Homework Answers
Add Answer to:
In a city, assume 25% of citizens are smokers. When 20 people in the city are...
10) In a random sample of 450 people aged 20-24, 22% were smokers, random sample of...
10) In a random sample of 450 people aged 20-24, 22% were smokers, random sample of 400 people aged 25-29, 16% were smokers. a) (4 points) When constructing a confidence interval for the difference between the population proportions of smokers, what must be true in order for the standard normal distribution to be used as an approximation? Show your work please b) (3 points) Construct a 95% confidence interval for the difference between the population proportions of c) (3 points)...
Suppose that 17 percent of an extremely large population are smokers. Six people are randomly selected....
Suppose that 17 percent of an extremely large population are smokers. Six people are randomly selected. Answer the following questions, rounding your answers to two decimal places. (a) What is the probability that no more than two of these people are smokers? (b) What is the probability that there is at least one smoker in the group of six?
In one city, 20% of the population has a college education. Three people are selected at...
In one city, 20% of the population has a college education. Three people are selected at random from the city. Find the probability distribution of X, the number among the three that have a college education. A. Identify then and the p for this distribution. p B. Let the random variable x be the possible number of people selected with a college degree. Develop a binomial distribution by finding P(x) when x = 0, 1, 2, and 3. XP(x) 0...
PROBLEM # PAGE1 Forty percent of a group of people are female and sixty democrats and...
PROBLEM # PAGE1 Forty percent of a group of people are female and sixty democrats and 48% of males are democrats. A person is randomly selected from the group. (A) [10 points) What is the probability that the selected person is a democrat? (B) (10 points] If the person selected is found to be a democrat, what is the probability that this person is male? (C) (10 points) What is the probability that the person selected is a female democrat?...
a) 30% of people in a city smoke. If 7 individuals are randomly selected what is...
a) 30% of people in a city smoke. If 7 individuals are randomly selected what is the probability that exactly 4 smoke? b) Let X be a binomial distribution with n = 30 and p = .6 then the standard deviation is c) Compute the probability of X successes. n = 7, X = 6, p = 0.3
A,B, & C If 25% of the people who are given a certain drug experience dizziness,...
A,B, & C
If 25% of the people who are given a certain drug experience dizziness, and the following probabilities for a sample of 20 people who take the drug. (a) Exactly eight people will become dizzy. (b) At least seven of the 20 people will become dizzy. (c) At most five of the 20 people will become dizzy.
Assume that 15% of people are left-handed. If 5 people are selected at random, find the...
Assume that 15% of people are left-handed. If 5 people are selected at random, find the probability of each outcome described below. a) Find the probability that there are exactly 2 lefties in the group. (round to four decimals) b) Find the probability that there are at least 3 lefties in the group. (round to four decimals) c) Find the probability that there are no more than 2 lefties in the group. (round to four decimals)
(20 points, 4 each) An engineering study of a city rated all the thousands of buildings within the city limits for...
(20 points, 4 each) An engineering study of a city rated all the thousands of buildings within the city limits for flood resilience. The results showed a normal distribution with a mean p-20.6 and a standard deviation of o = 6.3. a. What is the probability that a randomly selected building received a score of 23 or higher? (Hint: we are talking about a specific building, and not-for example-a sample mean!) b. What is the distribution of the sample mean,...
Assume that 12 jurors are randomly selected from a population in which 85% of the people...
Assume that 12 jurors are randomly selected from a population in which 85% of the people are Mexican-Americans. Refer to the probability distribution table below and find the indicated probabilities. xx P(x)P(x) 0 0+ 1 0+ 2 0+ 3 0+ 4 0.0001 5 0.0006 6 0.004 7 0.0193 8 0.0683 9 0.172 10 0.2924 11 0.3012 12 0.1422 Find the probability of exactly 6 Mexican-Americans among 12 jurors. Round your answer to four decimal places. P(x=6)=P(x=6)= Find the probability of...
Assume that 12 jurors are randomly selected from a population in which 72% of the people...
Assume that 12 jurors are randomly selected from a population in which 72% of the people are Mexican-Americans. Refer to the probability distribution table below and find the indicated probabilities. x P(x) 0 0+ 1 0+ 2 0.0001 3 0.0009 4 0.005 5 0.0207 6 0.062 7 0.1367 8 0.2197 9 0.2511 10 0.1937 11 0.0906 12 0.0194 Find the probability of exactly 6 Mexican-Americans among 12 jurors. P(x=6)= Find the probability of 6 or fewer Mexican-Americans among 12 jurors....
10) In a random sample of 450 people aged 20-24, 22% were smokers, random sample of 400 people aged 25-29, 16% were smokers. a) (4 points) When constructing a confidence interval for the difference between the population proportions of smokers, what must be true in order for the standard normal distribution to be used as an approximation? Show your work please b) (3 points) Construct a 95% confidence interval for the difference between the population proportions of c) (3 points)...
In one city, 20% of the population has a college education. Three people are selected at random from the city. Find the probability distribution of X, the number among the three that have a college education. A. Identify then and the p for this distribution. p B. Let the random variable x be the possible number of people selected with a college degree. Develop a binomial distribution by finding P(x) when x = 0, 1, 2, and 3. XP(x) 0...
PROBLEM # PAGE1 Forty percent of a group of people are female and sixty democrats and 48% of males are democrats. A person is randomly selected from the group. (A) [10 points) What is the probability that the selected person is a democrat? (B) (10 points] If the person selected is found to be a democrat, what is the probability that this person is male? (C) (10 points) What is the probability that the person selected is a female democrat?...
A,B, & C
If 25% of the people who are given a certain drug experience dizziness, and the following probabilities for a sample of 20 people who take the drug. (a) Exactly eight people will become dizzy. (b) At least seven of the 20 people will become dizzy. (c) At most five of the 20 people will become dizzy.
(20 points, 4 each) An engineering study of a city rated all the thousands of buildings within the city limits for flood resilience. The results showed a normal distribution with a mean p-20.6 and a standard deviation of o = 6.3. a. What is the probability that a randomly selected building received a score of 23 or higher? (Hint: we are talking about a specific building, and not-for example-a sample mean!) b. What is the distribution of the sample mean,...
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 8 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 11 hours ago