Homework Answers
1.Relationship between terpene and terpene : Terpenes are
biosynthetically derivied from a unit called Isoprene .Isoprene
(see figure in page uploaded) is the fundamental building block of
terpenes .These isoprene units join with each other in head tail
linkage
to give linear chain terpene
or a cyclic terpene. So the basic relationship between them is that
terpene is biosynthetically derivied from repeating units of
isoprene.
Add Answer to:
11. What is the relationship between isoprene and terpenes? 12. Give the structure of A. Amonoterpene...
BED S a. What is the relationship between compounds A and B? D b. What is...
BED S a. What is the relationship between compounds A and B? D b. What is the relationship between compounds C and D? D c. What is the relationship between compounds A and D? D E E E 4. In steam distillation of limonene, the boiling point of the distilling liquid is lower than limonene or water, can you explain? 2 pts 5. Bioynthesis of terpenes may proceed by way of the carbocation intermediate shown. a. Follow the arrows to...
please answer all the question and explain for better understanding 25.4 Give the effect on the...
please answer all the question and explain for better
understanding
25.4 Give the effect on the melting point of the presence of a cis double bond in a fatty acid 25.5 Describe the process in soap making a) b) c) d) Base-promoted hydrolysis of fats or oils Acid-promoted hydrolysis of fats or oils Acidifying hard water Heating oil a) b) c) A cis double bond raises the melting point. A cis double bond lowers the melting point. A cis double...
4 A 8 A V- 12 59. Given Ri > R2, what is the relationship between V1 and V2? d. No conclusion can be made Given R1 > R2, what is the relationship between I, and 12? b 11 12 c. 1, >12 d....
4 A 8 A V- 12 59. Given Ri > R2, what is the relationship between V1 and V2? d. No conclusion can be made Given R1 > R2, what is the relationship between I, and 12? b 11 12 c. 1, >12 d. No conclusion can be made Which of the following is a valid equation? b. 12 11-4A 121 d 12 12A-1 e 12 11-12A
4 A 8 A V- 12 59. Given Ri > R2, what is...
Tor F 1. With the exception of steroids, all lipids contain at least one fatty acid. 2. Some lipids contain monosaccharides as part of their structure. 3. Some lipids contain an amino acid as part of...
Tor F 1. With the exception of steroids, all lipids contain at least one fatty acid. 2. Some lipids contain monosaccharides as part of their structure. 3. Some lipids contain an amino acid as part of their structure. 4. Glycerophospholipids contain a phosphate portion in their structure. 5. All lipids have a molecule of glycerin as their backbone. 6. Polyunsaturated fatty acids have more than one C-C double bond in their "backbone." 7. Fatty acids are soluble in water. 8....
question 11 & 12 Question 11 Not yet answered What is the relationship between these two...
question 11 & 12
Question 11 Not yet answered What is the relationship between these two molecules? = ile Points out of 3 P Flag question identical enantiomers meso compounds diastereomers Which Fischer projection shows an R.configuration? Question 12 Not yet answered Points out of 3 Anot confit A) HO B ) C- CH3 C) HOMH DH-OH CH3 CH3 P Flag question сн.
12. Which of the following best describes the components of phospholipids? A) Glycerol, one fatty acid,...
12. Which of the following best describes the components of phospholipids? A) Glycerol, one fatty acid, two phosphate groups and an aminoalcohol B) Glycerol, two fatty acids, one phosphate group, and an aminoalcohol C) Sphingosine, two fatty acid, one phosphate group and an aminoalcohol D) Glycerol, three fatty acids, and a phosphate group 13. When ribose adopts the most stable cyclic structure hemiacetal, which of the following is happening? A. it becomes a furonose C. an acetal is formed B....
12. The glycolipid molecule is characterized by having a specific residue attached to the backbone. Which...
12. The glycolipid molecule is characterized by having a specific residue attached to the backbone. Which is that residue? 1. a) phosphate 2.b) glycerol 3. c) lipid 4.d) sugar 13. The steroid that is the raw material for the production of other steroids is 1. a) triglyceride. 2. b) cholesterol. 3. c) progesterone. 4. d) eicosanoid. 14. Which compounds are responsible for causing pain and inflammation 1. a) anabolic steroids 2. b) adrenocorticoids 3. c) prostaglandins 4. d) leukotrienes 7...
11. What statistical test would be appropriate to use when assessing the relationship between dif...
11. What statistical test would be appropriate to use when assessing the relationship between different cultures (i.e., Italian, Indian, German, American, and Mexican) and the spice levels in their food? Mann-Whitney U T-test ANOVA (Analysis of Variance) Chi-square test of independence a. b. c. d. 12. Confounding is said to be present in a study where the crude measurement of odds ratio is 2.0, and the adjusted measure is 1.85. a. True b. False c. Insufficient information
11. What statistical...
Compound 2 Compound Compound 3 12.(3 pts) What is the relationship between Compound 1 and compound...
Compound 2 Compound Compound 3 12.(3 pts) What is the relationship between Compound 1 and compound 2? 13. (3 pts) What is the relationship between Compound 2 and compound 3? 14.(3 pts) What is the relationship between compound 1 and compound 3? 15. (3 pts) Which compound(s) are meso? 16. (3 pts) Which compounds will rotate the plane of polarized light? 10.(6 pts) What are the configurations of the stereocenter(s) in the following molecule. Would you expect this molecule to...
16. Fats and oils are also known as - a triglycerides b. tripeptides sterols d. phospholipids...
16. Fats and oils are also known as - a triglycerides b. tripeptides sterols d. phospholipids 17. Cell membranes are composed of a __bilayer. a triglyceride c. sterol b. tripeptide d. phospholipid 18. The degree of saturation of a fatty acid is determined by the number of - atoms in the molecule. a. carbon c. hydrogen b. oxygen d. nitrogen 19. Foods high in cholesterol include all of the following except a. liver C. eggs b. milk d. peanut butter...
BED S a. What is the relationship between compounds A and B? D b. What is the relationship between compounds C and D? D c. What is the relationship between compounds A and D? D E E E 4. In steam distillation of limonene, the boiling point of the distilling liquid is lower than limonene or water, can you explain? 2 pts 5. Bioynthesis of terpenes may proceed by way of the carbocation intermediate shown. a. Follow the arrows to...
please answer all the question and explain for better
understanding
25.4 Give the effect on the melting point of the presence of a cis double bond in a fatty acid 25.5 Describe the process in soap making a) b) c) d) Base-promoted hydrolysis of fats or oils Acid-promoted hydrolysis of fats or oils Acidifying hard water Heating oil a) b) c) A cis double bond raises the melting point. A cis double bond lowers the melting point. A cis double...
4 A 8 A V- 12 59. Given Ri > R2, what is the relationship between V1 and V2? d. No conclusion can be made Given R1 > R2, what is the relationship between I, and 12? b 11 12 c. 1, >12 d. No conclusion can be made Which of the following is a valid equation? b. 12 11-4A 121 d 12 12A-1 e 12 11-12A
4 A 8 A V- 12 59. Given Ri > R2, what is...
Tor F 1. With the exception of steroids, all lipids contain at least one fatty acid. 2. Some lipids contain monosaccharides as part of their structure. 3. Some lipids contain an amino acid as part of their structure. 4. Glycerophospholipids contain a phosphate portion in their structure. 5. All lipids have a molecule of glycerin as their backbone. 6. Polyunsaturated fatty acids have more than one C-C double bond in their "backbone." 7. Fatty acids are soluble in water. 8....
question 11 & 12
Question 11 Not yet answered What is the relationship between these two molecules? = ile Points out of 3 P Flag question identical enantiomers meso compounds diastereomers Which Fischer projection shows an R.configuration? Question 12 Not yet answered Points out of 3 Anot confit A) HO B ) C- CH3 C) HOMH DH-OH CH3 CH3 P Flag question сн.
12. Which of the following best describes the components of phospholipids? A) Glycerol, one fatty acid, two phosphate groups and an aminoalcohol B) Glycerol, two fatty acids, one phosphate group, and an aminoalcohol C) Sphingosine, two fatty acid, one phosphate group and an aminoalcohol D) Glycerol, three fatty acids, and a phosphate group 13. When ribose adopts the most stable cyclic structure hemiacetal, which of the following is happening? A. it becomes a furonose C. an acetal is formed B....
12. The glycolipid molecule is characterized by having a specific residue attached to the backbone. Which is that residue? 1. a) phosphate 2.b) glycerol 3. c) lipid 4.d) sugar 13. The steroid that is the raw material for the production of other steroids is 1. a) triglyceride. 2. b) cholesterol. 3. c) progesterone. 4. d) eicosanoid. 14. Which compounds are responsible for causing pain and inflammation 1. a) anabolic steroids 2. b) adrenocorticoids 3. c) prostaglandins 4. d) leukotrienes 7...
11. What statistical test would be appropriate to use when assessing the relationship between different cultures (i.e., Italian, Indian, German, American, and Mexican) and the spice levels in their food? Mann-Whitney U T-test ANOVA (Analysis of Variance) Chi-square test of independence a. b. c. d. 12. Confounding is said to be present in a study where the crude measurement of odds ratio is 2.0, and the adjusted measure is 1.85. a. True b. False c. Insufficient information
11. What statistical...
Compound 2 Compound Compound 3 12.(3 pts) What is the relationship between Compound 1 and compound 2? 13. (3 pts) What is the relationship between Compound 2 and compound 3? 14.(3 pts) What is the relationship between compound 1 and compound 3? 15. (3 pts) Which compound(s) are meso? 16. (3 pts) Which compounds will rotate the plane of polarized light? 10.(6 pts) What are the configurations of the stereocenter(s) in the following molecule. Would you expect this molecule to...
16. Fats and oils are also known as - a triglycerides b. tripeptides sterols d. phospholipids 17. Cell membranes are composed of a __bilayer. a triglyceride c. sterol b. tripeptide d. phospholipid 18. The degree of saturation of a fatty acid is determined by the number of - atoms in the molecule. a. carbon c. hydrogen b. oxygen d. nitrogen 19. Foods high in cholesterol include all of the following except a. liver C. eggs b. milk d. peanut butter...
Most questions answered within 3 hours.
-
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 3 minutes ago -
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 3 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 17 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago