Homework Answers
quantity of heat absorbed = mass of ice x specific heat of ice x ( rise in temperature)
50 x1000 J = mass x 2.06J/g.C x [ (-10) - (-50)]C
thus mass = 50x1000J / 2.06 J/g.C x 40C
=606.79 g
We need 606.79g of ice to absorb 50kJ of heat to bring the temperature from -50 to -10C
Add Answer to:
e. Yes f) No 6 Exp 9 Calorimetry and Hess's Law Determine the quantity of ice...
Prelab: Exp 2 Calorimetry Name: Locker # 1. A student placed 25.421 g of metal in...
Prelab: Exp 2 Calorimetry Name: Locker # 1. A student placed 25.421 g of metal in a coffee cup with exactly 50.0 grams of water. The initial temperature of the metal was 99.5 °C and the initial temperature of the water in the cup was 22.5 °C. If the final temp of the system was 31.8 °C what is the specific heat of the metal? 2. If the actual specific heat for the metal in question 1 is 1.35 J/g.°C,...
Prelab: Exp 2 Calorimetry Name: Locker # 1. A student placed 25.421 g of metal in...
Prelab: Exp 2 Calorimetry Name: Locker # 1. A student placed 25.421 g of metal in a coffee cup with exactly 50.0 grams of water. The initial temperature of the metal was 99.5 °C and the initial temperature of the water in the cup was 22.5 °C. If the final temp of the system was 31.8 °C what is the specific heat of the metal? 2. If the actual specific heat for the metal in question 1 is 1.35 J/g.°C,...
Given that the specific heat capacities of ice and steam are 2.06 J/g°C and 2.03 J/g°C,...
Given that the specific heat capacities of ice and steam are 2.06 J/g°C and 2.03 J/g°C, the molar heats of fusion and vaporization for water are 6.02 kJ/mol and 40.6 kJ/mol, respectively, and the specific heat capacity of water is 4.18 J/g°C, calculate the total quantity of heat evolved when 24.1 g of steam at 158°C is condensed, cooled, and frozen to ice at -50.°C.
How much energy (heat) is required to convert 52.0 g of ice at -10.0 C to...
How much energy (heat) is required to convert 52.0 g of ice at -10.0 C to steam at 100 C?Specific heat of ice: 2.09 J/g * C DHfus = 6.02 kJ/molSpecific heat of water: 4.18 J/g * C DHvap = 40.7 kJ/molSpecific heat of steam: 1.84 J/g * C
What quantity of energy does it take to convert 1.29 kg of ice at -23 degree...
What quantity of energy does it take to convert 1.29 kg of ice at -23 degree C to water at 35 degree C? Specific heat capacities: ice 2.03 J/(g degree C) and liquid water 4.184 J/(g degree C) Delta H_vap = 40.7 kJ/mol; Delta H_fus = 6.02 kJ/mol A) 680 kJ B) 257 kJ C) 6.04 times 10^4 kJ D) 3.59 times 10^3 kJ
Calorimetry Problems: AH = m(at), Exercise #6: Enthalpy Problems 300 kg of water cools from 5...
Calorimetry Problems: AH = m(at), Exercise #6: Enthalpy Problems 300 kg of water cools from 5 to 20 How much beat energy was released by the water? Co H2O(l) is 4.180 J/gºC. 4. How much heat energy is required to heat 45 g of sheet Fe from 24°C to 200."C?, of Fe(s) is 0.449 J/gºC. 3. A food chemist combusts 56 g of a chocolate bar in a calorimeter containing 1.5 L of water (density Ho mL). The initial temperature...
Determination Of The Molar Heat of Fusion Of Ice Purpose The purpose of this result with its reported value that is s 6...
Determination Of The Molar Heat of Fusion Of Ice Purpose The purpose of this result with its reported value that is s 6.01 kJ/mol. The molar heat of fusion (AH) of ice is the amount of heat required to melt 1 mole of ice experiment is to determine the molar heat of fusion of ice and compare the experimental Definition Heat of fusion of ice is the amount of heat required to melt ice. The more the ice to melt,...
Chapter 17 Thermochemistry Final Review Determine the heat required to convert 62.0 grams of ice at...
Chapter 17 Thermochemistry Final Review Determine the heat required to convert 62.0 grams of ice at -10.3 °C to water at 0.0 °C. The specific heat capacity of ice is 2.02 J/g °C 1. 2. Determine the energy released when converting 500.0 g of steam at 100.0 °C to ice at-250°C. Determine the final temperature when 450.2 grams of aluminum at 95.2 °C is placed in an insulated calorimeter with 60.0 grams of water at 10.0 °C. 3. 4. Determine...
Exercise #6: Enthalpy Problems Calorimetry Problems: AH = m(at)c, 500 kg of water cools from 95°C...
Exercise #6: Enthalpy Problems Calorimetry Problems: AH = m(at)c, 500 kg of water cools from 95°C to 20°C. How much heat energy was released by the water? C, of H2O(l) is 4.180 J/gºC. 2. How much heat energy is required to heat 45 g of sheet Fe from 24°C to 200°C? C of Fe(s) is 0.449 J/gºC. 3. A food chemist combusts 56 g of a chocolate bar in a calorimeter containing 1.5 L of water (density H,0 = 1g/ImL)....
reaction one NaOH and HCl. 50.0 mL of 2.0 M HCl solution into 50.0 mL of...
reaction one NaOH and HCl. 50.0 mL of 2.0 M HCl solution into
50.0 mL of 2.0 M NaOH
reaction two 50 mL OF 2.0 M NaOH into 50 mL of 2.0 M NH4Cl
reaction three 50.0 mL of 2.0 M HCl into 50.0 mL NH3
pleanse answer all of the questions
Experinen DATA TABLE Reaction 1 Reaction 2 Reaction 3 34,012。21 2H0 Maximum temperature (C) Initial temperature (C) Temperature change (&T) DATA ANALYSIS 1. Calculate the amount of heat...
Prelab: Exp 2 Calorimetry Name: Locker # 1. A student placed 25.421 g of metal in a coffee cup with exactly 50.0 grams of water. The initial temperature of the metal was 99.5 °C and the initial temperature of the water in the cup was 22.5 °C. If the final temp of the system was 31.8 °C what is the specific heat of the metal? 2. If the actual specific heat for the metal in question 1 is 1.35 J/g.°C,...
Prelab: Exp 2 Calorimetry Name: Locker # 1. A student placed 25.421 g of metal in a coffee cup with exactly 50.0 grams of water. The initial temperature of the metal was 99.5 °C and the initial temperature of the water in the cup was 22.5 °C. If the final temp of the system was 31.8 °C what is the specific heat of the metal? 2. If the actual specific heat for the metal in question 1 is 1.35 J/g.°C,...
What quantity of energy does it take to convert 1.29 kg of ice at -23 degree C to water at 35 degree C? Specific heat capacities: ice 2.03 J/(g degree C) and liquid water 4.184 J/(g degree C) Delta H_vap = 40.7 kJ/mol; Delta H_fus = 6.02 kJ/mol A) 680 kJ B) 257 kJ C) 6.04 times 10^4 kJ D) 3.59 times 10^3 kJ
Calorimetry Problems: AH = m(at), Exercise #6: Enthalpy Problems 300 kg of water cools from 5 to 20 How much beat energy was released by the water? Co H2O(l) is 4.180 J/gºC. 4. How much heat energy is required to heat 45 g of sheet Fe from 24°C to 200."C?, of Fe(s) is 0.449 J/gºC. 3. A food chemist combusts 56 g of a chocolate bar in a calorimeter containing 1.5 L of water (density Ho mL). The initial temperature...
Determination Of The Molar Heat of Fusion Of Ice Purpose The purpose of this result with its reported value that is s 6.01 kJ/mol. The molar heat of fusion (AH) of ice is the amount of heat required to melt 1 mole of ice experiment is to determine the molar heat of fusion of ice and compare the experimental Definition Heat of fusion of ice is the amount of heat required to melt ice. The more the ice to melt,...
Chapter 17 Thermochemistry Final Review Determine the heat required to convert 62.0 grams of ice at -10.3 °C to water at 0.0 °C. The specific heat capacity of ice is 2.02 J/g °C 1. 2. Determine the energy released when converting 500.0 g of steam at 100.0 °C to ice at-250°C. Determine the final temperature when 450.2 grams of aluminum at 95.2 °C is placed in an insulated calorimeter with 60.0 grams of water at 10.0 °C. 3. 4. Determine...
Exercise #6: Enthalpy Problems Calorimetry Problems: AH = m(at)c, 500 kg of water cools from 95°C to 20°C. How much heat energy was released by the water? C, of H2O(l) is 4.180 J/gºC. 2. How much heat energy is required to heat 45 g of sheet Fe from 24°C to 200°C? C of Fe(s) is 0.449 J/gºC. 3. A food chemist combusts 56 g of a chocolate bar in a calorimeter containing 1.5 L of water (density H,0 = 1g/ImL)....
reaction one NaOH and HCl. 50.0 mL of 2.0 M HCl solution into
50.0 mL of 2.0 M NaOH
reaction two 50 mL OF 2.0 M NaOH into 50 mL of 2.0 M NH4Cl
reaction three 50.0 mL of 2.0 M HCl into 50.0 mL NH3
pleanse answer all of the questions
Experinen DATA TABLE Reaction 1 Reaction 2 Reaction 3 34,012。21 2H0 Maximum temperature (C) Initial temperature (C) Temperature change (&T) DATA ANALYSIS 1. Calculate the amount of heat...
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 46 minutes ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 1 hour ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 2 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 3 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 5 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 6 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 7 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 7 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 7 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago