Homework Answers
Add Answer to:
Consider the peptide HITHEREFRIEND. If this peptide is an a-helix, the a-amino nitrogen of 12 (I...
There are four amino acid residues between each turn of an alpha helix, because O hydrogen...
There are four amino acid residues between each turn of an alpha helix, because O hydrogen bonding between the carbonyl and amine groups is more stable at this distance. O amino acid residues need a certain amount of distance between then during the turn. O the polar amino acids are more attractive to the peptide bond at this distance. O None of the choices are correct.
Understand alpha helices and beta pleated sheets Question The coiling of an a-helix is maintained in...
Understand alpha helices and beta pleated sheets Question The coiling of an a-helix is maintained in position by which of the following bonds? Select the correct answer below: hydrogen bonds between the oxygen atom in the carbonyl group in one amino acid and the hydrogen atom of the hydroxyl group in an R-group of another amino acid that is four amino acids farther along the chain O hydrogen bonds between the oxygen atom in the carbonyl group in one amino...
25. Consider two peptide sequences: LKAENDEAARAMSEA and CRAGGFPWDQPGTSN. Which of the two is more likely to adopt an al...
25. Consider two peptide sequences: LKAENDEAARAMSEA and CRAGGFPWDQPGTSN. Which of the two is more likely to adopt an alpha-helical structure? Why? 26. A beta strand is a stretch of residues in the extended conformation that can participate in a beta sheet. (In the figure at right, beta strands A and B participate in a two-strand sheet.) What sorts of hydrogen bonds are required for the formation of single beta strands and for the formation of beta sheets? backbone- backbone sidechain...
25. Consider two peptide sequences: LKAENDEAARAMSEA and CRAGGFPWDQPGTSN. Which of the two is more likely to adopt an al...
25. Consider two peptide sequences: LKAENDEAARAMSEA and CRAGGFPWDQPGTSN. Which of the two is more likely to adopt an alpha-helical structure? Why? 26. A beta strand is a stretch of residues in the extended conformation that can participate in a beta sheet. (In the figure at right, beta strands A and B participate in a two-strand sheet.) What sorts of hydrogen bonds are required for the formation of single beta strands and for the formation of beta sheets? backbone- backbone sidechain...
Consider the following amino acids for questions 11-13. Choose the best answers. cysteine serine lysine phenylalanine...
Consider the following amino acids for questions 11-13. Choose the best answers. cysteine serine lysine phenylalanine aspartate Which amino acid's R group has a pKa nearest physiological pH? Which amino acid would you most expect to find in the centre of a folded globular protein? Which amino amino acid can be phosphorylated? The overall charge on the peptide (G-R-A-M-P-S) at pH 12.5 is: -1 -0.5 -1.5 +0.5 1 15. What term best describes the protein secondary structure element drawn below:...
-HAPTER 4 CLAUOVOR " Tyrosine O Asparticauid Ho iX !! HOH Peptide Bond Alanie Y qoo...
-HAPTER 4 CLAUOVOR " Tyrosine O Asparticauid Ho iX !! HOH Peptide Bond Alanie Y qoo Guysine Сн, / сн. н сH, Hн fan-e--c-coo- alpha HH OH OH H Carbon How many amino acid residues are in this structure? 48 amino acid residles How many peptide bonds are in this structure? 3 Peptide bonds What is the name of the C terminal residue? Gusine What is the one-letter abbreviation of the N-terminal residue? What is the sequence, given in three-letter...
A small generic section of the primary structure of an alpha helix is given below -amino...
A small generic section of the primary structure of an alpha helix is given below -amino acid1-amino acid2-amino acid3-amino acid4-amino acid5-amino acid-6-amino acid7- a.) which amino acid residue's backbone forms a hydrogen bond witht he backbone of the seventh(7th) residue? 6, 1, 3, 2, 5, OR 7? b.) which of the following peptide segments is most likely to be part of a stable alpha helix at physiological pH? a.) -Lys-Lys-Ala-Arg-Ser- b.) -Gly-Arg-Lys-His-Gly- c.) -Pro-Leu-Thr-Pro-Trp- d.) -Gly-Gly-Gly-Ala-Gly- e.) -Glu-Glu-Glu-Glu-Glu- f.) -Glu-Leu-Ala-Lys-Phe-...
CHM 230 F'19 Amino acids/peptides Worksheet 1. Draw the structure, at pH 7, of a tetrapeptide...
CHM 230 F'19 Amino acids/peptides Worksheet 1. Draw the structure, at pH 7, of a tetrapeptide that is composed of four different amino acid residues, each from a different category (classification). Draw an arrow to every peptide bond in this peptide. Identify by name the C-terminal residue and the N-terminal residue. Give the abbreviation of this tetrapeptide using three-letter codes. 2. Identify the amino acid residue whose R groun is drawn below in the "clothes line" format
9. The bond linking together amino acids to form peptides is called a atom of atom...
9. The bond linking together amino acids to form peptides is called a atom of atom of the amine group. bond. This involves a covalent bond linking the the carboxylate group of one amino acid to the 10. Peptides are classi fied according to the number of amino acids linked together. As such, peptides containing 2, 3, and 4 amino acids would be classified as a(n) , and respectively. A peptide containing five or more amino acid is a(n) 11....
Explain this question please! Name (4 ofer to the Table of Amino Acids at the beginning of the exam to help solve this problem. Polypeptide I is a 12-mer and has the following amino acid compositi...
Explain this question please!
Name (4 ofer to the Table of Amino Acids at the beginning of the exam to help solve this problem. Polypeptide I is a 12-mer and has the following amino acid composition: Ala, Arg, 2 His, Leu, 2 Lys, 2 Phe, Ser, Thr, Trp Edman degradation of I shows that its N-terminal amino acid is His. Chymotrypsin cleavage of I yields peptide fragments A-D.Trypsin cleavage of I gives peptide fragments E-G. Shown below is the amino...
There are four amino acid residues between each turn of an alpha helix, because O hydrogen bonding between the carbonyl and amine groups is more stable at this distance. O amino acid residues need a certain amount of distance between then during the turn. O the polar amino acids are more attractive to the peptide bond at this distance. O None of the choices are correct.
Understand alpha helices and beta pleated sheets Question The coiling of an a-helix is maintained in position by which of the following bonds? Select the correct answer below: hydrogen bonds between the oxygen atom in the carbonyl group in one amino acid and the hydrogen atom of the hydroxyl group in an R-group of another amino acid that is four amino acids farther along the chain O hydrogen bonds between the oxygen atom in the carbonyl group in one amino...
25. Consider two peptide sequences: LKAENDEAARAMSEA and CRAGGFPWDQPGTSN. Which of the two is more likely to adopt an alpha-helical structure? Why? 26. A beta strand is a stretch of residues in the extended conformation that can participate in a beta sheet. (In the figure at right, beta strands A and B participate in a two-strand sheet.) What sorts of hydrogen bonds are required for the formation of single beta strands and for the formation of beta sheets? backbone- backbone sidechain...
25. Consider two peptide sequences: LKAENDEAARAMSEA and CRAGGFPWDQPGTSN. Which of the two is more likely to adopt an alpha-helical structure? Why? 26. A beta strand is a stretch of residues in the extended conformation that can participate in a beta sheet. (In the figure at right, beta strands A and B participate in a two-strand sheet.) What sorts of hydrogen bonds are required for the formation of single beta strands and for the formation of beta sheets? backbone- backbone sidechain...
Consider the following amino acids for questions 11-13. Choose the best answers. cysteine serine lysine phenylalanine aspartate Which amino acid's R group has a pKa nearest physiological pH? Which amino acid would you most expect to find in the centre of a folded globular protein? Which amino amino acid can be phosphorylated? The overall charge on the peptide (G-R-A-M-P-S) at pH 12.5 is: -1 -0.5 -1.5 +0.5 1 15. What term best describes the protein secondary structure element drawn below:...
-HAPTER 4 CLAUOVOR " Tyrosine O Asparticauid Ho iX !! HOH Peptide Bond Alanie Y qoo Guysine Сн, / сн. н сH, Hн fan-e--c-coo- alpha HH OH OH H Carbon How many amino acid residues are in this structure? 48 amino acid residles How many peptide bonds are in this structure? 3 Peptide bonds What is the name of the C terminal residue? Gusine What is the one-letter abbreviation of the N-terminal residue? What is the sequence, given in three-letter...
CHM 230 F'19 Amino acids/peptides Worksheet 1. Draw the structure, at pH 7, of a tetrapeptide that is composed of four different amino acid residues, each from a different category (classification). Draw an arrow to every peptide bond in this peptide. Identify by name the C-terminal residue and the N-terminal residue. Give the abbreviation of this tetrapeptide using three-letter codes. 2. Identify the amino acid residue whose R groun is drawn below in the "clothes line" format
9. The bond linking together amino acids to form peptides is called a atom of atom of the amine group. bond. This involves a covalent bond linking the the carboxylate group of one amino acid to the 10. Peptides are classi fied according to the number of amino acids linked together. As such, peptides containing 2, 3, and 4 amino acids would be classified as a(n) , and respectively. A peptide containing five or more amino acid is a(n) 11....
Explain this question please!
Name (4 ofer to the Table of Amino Acids at the beginning of the exam to help solve this problem. Polypeptide I is a 12-mer and has the following amino acid composition: Ala, Arg, 2 His, Leu, 2 Lys, 2 Phe, Ser, Thr, Trp Edman degradation of I shows that its N-terminal amino acid is His. Chymotrypsin cleavage of I yields peptide fragments A-D.Trypsin cleavage of I gives peptide fragments E-G. Shown below is the amino...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago