces demand given by P=18-0.50(MR-18-Q) and produces with a constant marginal cost of $10. Assume that there are no fixed costs. i. Solve for the profit-maximizing quantity and price. What is the firm's profit? ii. If this was a competitive market, what would the equilibrium price and quantity be? iii. Graph D, MR, and MC curves for the monopolist. Show the area that represents the social gain if the monopolist was forced to produce and price at...
Suppose a profit maximizing monopolist has total cost and marginal
cost as follow:1. Suppose a profit-maximizing monopolist has total cost and marginal cost as follow: \(\mathrm{TC}=0.1 Q^{2}+Q+10\) and \(\mathrm{MC}=0.2 Q+1\). It faces the demand curve \(\mathrm{Q}=35-5^{\mathrm{P}} .(35\) points \()\)a) What are the price, output, and profit for this monopolist?b) Carefully draw the diagram that illustrates your answers.c) What are the equilibrium price, output, and total profit if this is a perfectly competitive market?d) Compare the results between monopoly and perfect...
2. Consider a market with one firm. The firm's cost function is c(g)-2, and the market demand is Q 1000-P (a) Suppose the monopolist does not exereise any market power and behaves like a competitive firm. Find the equilibrium price, the quantity produced and the firm's profit. (b) Suppose the monopolist exercises market power but does not price dis- criminate (that is, the firm uses MR MC pricing strategy). Find the price the firm charges, the quantity produced, and the...
1. A monopolist has costs given by C = Q and faces demand curve P = 12 - Q. a. Provide a labeled diagram that shows the monopolist's MC, AC, P and MR curves. b. Illustrate and calculate the profit maximizing level of output, price and profits. Calculate the elasticity of demand at the monopoly equilibrium price. Confirm that MR =P(1 + 1/n] d. illustrate and calculate the efficiency loss. e. Calculate the per-unit subsidy required to eliminate the efficiency...
5. A monopolist faces a demand curve P = 60 – 2Q and initially faces a constant marginal cost MC = 4. (a) Calculate the profit-maximizing monopoly quantity and price, and compute the monopolist's total rev- enue and profits at the optimal price. (b) Suppose that the monopolist's marginal cost in- creases to MC = 8. Verify that the monopolist's total revenue goes down. (c) Suppose that all firms in a perfectly competitive equilibrium had a constant marginal cost MC...
10. The monopoly firm's profit-maximizing price is: determined for the quantity of output at which MR > MC by the greatest amount. given by the point on the ATC curve for the profit-maximizing quantity. given by the point on the demand curve for the profit-maximizing quantity. found where MR > MC at the monopolist's profit-maximizing quantity of output.
20y25 Consider a product that has a cost function c(y) (А-р) Demand for this product is represented by the demand curve: y (NOTE: this the demand curve, not the inverse demand curve) 1) Write the profit maximization problem for a monopolist 2) Use the envelope theorem to determine whether the monopolist's profits will increase or decrease with b. C 3)What is the elasticity of demand (in terms of p)? What restriction must be on the elasticity of demand for a...
Most questions answered within 3 hours.
-
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 4 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 5 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 19 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago