Homework Answers
Doubt in this then comment below...i will explain you..
By rules and regulations we are allow to do only one question at a time..so i do only 2nd
.
please thumbs up for this solution..thanks..
.
Add Answer to:
Name: 1. Find a diagonlizing matrix P for the matrix A and write A in the...
Linear Algebra Matrices and Spaces I am having some troubles here, thanks in advance! 3. Use...
Linear Algebra Matrices and Spaces
I am having some troubles here, thanks in advance!
3. Use the Gram-Schmidt process to construct an orthogonal basis of the subspace of V = C[0, 1] spanned by f(x) = 1, g(2) = x, and h(x) = er where V has the inner product defined by <f.g >= S. fc)g(x)dr.
Linear Algebra. Please show all steps. 3. Use the Gram-Schmidt process to construct an orthogonal basis...
Linear Algebra. Please show all steps.
3. Use the Gram-Schmidt process to construct an orthogonal basis of the subspace of V = CⓇ [0,1] spanned by f(0) = 1, g(x) = x, and h(x) = e" where V has the inner product defined by < 5,9 >= S f(x)g(x)da. TI 11
1: 1 131 2 Given matrix A 2 2 2. matrix P and I S set 2. a) Show that matrix P diaqonalizes A and find D(diagonal m...
1: 1 131 2 Given matrix A 2 2 2. matrix P and I S set 2. a) Show that matrix P diaqonalizes A and find D(diagonal matnx) that matches. 6) Find the eigen values of A Observe that the columns of P form set S c) orthogonal Set using the inner product standard show that set S is not an Use the Gram- Schmidt process to get an orthonormal set from S using inner product standard
1: 1 131...
LA class!! 1. Find a diagonlizing matrix P for the matrix A and write A in...
LA class!!
1. Find a diagonlizing matrix P for the matrix A and write A in the form A = PDP-1 where D is a diagonal matrix. AE 5 -6 3 3 -4 3 0 0 2 Also, use the diagonalization of A to compute A8, A-8, and eA.
5.3: Diagonalization Find the diagonal matrix D and invertible matrix P such that A- PDp-1 if pos...
I
5.3: Diagonalization Find the diagonal matrix D and invertible matrix P such that A- PDp-1 if possible. If it is not possibl which eigenspace(s) are to blame. e, eosplain A-1 2 1 3 -1 A 1 1 1 5 0 3 A- 0 2 0 し406
5.3: Diagonalization Find the diagonal matrix D and invertible matrix P such that A- PDp-1 if possible. If it is not possibl which eigenspace(s) are to blame. e, eosplain A-1 2 1 3...
1. Consider the following three vectors in R Vi (1,-1,-11), v2 (3,0,-3,2), v3- (4,0,-2,2) (a) Perform...
1. Consider the following three vectors in R Vi (1,-1,-11), v2 (3,0,-3,2), v3- (4,0,-2,2) (a) Perform the Gram-Schmidt process to find an orthonormal basis [ei,e2,e3j of the subspace spanned by {vi, V2, V3) (b) Find the QR decomposition of the following matrix A QR: 412 922 231 12 113 q13 q23 43300 14 924 934 -1 0 0 0 122 r23 Relate (rij] to the Gram-Schmidt process. (c) Can you say anything about either Qor without calculation? Show that ATA...
Problem 1. Let the inner product (,) be defined by (u.v)xu (x)v (x) dx, and let the norm Iilbe de...
Problem 1. Let the inner product (,) be defined by (u.v)xu (x)v (x) dx, and let the norm Iilbe defined by lIul-)Corhe target funtio), and work with the approximating space P4 Use Gram-Schmidt orthogonalization with this inner product to find orthogonal polynomials (x) through degree four. Standardize your polynomials such that p: (1) 1. (a) Form the five-by-five Gram matrix for this inner product with the basis functions p (x) degree 4 approximation o f (x) using the specified norm,...
4. Consider the vector space V = R3 and the matrix 2 -1 -1 2 -1 -1 0 2 We can define an inner product on V by (v, w) =...
4. Consider the vector space V = R3 and the matrix 2 -1 -1 2 -1 -1 0 2 We can define an inner product on V by (v, w) = v'Mw. where vt indicates the transpose. Please note this is NOT the standard dot product. It is a inner product different (a) (5 points) Apply the Gram-Schmidt process to the basis E = {e1,e2, e3} (the standard basis) to find an orthogonal basis B.
4. Consider the vector space...
2. Consider the vector space C([0, 1]) consisting of all continuous functions f: [0,1]-R with the...
2. Consider the vector space C([0, 1]) consisting of all continuous functions f: [0,1]-R with the weighted inner product, (f.g)-f(x) g(x) x dr. (a) Let Po(z) = 1, Pi(z) = x-2, and P2(x) = x2-6r + 흡 Show that {Po, pi,r) are orthogonal with respect to this inner product b) Use Gram-Schmidt on f(x)3 to find a polynomial pa(r) which is orthogonal to each of po P1 P2 You may use your favorite web site or software to calculate the...
please provide step by step solution Thank you (1 point) Use the inner product (5,8) =...
please provide step by step solution
Thank you
(1 point) Use the inner product (5,8) = $* f()g(x) dx in the vector space P(R) of polynomials to find the orthogonal projection of f(x) = 2x2 + 4 onto the subspace V spanned by g(x) = x and h(x) = 1. (Caution: x and 1 do not form an orthogonal basis of V.) projy(f) =
Linear Algebra Matrices and Spaces
I am having some troubles here, thanks in advance!
3. Use the Gram-Schmidt process to construct an orthogonal basis of the subspace of V = C[0, 1] spanned by f(x) = 1, g(2) = x, and h(x) = er where V has the inner product defined by <f.g >= S. fc)g(x)dr.
Linear Algebra. Please show all steps.
3. Use the Gram-Schmidt process to construct an orthogonal basis of the subspace of V = CⓇ [0,1] spanned by f(0) = 1, g(x) = x, and h(x) = e" where V has the inner product defined by < 5,9 >= S f(x)g(x)da. TI 11
1: 1 131 2 Given matrix A 2 2 2. matrix P and I S set 2. a) Show that matrix P diaqonalizes A and find D(diagonal matnx) that matches. 6) Find the eigen values of A Observe that the columns of P form set S c) orthogonal Set using the inner product standard show that set S is not an Use the Gram- Schmidt process to get an orthonormal set from S using inner product standard
1: 1 131...
LA class!!
1. Find a diagonlizing matrix P for the matrix A and write A in the form A = PDP-1 where D is a diagonal matrix. AE 5 -6 3 3 -4 3 0 0 2 Also, use the diagonalization of A to compute A8, A-8, and eA.
I
5.3: Diagonalization Find the diagonal matrix D and invertible matrix P such that A- PDp-1 if possible. If it is not possibl which eigenspace(s) are to blame. e, eosplain A-1 2 1 3 -1 A 1 1 1 5 0 3 A- 0 2 0 し406
5.3: Diagonalization Find the diagonal matrix D and invertible matrix P such that A- PDp-1 if possible. If it is not possibl which eigenspace(s) are to blame. e, eosplain A-1 2 1 3...
1. Consider the following three vectors in R Vi (1,-1,-11), v2 (3,0,-3,2), v3- (4,0,-2,2) (a) Perform the Gram-Schmidt process to find an orthonormal basis [ei,e2,e3j of the subspace spanned by {vi, V2, V3) (b) Find the QR decomposition of the following matrix A QR: 412 922 231 12 113 q13 q23 43300 14 924 934 -1 0 0 0 122 r23 Relate (rij] to the Gram-Schmidt process. (c) Can you say anything about either Qor without calculation? Show that ATA...
Problem 1. Let the inner product (,) be defined by (u.v)xu (x)v (x) dx, and let the norm Iilbe defined by lIul-)Corhe target funtio), and work with the approximating space P4 Use Gram-Schmidt orthogonalization with this inner product to find orthogonal polynomials (x) through degree four. Standardize your polynomials such that p: (1) 1. (a) Form the five-by-five Gram matrix for this inner product with the basis functions p (x) degree 4 approximation o f (x) using the specified norm,...
4. Consider the vector space V = R3 and the matrix 2 -1 -1 2 -1 -1 0 2 We can define an inner product on V by (v, w) = v'Mw. where vt indicates the transpose. Please note this is NOT the standard dot product. It is a inner product different (a) (5 points) Apply the Gram-Schmidt process to the basis E = {e1,e2, e3} (the standard basis) to find an orthogonal basis B.
4. Consider the vector space...
2. Consider the vector space C([0, 1]) consisting of all continuous functions f: [0,1]-R with the weighted inner product, (f.g)-f(x) g(x) x dr. (a) Let Po(z) = 1, Pi(z) = x-2, and P2(x) = x2-6r + 흡 Show that {Po, pi,r) are orthogonal with respect to this inner product b) Use Gram-Schmidt on f(x)3 to find a polynomial pa(r) which is orthogonal to each of po P1 P2 You may use your favorite web site or software to calculate the...
please provide step by step solution
Thank you
(1 point) Use the inner product (5,8) = $* f()g(x) dx in the vector space P(R) of polynomials to find the orthogonal projection of f(x) = 2x2 + 4 onto the subspace V spanned by g(x) = x and h(x) = 1. (Caution: x and 1 do not form an orthogonal basis of V.) projy(f) =
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 28 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 1 hour ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 4 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago