CHy OCHs メor -. 스. + HBr (1 mol) CHs CHOH Hisa DMF 7. Nal acetona...
identify (SN1,SN2, E1 or E2), write the product and reactive, also the mecanism Mecanismo Reacción Sna Н.сн.с. Н,С Br H3CH2C. он Her CH3 Hас "Cн, 2. CH -Br CHs OCH3 ON 1 3. LOCH CHeOH E O 4. HI (xs) CH3 X CH3OH H2SO4 6 -Grupo sadasnt Br NaCN SNO DMF Ederes 7. Nal acetona 8. CH, снон
answer the problem show work thanks CH3 H2O + 1. H-C-CH-CH-CH2 CH3 CH C 2, CHy-CH2-CH-CHOHPCC 25°C 50-55°C + HNO H2SO4 он H2CrO4 CH,CHCH acetone, 35°c Et O 2150113H20 5. CH3(CH2)2MgBr+ CH3(CH2)sC(CH2)sCH3 Nall CH2-CHCH2l H2SO4 140°C 6. CH3CH2CH2OH 7. CHCH CHOH 1) LiAIH(O-t-Bu)3,-78°C 2) H20 8. CH,C-CI HBr 9. CH2 CH-CH-CH2 40°C 10. H3C CIH2 Benzene 100℃ H3C 1. LiAIH/Et2O 11. CH,CH2CH,COH 2. H,0 12. + CH,CH,cCI AIC Benzene, 80°C 13. Br2 heat CH3 AlcI 15. 25°C conc. H2SO4 NaBH4...
Problem of the Day 18 1. (10 pts) Consider the following reaction: TO + HBr a. Estimate AH for this reaction (use table 6.1 in your textbook) b. Is AS for this reaction positive or negative? Explain. C. Determine if AG is positive or negative. d. Is the sign of AG (positive or negative) dependent on temperature? Why? TABLE 6.1 BOND DISSOCIATION ENERGIES (AH) OF COMMON BONDS KJ/MOL KCAL/MOL KI/MOL KCAUMO Bonds to H H2C=CH-CH3 HCC-CH3 KJ/MOL KCAL/MOL 385 92...
Determine the structures of compounds K-Y in the following reaction sequences. NH MgBr Ho 1. LIAIH4, ether 2. HO 1. NaOH → M- Mchu >N 2. CH CH Br 2. CH,OH ola.ompelen 1. LIAIH., ether PBrs > p 1. PICH) » Q" 2. Bu- H R 2. H2O NaCN OH PBrya 1 V 1. LIAIH, ether 2. 0 .CHMgBrother 2. CH,OH Challe CHET (excess) NaOH, a HGG OCH CHO X- NaOCH,CHY CH.CH OH 2. NHCI
1. PCC CI 3. Cl2 H,0, heat 7- け 3. на, но 8- CH-CH HBr H20 refux 9- NH2 CH -C-Cl 10. 2.HaO кон. rMso 12- CH3 CH Ch 13- NH2 14- -78C 15- OH LiAIH 4 16- socl2 2 pyridine P2Os NH2 18- 1. NaHCO.. H2O 2. OH Br 19. 2, H30 20- 1. BH4 2. H3O 21- 22- 2. PBr 3.2 equiv. CH,CH CH&NH 23- 1. Mg Br 3. NaHCO Cl 24- 2 LAH 25-
7. When compound 1 is treated with concentrated HBr, it yields the corresponding compound 2. Propose a mechanism that will account for the stereochemistry of the reaction. Br CH3 Br CH3 H Hl.... C + HBr C6-H HI CHE OH CH3
6. CH3 Br CCI 7. CH3 Br CH, OH 8. CHE 1. MCPBA 2. CH,OH, H* 9. CH Oso,,H,O, 10. Na, NH 0
9. Predict the product for the following reaction. OTS 1. Nal/acetone 2. NaCN/DMF CN II II IV 10. Which of the following methods would be expected to efficiently produce cis-2-butene as the major organic product? a. CH3C CCH3 + H2, Pt b. CH3CHBrCH2CH3+(CHs)3COK/(CH3); COH c. CH3C CCH +H2, Ni2B (P-2) d. CH3C CCH +Na, NH3() 11. Which of the following is the structure for (2E,4E)-octa-2,4-dien-6-yne? IV ш п
Question 11 (1 point) CH,CHCH-CHAI CHS CHCHCH,CH SCH3 + 1 CH,OH CH, CH Which of the following would increase the rate of the above reaction? IL Increase the concentration of alkyl iodide. Change the solvent to DMF (shown at right). N(CH3)2 H Il only I only Neither I or 11 Both 1 and 11
Solve for #9 what is the condensed structural formula CH3 8) 2-butene Cu H CHs- CH-CHs or CHs CHCHC 9) 3-ethyl-3-methyl-1-hexene 10) 3-methylcyclohexene C1 He