2NO (g) +Cl2 (g) → NOCl (g) Experiment concentration of NO (M) concentration of Cl2(M) Rate...
2NO (g) +Cl2 (g) → NOCl (g)
| Experiment | concentration of NO (M) | concentration of Cl2(M) | Rate (M/s) |
| 1 | 0.05 | 0.01 | 3.40 x 10-4 |
| 2 | 0.025 | 0.01 | 8.50 x 10-5 |
| 3 | 0.025 | 0.04 | 3.40 x 10-4 |
What is the reaction order with respect to NO ? the reaction order with respect to reaction order to Cl2 ? overall reaction order ? what is the rate constant ?
Homework Answers
![order with order with overall respect to No=2 respect to C₂ = 1 order = 2+1=3. Rate = k [NO] 2 [2] consider equation 3.40810-](http://img.homeworklib.com/questions/10727740-5f0f-11eb-9172-215b60cfc900.png?x-oss-process=image/resize,w_560)
I hope you like the answer and
comment for further queries.
Add Answer to:
2NO (g) +Cl2 (g) → NOCl (g)
Experiment
concentration of NO (M)
concentration of Cl2(M)
Rate...
QUESTION 14 2NO (g) +Cl2 (g) → NOCl (g) Experiment concentration of NO (M) concentration of...
QUESTION 14 2NO (g) +Cl2 (g) → NOCl (g) Experiment concentration of NO (M) concentration of Cl2(M) Rate (M/s) 1 0.09 0.04 3.40 x 10-4 2 0.045 0.04 8.50 x 10-5 3 0.045 0.16 3.40 x 10-4 What is the reaction order with respect to NO ? the reaction order with respect to reaction order to Cl2 ? overall reaction order ? what is the rate constant ? * All orders are integers * Rate constant: Please report 3 significant figures. Numbers only,...
2NO(g) +Cl2(g) + NOCI (8) Experiment concentration of NO (M) 0.05 0.025 0.025 concentration of Cl2(M)...
2NO(g) +Cl2(g) + NOCI (8) Experiment concentration of NO (M) 0.05 0.025 0.025 concentration of Cl2(M) Rate (M/s) 0.015 0.015 8.50 x 10-5 0.06 3.40 x 10-4 3.40 x 10-4 What is the reaction order with respect to NO order to Cl2 ? overall reaction order ? the reaction order with respect to reaction ? what is the rate constant • All orders are integers • Rate constant: Please report 3 significant figures. Numbers only, No unit. No scientific notation.
2NO (g) +Cl2 (g) → NOCI (g) Experiment concentration of NO (M) 0.096 concentration of Cl2(M)...
2NO (g) +Cl2 (g) → NOCI (g) Experiment concentration of NO (M) 0.096 concentration of Cl2(M) Rate (M/s) 0.05 3.40 x 10-4 0.05 8.50 x 10-5 0.10 3.40 x 10-4 0.024 0.024 What is the reaction order with respect to NO ? the reaction order with respect to reaction order to Cl2 ? overall reaction order ? what is the rate constant * All orders are integers * Rate constant: Please report 3 significant figures. Numbers only, No unit. No...
1) 2) 3) 2NO(g) +Cl2 (g) → NOCI (8) Experiment concentration of NO (M) 0.09 0.045...
1)
2)
3)
2NO(g) +Cl2 (g) → NOCI (8) Experiment concentration of NO (M) 0.09 0.045 0.045 concentration of Cl2(M) Rate (M/s) 0.01 3.40 x 10-4 8.50 x 10-5 0.04 3.40 x 10-4 0.01 What is the reaction order with respect to NO to Cl2 ? overall reaction order ? the reaction order with respect to reaction order ? what is the rate constant * All orders are integers * Rate constant: Please report 3 significant figures. Numbers only, No...
1) 2) 3) A proposed mechanism for the reaction 2NO(g) +2H2(g) → N2(g) + 2H2O(g): Step...
1)
2)
3)
A proposed mechanism for the reaction 2NO(g) +2H2(g) → N2(g) + 2H2O(g): Step 1: 2NO(g) + N2O2(g) (very fast, reversible) Step 2: N2O2(g) + H2(g) N20(g) + H20(g) (slow) Step 3: N2O(g) + H2(g) →N2(g) +H2O(g) (fast) What is the rate law for the overall reaction? Ok[NO2 Ok[NO]2[H212 O k[NO]2[H2] Ok[N20][H2] k[NO]1/2[H2] 2NO(g) +Cl2 (g) → NOCI (8) Experiment concentration of NO (M) 0.09 0.045 0.045 concentration of Cl2(M) Rate (M/s) 0.01 3.40 x 10-4 8.50 x...
1) 2) 3) The slope and intercept of an Arrhenius plot made for the first-order decomposition...
1)
2)
3)
The slope and intercept of an Arrhenius plot made for the first-order decomposition reaction are -2864.3 K and 23.279 at 303K, what is the value of the activation energy (KJ/mol) at this temperature? The value of Keq for the following reaction is 0.340: A (g) +B (g)=C(g) +D (g) The value of Keq at the same temperature for the reaction below is 3C (g) + 3D (g) = 3A (g) + 3B (g) 2NO(g) +Cl2 (g) →...
Consider the reaction between NO and Cl2 to form NOCl: 2NO(g)+Cl2(g)⇌2NOCl(g) A reaction mixture at a...
Consider the reaction between NO and Cl2 to form NOCl: 2NO(g)+Cl2(g)⇌2NOCl(g) A reaction mixture at a certain temperature initially contains only [NO]= 0.65 M and [Cl2]= 0.64 M. After the reaction comes to equilibrium, the concentration of NOCl is 0.1 M. Find the value of the equilibrium constant (Kc) at this temperature.
Consider the reaction between NO and Cl2 to form NOCl: 2NO(g)+Cl2(g)⇌2NOCl(g) A reaction mixture at a...
Consider the reaction between NO and Cl2 to form NOCl: 2NO(g)+Cl2(g)⇌2NOCl(g) A reaction mixture at a certain temperature initially contains only [NO]= 0.66 M and [Cl2]= 0.51 M . After the reaction comes to equilibrium, the concentration of NOCl is 0.21 M . a)Find the value of the equilibrium constant (Kc) at this temperature.
Consider the reaction between NO and Cl2 to form NOCl: 2NO(g)+Cl2(g)⇌2NOCl(g) A reaction mixture at a...
Consider the reaction between NO and Cl2 to form NOCl: 2NO(g)+Cl2(g)⇌2NOCl(g) A reaction mixture at a certain temperature initially contains only [NO]= 0.65 M and [Cl2]= 0.53. After the reaction comes to equilibrium, the concentration of NOCl is 0.25 M . ---Find the value of the equilibrium constant (Kc) at this temperature. Express your answer using two significant figures.
Consider the reaction between NO and Cl2 to form NOCl: 2NO(g)+Cl2(g)⇌2NOCl(g) A reaction mixture at a...
Consider the reaction between NO and Cl2 to form NOCl: 2NO(g)+Cl2(g)⇌2NOCl(g) A reaction mixture at a certain temperature initially contains only [NO]= 0.67 M and [Cl2]= 0.65. After the reaction comes to equilibrium, the concentration of NOCl is 0.15 M. Find the value of the equilibrium constant (Kc) at this temperature. Express your answer using two significant figures.
2NO(g) +Cl2(g) + NOCI (8) Experiment concentration of NO (M) 0.05 0.025 0.025 concentration of Cl2(M) Rate (M/s) 0.015 0.015 8.50 x 10-5 0.06 3.40 x 10-4 3.40 x 10-4 What is the reaction order with respect to NO order to Cl2 ? overall reaction order ? the reaction order with respect to reaction ? what is the rate constant • All orders are integers • Rate constant: Please report 3 significant figures. Numbers only, No unit. No scientific notation.
2NO (g) +Cl2 (g) → NOCI (g) Experiment concentration of NO (M) 0.096 concentration of Cl2(M) Rate (M/s) 0.05 3.40 x 10-4 0.05 8.50 x 10-5 0.10 3.40 x 10-4 0.024 0.024 What is the reaction order with respect to NO ? the reaction order with respect to reaction order to Cl2 ? overall reaction order ? what is the rate constant * All orders are integers * Rate constant: Please report 3 significant figures. Numbers only, No unit. No...
1)
2)
3)
2NO(g) +Cl2 (g) → NOCI (8) Experiment concentration of NO (M) 0.09 0.045 0.045 concentration of Cl2(M) Rate (M/s) 0.01 3.40 x 10-4 8.50 x 10-5 0.04 3.40 x 10-4 0.01 What is the reaction order with respect to NO to Cl2 ? overall reaction order ? the reaction order with respect to reaction order ? what is the rate constant * All orders are integers * Rate constant: Please report 3 significant figures. Numbers only, No...
1)
2)
3)
A proposed mechanism for the reaction 2NO(g) +2H2(g) → N2(g) + 2H2O(g): Step 1: 2NO(g) + N2O2(g) (very fast, reversible) Step 2: N2O2(g) + H2(g) N20(g) + H20(g) (slow) Step 3: N2O(g) + H2(g) →N2(g) +H2O(g) (fast) What is the rate law for the overall reaction? Ok[NO2 Ok[NO]2[H212 O k[NO]2[H2] Ok[N20][H2] k[NO]1/2[H2] 2NO(g) +Cl2 (g) → NOCI (8) Experiment concentration of NO (M) 0.09 0.045 0.045 concentration of Cl2(M) Rate (M/s) 0.01 3.40 x 10-4 8.50 x...
1)
2)
3)
The slope and intercept of an Arrhenius plot made for the first-order decomposition reaction are -2864.3 K and 23.279 at 303K, what is the value of the activation energy (KJ/mol) at this temperature? The value of Keq for the following reaction is 0.340: A (g) +B (g)=C(g) +D (g) The value of Keq at the same temperature for the reaction below is 3C (g) + 3D (g) = 3A (g) + 3B (g) 2NO(g) +Cl2 (g) →...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 55 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago