Homework Answers
Your one thumbs up will help me lot. Thanks!
Add Answer to:
3 pts Write complete reaction of p-amino phenol and acetic anhydride by nuclephilic acyl substitution. Also,...
complete mechanism for this reaction -NH₂ Acetic anhydride p-Isopropylaniline p-Isopropylacetanilide (98%)
complete mechanism for this reaction
-NH₂ Acetic anhydride p-Isopropylaniline p-Isopropylacetanilide (98%)
Questions 1. Write an equation for the reaction of aniline with acetic anhydride. 2. Account for...
Questions 1. Write an equation for the reaction of aniline with acetic anhydride. 2. Account for the different odors and effects on litmus of the volatile products obtained when acetamide is hydrolyzed in acid and in base, use equations 3. Bonus, describe how this reaction takes place. LO Acetanilide Acetominophen (Tylenol) 282 Reactions of Carboxylic Acids and Their Derivatives Experiment 18
Show the structure and reaction for the derivative prepared from p-chloroaniline and acetic anhydride. Use skeletal...
Show the structure and reaction for the derivative prepared from p-chloroaniline and acetic anhydride. Use skeletal / line angle structures. No mechanism necessary, just show reactants, conditions, and products.
Write the detailed balanced equation for synthesis of acetylferrocene from ferrocene and acetic anhydride. What is...
Write the detailed balanced equation for synthesis of acetylferrocene from ferrocene and acetic anhydride. What is the function of the phosphoric acid in the reaction? Chemically, what role does thiamine plays in the catalysis of benzoin condensation? Name another catalyst that can also perform this reaction. Which catalyst for benzoin condensation is better? Why (3reasons)
Question 26 12 pts Complete and balance the following reactions. Write the complete and net ionic...
Question 26 12 pts Complete and balance the following reactions. Write the complete and net ionic reactions. Include state labels. Write NR if no reaction occurs. → KOH() + Mg(NO3)2() Pb(C2H302)2( ) + NaBr() + Zn() + H2SO4( ) ► Upload Choose a File
Write a detailed mechanism for the reaction of dimethylamine in water with acetic anhydride to create...
Write a detailed mechanism for the reaction of dimethylamine in water with acetic anhydride to create N,N-dimethylacetamide which proceeds in 3 steps including proton transfer steps. Then draw curved arrows that depict electron reorganization for the mechanism step below. Arrow-pushing Instructions nno XT :0: :0 H CH3 :N-Me 1 нс N-Me Me Me
Choose a File Question 2 5 pts • For the following compounds... 1. Provide molecular formula...
Choose a File Question 2 5 pts • For the following compounds... 1. Provide molecular formula 2. Provide IUPAC name 3. Show addition of hydrogen reaction, draw structures of the products and provide IUPAC name for the products. a) b) O I • Upload your answer for this assignment. Upload Choose file
Question 25 6 pts Complete the 2 step synthesis below that converts 2-bromo-2-methylpentane to 3-bromo- 2-methylpentane....
Question 25 6 pts Complete the 2 step synthesis below that converts 2-bromo-2-methylpentane to 3-bromo- 2-methylpentane. (A) will represent your reagents for the first reaction. (B) represents the product of the first reaction (and the starting material of the second), while (C) represents the reagents for the second reaction. You will write your answers out and then submit them via a file upload. You can either recreate the format shown below, or just simply list A,B, and C along with...
Friedel-Crafts Acylation of Ferrocene "riedel-Crafts reactions are examples of electrophilic aromatic substitution reactions. The eaction involves...
Friedel-Crafts Acylation of Ferrocene "riedel-Crafts reactions are examples of electrophilic aromatic substitution reactions. The eaction involves the substitution of hydrogen on the aromatic ring system by an electrophilic arbon species forming a new carbon-carbon bond. Friedel-Crafts reactions may be used to ntroduce either an alkyl or acyl group. Ferrocene does not undergo addition reactions typical of cyclopentadiene, but undergoes Electrophilic aromatic substitution. The Friedel-Crafts acylation reaction of ferrocene involves he addition of the acylium cation to one of the carbon...
Question 10 20 pts The following reaction leads to two products: conjugated system A and unknown...
Question 10 20 pts The following reaction leads to two products: conjugated system A and unknown product B. NaOH, H2O + FO ? А B Determine the structure of product B and provide a complete arrow-pushing mechanism for the reaction. Upload Choose a File
complete mechanism for this reaction
-NH₂ Acetic anhydride p-Isopropylaniline p-Isopropylacetanilide (98%)
Questions 1. Write an equation for the reaction of aniline with acetic anhydride. 2. Account for the different odors and effects on litmus of the volatile products obtained when acetamide is hydrolyzed in acid and in base, use equations 3. Bonus, describe how this reaction takes place. LO Acetanilide Acetominophen (Tylenol) 282 Reactions of Carboxylic Acids and Their Derivatives Experiment 18
Write the detailed balanced equation for synthesis of acetylferrocene from ferrocene and acetic anhydride. What is the function of the phosphoric acid in the reaction? Chemically, what role does thiamine plays in the catalysis of benzoin condensation? Name another catalyst that can also perform this reaction. Which catalyst for benzoin condensation is better? Why (3reasons)
Question 26 12 pts Complete and balance the following reactions. Write the complete and net ionic reactions. Include state labels. Write NR if no reaction occurs. → KOH() + Mg(NO3)2() Pb(C2H302)2( ) + NaBr() + Zn() + H2SO4( ) ► Upload Choose a File
Write a detailed mechanism for the reaction of dimethylamine in water with acetic anhydride to create N,N-dimethylacetamide which proceeds in 3 steps including proton transfer steps. Then draw curved arrows that depict electron reorganization for the mechanism step below. Arrow-pushing Instructions nno XT :0: :0 H CH3 :N-Me 1 нс N-Me Me Me
Choose a File Question 2 5 pts • For the following compounds... 1. Provide molecular formula 2. Provide IUPAC name 3. Show addition of hydrogen reaction, draw structures of the products and provide IUPAC name for the products. a) b) O I • Upload your answer for this assignment. Upload Choose file
Question 25 6 pts Complete the 2 step synthesis below that converts 2-bromo-2-methylpentane to 3-bromo- 2-methylpentane. (A) will represent your reagents for the first reaction. (B) represents the product of the first reaction (and the starting material of the second), while (C) represents the reagents for the second reaction. You will write your answers out and then submit them via a file upload. You can either recreate the format shown below, or just simply list A,B, and C along with...
Friedel-Crafts Acylation of Ferrocene "riedel-Crafts reactions are examples of electrophilic aromatic substitution reactions. The eaction involves the substitution of hydrogen on the aromatic ring system by an electrophilic arbon species forming a new carbon-carbon bond. Friedel-Crafts reactions may be used to ntroduce either an alkyl or acyl group. Ferrocene does not undergo addition reactions typical of cyclopentadiene, but undergoes Electrophilic aromatic substitution. The Friedel-Crafts acylation reaction of ferrocene involves he addition of the acylium cation to one of the carbon...
Question 10 20 pts The following reaction leads to two products: conjugated system A and unknown product B. NaOH, H2O + FO ? А B Determine the structure of product B and provide a complete arrow-pushing mechanism for the reaction. Upload Choose a File
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 31 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago