Homework Answers
V1 1 0 value v (here value will be replace by given input voltage )
R1 1 2 200 ohm
L1 2 3 10 mH
C1 3 0 1 uF
R2 1 4 100 ohm
L2 4 5 10 mH
C2 5 0 1 uF
R3 1 6 50 ohm
L3 6 7 10 mH
C3 7 0 1 uF
R4 1 8 50 ohm
L4 8 9 10 mH
C4 9 0 1 uF
.AC lin 1 Freq Freq ( put the value of given freq at place of Freq)
Add Answer to:
write netlist script of this circuit (any spice program)
32000 ๑) 31000 ๑) 3500 ๑ 3250...
2. [5pts] Write a MATLAB script that can calculate the equivalent resistance in a circuit that all electrical resis...
2. [5pts] Write a MATLAB script that can calculate the equivalent resistance in a circuit that all electrical resistors are connected in parallel: . Print the title 'Equivalent Resistance for Resistors Connected in Parallel' on your output. . Check the size of vector resistor to see how many resistors in the circuit. .Check each individual resistance to see any 0 or negative resistance. If there is any, print message 'ERROR', then finish the program. . Otherwise, calculate the equivalent resistance...
Programming Exercise 4.9 Write a script named numberlines.py. This script creates a program listing from a...
Programming Exercise 4.9
Write a script named numberlines.py. This script
creates a program listing from a source program.
This script should:
Prompt the user for the names of two files.
The input filename could be the name of the script itself, but
be careful to use a different output filename!
The script copies the lines of text from the input file to the
output file, numbering each line as it goes.
The line numbers should be right-justified in 4 columns,...
this is for script for terminal or putty question 1------ 1. Write a PERL script/program based...
this is for script for terminal or putty question 1------ 1. Write a PERL script/program based on the following requirements. The program should to prompt the user for how many courses the plan to take next semester and ask the user to enter each of those courses before displaying all the information entered back on the screen. question 2------ 2. Write a PERL script that defines/declares an array or a list of elements. The array should hold three-letter abbreviations for...
Write a program in a script file that finds the smallest odd integer that is also...
Write a program in a script file that finds the smallest odd integer that is also divisible by 3 and whose cube is greater than 4000. Use a loop in the program. The loop should start from 1 and stop when the number is found. The program should print the message: The required number is: [and then prints the number]
Describe why you might want to write a script vs. a C program. Describe two example...
Describe why you might want to write a script vs. a C program. Describe two example situations that illustrate your answer, one each for script and C.
In Spyder, write a Python program (script) that has a variable num that is set to...
In Spyder, write a Python program (script) that has a variable num that is set to the value 35607. Your program is to display the last and second-last digit of the value stored in num. For example, when num contains the value 35607, your program should print the last digit of 35607 is 7 and the second last digit of 35607 is 0 respectively. Your program should be able to work with whatever number is stored in the variable num....
Q2) Write a shell script program to read a number then checks the number using the...
Q2) Write a shell script program to read a number then checks the number using the following: If the number is =100 print (number is equal to 100) If the number is>100 print( number is less than 100) If the number is<100 print( number is greater than 100)
Write program and programmer information as comments at the top of the script. Create a text...
Write program and programmer information as comments at the top of the script. Create a text file called words.txt and include at least 20 English dictionary-based words in your folder. Program must read the list of words from the file into list data structure. Program chooses a random word from the list and starts asking player to guess the word one character at a time until player wins or runs out of predefined no. of tries. Game continues until the...
matlab Write a script using a loop that will take a vector (of any size) of...
matlab
Write a script using a loop that will take a vector (of any size) of numbers and remove all numbers that are between 5.0 and 9.0 and assign the remaining vector to a nevw variable. Example: A-[1,5,8,10,13,18.20,9,4,6,8] B-[1,10,13,18,20,4]
The Department plans to purchase a humanoid robot. The Chairman would like you to write a program to show a greeting script the robot can use later.
Include FlowChart as well.The Department plans to purchase a humanoid robot. The Chairman would like you to write a program to show a greeting script the robot can use later. Your first task is to use the following script to prototype the robot for presentation: Write a program that uses the script above as a guide without roles, L.e. robot computer and visitor human, to prototype robot greeting in C++. See the Sample Screen Output below.
2. [5pts] Write a MATLAB script that can calculate the equivalent resistance in a circuit that all electrical resistors are connected in parallel: . Print the title 'Equivalent Resistance for Resistors Connected in Parallel' on your output. . Check the size of vector resistor to see how many resistors in the circuit. .Check each individual resistance to see any 0 or negative resistance. If there is any, print message 'ERROR', then finish the program. . Otherwise, calculate the equivalent resistance...
Programming Exercise 4.9
Write a script named numberlines.py. This script
creates a program listing from a source program.
This script should:
Prompt the user for the names of two files.
The input filename could be the name of the script itself, but
be careful to use a different output filename!
The script copies the lines of text from the input file to the
output file, numbering each line as it goes.
The line numbers should be right-justified in 4 columns,...
matlab
Write a script using a loop that will take a vector (of any size) of numbers and remove all numbers that are between 5.0 and 9.0 and assign the remaining vector to a nevw variable. Example: A-[1,5,8,10,13,18.20,9,4,6,8] B-[1,10,13,18,20,4]
Include FlowChart as well.The Department plans to purchase a humanoid robot. The Chairman would like you to write a program to show a greeting script the robot can use later. Your first task is to use the following script to prototype the robot for presentation: Write a program that uses the script above as a guide without roles, L.e. robot computer and visitor human, to prototype robot greeting in C++. See the Sample Screen Output below.
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago