PhCHO+n-BuLi=PhCH(n-Bu)OLi
PhCH(n-Bu)OLi+H3O+=PhCH(n-Bu)OH
PhCH(n-Bu)OH+Pr-COOH+H3O+=product
3. Give a synthesis of the target below. All carbons must come from benzaldehyde and alcohols...
Complete synthesis problems below. You may use any reagents you’d like but all C’s must come from benzene, carbon dioxide, or alkyl halides with 4 carbons or less. b. OCH2Crl3 b. OCH2Crl3
How would you carry out the synthesis below? Additional carbons may come from any alkyl halide with 3 C's or less. Show the reagents needed for each step of your transformation, but do NOT draw the mechanisms for each step. SHORT ANSWER #30: How would you carry out the synthesis below. Additional carbons may come from any alkyl halide with 3 C's or less. Show the reagents needed for each step of your transformation, but do NOT draw the mechanisms...
SHORT ANSWER #30: How would you carry out the synthesis below? Additional carbons may come from any alkyl halide with 3 C's or less. Show the reagents needed for each step of your transformation, but do NOT draw the mechanisms for each step. (10 points)
SHORT ANSWER #30: How would you carry out the synthesis below? Additional carbons may come from any alkyl halide with 3 C's or less. Show the reagents needed for each step of your transformation, but do NOT draw the mechanisms for each step. (10 points)
SHORT ANSWER #30: How would you carry out the synthesis below? Additional carbons may come from any alkyl halide with 3 C's or less. Show the reagents needed for each step of your transformation, but do NOT draw the mechanisms for each step. (10 points) i
SHORT ANSWER #30: How would you carry out the synthesis below? Additional carbons may come from any alkyl halide with 3 C's or less. Show the reagents needed for each step of your transformation, but do NOT draw the mechanisms for each step. (10 points) ri
E. Synthesis: 13 Points Synthesize the molecule below using any of the following reagents: benzene, bromobenzene, any alkenes, alcohols, or alkyl halides of three carbons or less, ethylene oxide; any inorganic reagents, oxidizing or reducing agents, and any peroxyacids. CH2CH3 CH2CH2N CH3 CH3 0%0% E. Synthesis: 13 Points Synthesize the molecule below using any of the following reagents: benzene, bromobenzene, any alkenes, alcohols, or alkyl halides of three carbons or less, ethylene oxide; any inorganic reagents, oxidizing or reducing agents,...
How would you carry out the synthesis below? Additional carbons may come from any alkyl halide with 30's or less, Show the reagents needed for each step of your transformation, but do not draw mechanisms for each step. the -->
5. Outline an organometallic synthesis the compound below starting from cyclohexanol and alcohols of 3 carbons or fewer using any necessary solvents and inorganic reagents. (5pts)
Devise a synthesis of these compounds starting with 3-carbon alkyl halides. Show any necessary reagents and reaction conditions. All carbons must ultimately come from the 3-carbon alkyl halides. Once you have made a new compound, you may reuse it without making it again. a) Propanone b) Butanoic acid c) 3-hexene