please help in answering all of the questionsHomework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
please help in answering all of the questions
15. Which is a propagation step in the...
Section: 17-18 61. Give the major product for the following reaction. 1. CH₂CHOO CH.CHO CHEOCH.CH 2....
Section: 17-18 61. Give the major product for the following reaction. 1. CH₂CHOO CH.CHO CHEOCH.CH 2. CH, CH, CH, Br 3. HC, H, O, heat A) B) D) CH, CHOCHOCHCHHO CH.CH.CH CH,CHỊCH, QH, CH, CHCH OCHCH QH, CHỊCH CHO CHỊCH CHO
please answer numbers 13-16 Question 13 What is the major product of the following reaction? H2O...
please answer numbers 13-16
Question 13 What is the major product of the following reaction? H2O CH3CH2CH2C=CH HgSo. H SO. OCH,CHCH,C=CH, OH CH:CH-CH: CH, CH3CH2CH2CH=CHOH CH, CH, CH,CH-CH: но он CH:CH-CH:CHEN Question 14 The reagent needed to convert 2-butyne to cis-2-butene is H2, Pd/C H2/Lindlar catalyst OH+/H2 Li/NH3 Na/NH3 What is the major product of the following reaction? CH,CH,CECCH; Pd/C CH.CH CHCH CH, CH3CH2CH2CH2CH3 сн. CH What is the major product of the following reaction? CH3CHC=CCHE He Lindlar catalyst o...
please answer questions 9-12 Question 9 1 pts Which of the following statements describes the reactivity...
please answer questions 9-12
Question 9 1 pts Which of the following statements describes the reactivity of alkynes? An alkyne is an electron-rich molecule and therefore reacts as a nucleophile. When a symmetrical internal alkyne reacts with HBr, two products are formed. Unlike alkenes, alkynes fail to undergo electrophilic addition reactions The o bonds of alkynes are greater in energy than the rt bonds and, therefore, are more reactive Alkynes react as electrophiles, whereas alkenes react as nucleophiles What is...
please answer all :) 250 Chapter 9 Chapter 9 Practice Test Which of the following reagents...
please answer all :)
250 Chapter 9 Chapter 9 Practice Test Which of the following reagents is the best one to use in order to wing reagents is the best one to use in order to convert methyl alcohol into methy bromide? 2. Br HBr Br NaBr Br* a. what would be the major product obtained from the reaction of the epoxide shown below containing 0.1 M HCI? CH2CH; CH CH3 b. What would be the major product obtained from...
15) 15) Which of the following statements describes the meaning of mutorotation? A) a slow change...
15) 15) Which of the following statements describes the meaning of mutorotation? A) a slow change between the Dand L forms B) a slow exchange between hydrogen and deuterium C) a slow change in optical rotation to reach an equilibrium value D) a rapid exchange between the a and B forms of sugars E) a rapid exchange between the Dand L. forms 16) What is the major product of the following reaction? PCI, CH --CH-CH:CH pyridine OH A) CH, CH-CH:CH,...
Please show ALL work and justify your answer in full sentences. Thanks so much! 3. Identify...
Please show ALL work and justify your answer in full sentences.
Thanks so much!
3. Identify the product for the reaction. 1. CH,CH,MgCI 2. H20, H со. A) CH:CH2 он 0 B) CH,CHCH2OH C) CHs он 0 D) CHCHOH 4. Give the product for the following reaction. CH:CH Cl 2 H20, H 0 A) 0% CH CHCH OH CH B) CH,CH. CH C) CH CH он CH D) CH2CH, CHCH OH CH2CH
please answer all 4 questions and circle the answers to make it clarified H11.11 - Level...
please answer all 4 questions and circle the answers to make
it clarified
H11.11 - Level 2 Homework . Unanswered For the given reaction, predict the major and minor products or not produced if the product is highly unlikely to form. CH.CH OH major and minor products Premise Response Drag and drop to mat H11.12 - Level 2 Homework. Unanswered For the given reaction, predict the major and minor products or not produced if the product is highly unlikely to...
Nucleophilie Additionat Carbonyl Greg 22. Which is the major product of this reaction? CHLECHT--CHA 20. What...
Nucleophilie Additionat Carbonyl Greg 22. Which is the major product of this reaction? CHLECHT--CHA 20. What is the product of this reaction sequence? Call,CH, C OLOR CO. (A) (CH),COH (R) Core (A) Chov (C) (CH)C=CHICHIS (D) (CH),COCH.CH CHOO CH-cn-d-cats OCH CH=CH-c-Cells OCH OH CH2=CH-C-CH ОСНЫ 21. What is the product of this reaction sequence? (CH)CH, CEU. GROOKL, (A) CH CH=C-CH=CHCH, (D) C150-C-CHÈ-cas CH₂=C-Catts CH,-¢-CH=CHCH CH--CH=CHCH3 CH NA-10. What is the product of the reaction sequence shown? Cho CHỊCH,CH,BI (CẠP CHI...
1) What is the product of the following aldol addition of two aldehydes reaction Өон CH.CH.CH...
1) What is the product of the following aldol addition of two aldehydes reaction Өон CH.CH.CH сн,сн: снҫнн CH. B) CH:CH.CHCHH сн: Сн, он cң, сн: сненнн СН: D) cң, сн: Снінен CH₃CH: E) он cң, cң сн: Снінен сн: 2) Draw the enone product of the following reaction: HO, HO, 3 HC CH HỌC CH 3) What is the product of the following crossed aldol addition reaction? "ОН CH, CHỊCH + H C H (excess) CH3CH2CHCH IV. CH3CHCH Сн,он...
Calculate the enthalpy of each propagation step and the total enthalpy of reaction for the follow...
Calculate the enthalpy of each propagation step and the total
enthalpy of reaction for the following transformation. A table of
bond dissociation energies is provided for reference.
Do not include units in your answer. For example, if the answer is
positive one hundred kilojoules per mole, write "+100" only.
∆HP1 =
∆HP2 =
∆HP =
Average Bond Dissociation Energies, D (kJ mol) Br-Br 193 R2C-CR2 262 (π bond) H-Br 369 C-H 420 C-O 350 C-C 350 C-Br 285 O-o 180...
Section: 17-18 61. Give the major product for the following reaction. 1. CH₂CHOO CH.CHO CHEOCH.CH 2. CH, CH, CH, Br 3. HC, H, O, heat A) B) D) CH, CHOCHOCHCHHO CH.CH.CH CH,CHỊCH, QH, CH, CHCH OCHCH QH, CHỊCH CHO CHỊCH CHO
please answer numbers 13-16
Question 13 What is the major product of the following reaction? H2O CH3CH2CH2C=CH HgSo. H SO. OCH,CHCH,C=CH, OH CH:CH-CH: CH, CH3CH2CH2CH=CHOH CH, CH, CH,CH-CH: но он CH:CH-CH:CHEN Question 14 The reagent needed to convert 2-butyne to cis-2-butene is H2, Pd/C H2/Lindlar catalyst OH+/H2 Li/NH3 Na/NH3 What is the major product of the following reaction? CH,CH,CECCH; Pd/C CH.CH CHCH CH, CH3CH2CH2CH2CH3 сн. CH What is the major product of the following reaction? CH3CHC=CCHE He Lindlar catalyst o...
please answer questions 9-12
Question 9 1 pts Which of the following statements describes the reactivity of alkynes? An alkyne is an electron-rich molecule and therefore reacts as a nucleophile. When a symmetrical internal alkyne reacts with HBr, two products are formed. Unlike alkenes, alkynes fail to undergo electrophilic addition reactions The o bonds of alkynes are greater in energy than the rt bonds and, therefore, are more reactive Alkynes react as electrophiles, whereas alkenes react as nucleophiles What is...
please answer all :)
250 Chapter 9 Chapter 9 Practice Test Which of the following reagents is the best one to use in order to wing reagents is the best one to use in order to convert methyl alcohol into methy bromide? 2. Br HBr Br NaBr Br* a. what would be the major product obtained from the reaction of the epoxide shown below containing 0.1 M HCI? CH2CH; CH CH3 b. What would be the major product obtained from...
15) 15) Which of the following statements describes the meaning of mutorotation? A) a slow change between the Dand L forms B) a slow exchange between hydrogen and deuterium C) a slow change in optical rotation to reach an equilibrium value D) a rapid exchange between the a and B forms of sugars E) a rapid exchange between the Dand L. forms 16) What is the major product of the following reaction? PCI, CH --CH-CH:CH pyridine OH A) CH, CH-CH:CH,...
Please show ALL work and justify your answer in full sentences.
Thanks so much!
3. Identify the product for the reaction. 1. CH,CH,MgCI 2. H20, H со. A) CH:CH2 он 0 B) CH,CHCH2OH C) CHs он 0 D) CHCHOH 4. Give the product for the following reaction. CH:CH Cl 2 H20, H 0 A) 0% CH CHCH OH CH B) CH,CH. CH C) CH CH он CH D) CH2CH, CHCH OH CH2CH
please answer all 4 questions and circle the answers to make
it clarified
H11.11 - Level 2 Homework . Unanswered For the given reaction, predict the major and minor products or not produced if the product is highly unlikely to form. CH.CH OH major and minor products Premise Response Drag and drop to mat H11.12 - Level 2 Homework. Unanswered For the given reaction, predict the major and minor products or not produced if the product is highly unlikely to...
Nucleophilie Additionat Carbonyl Greg 22. Which is the major product of this reaction? CHLECHT--CHA 20. What is the product of this reaction sequence? Call,CH, C OLOR CO. (A) (CH),COH (R) Core (A) Chov (C) (CH)C=CHICHIS (D) (CH),COCH.CH CHOO CH-cn-d-cats OCH CH=CH-c-Cells OCH OH CH2=CH-C-CH ОСНЫ 21. What is the product of this reaction sequence? (CH)CH, CEU. GROOKL, (A) CH CH=C-CH=CHCH, (D) C150-C-CHÈ-cas CH₂=C-Catts CH,-¢-CH=CHCH CH--CH=CHCH3 CH NA-10. What is the product of the reaction sequence shown? Cho CHỊCH,CH,BI (CẠP CHI...
1) What is the product of the following aldol addition of two aldehydes reaction Өон CH.CH.CH сн,сн: снҫнн CH. B) CH:CH.CHCHH сн: Сн, он cң, сн: сненнн СН: D) cң, сн: Снінен CH₃CH: E) он cң, cң сн: Снінен сн: 2) Draw the enone product of the following reaction: HO, HO, 3 HC CH HỌC CH 3) What is the product of the following crossed aldol addition reaction? "ОН CH, CHỊCH + H C H (excess) CH3CH2CHCH IV. CH3CHCH Сн,он...
Calculate the enthalpy of each propagation step and the total
enthalpy of reaction for the following transformation. A table of
bond dissociation energies is provided for reference.
Do not include units in your answer. For example, if the answer is
positive one hundred kilojoules per mole, write "+100" only.
∆HP1 =
∆HP2 =
∆HP =
Average Bond Dissociation Energies, D (kJ mol) Br-Br 193 R2C-CR2 262 (π bond) H-Br 369 C-H 420 C-O 350 C-C 350 C-Br 285 O-o 180...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 33 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago