Homework Answers
As caffeine hydrochloride is added, the concentration of protonated caffeine increase and equilibrium shifts in such a way to cancel if effect. For this the reaction proceeds backwards. More caffeine will be produced. Hence the protonation of caffeine is depressed and this is called common ion effect.
A weak base and it's salt can act as a buffer. In this case if we add an acid then it will be neutralized by forming corresponding caffeine salt. If base is added, caffeine hydrochloride will react with it forming caffeine, which is weakly protonated/hydrolysed
Add Answer to:
This is all I'm given.
If caffeine hydrochloride. the salt of caffeine, is added to coffee....
I need help with understanding the shifting stuff on these problems I know the answers for...
I need help with understanding the shifting stuff on these problems I know the answers for all of them but im trying to understand how you get there The following equilibrium was established. Predict what would happen if each of the following changes were made to the conditions of the equilibrium. (2 points each). Ba(OH)2· 8H2O(s) + 2NH4NO3 (s) ↔ Ba(NO3)2 (aq) + 3NH3 (aq) + 10H2O(g) DH = +110.2 kJ What would happen if water vapor were added to...
lines provided. A few drops of NaCkeg) solution is deep yellow are added to a solution...
lines provided. A few drops of NaCkeg) solution is deep yellow are added to a solution containing Fe3. The resulting to a colour Predict the effect of adding NaF㈣ to this deep solution,The win color. Equilibrium #1 +6 F() Feagan pale yellow Fe"(aa) pale yellow colourless Equilibrium #2 4 Cl(a) deep yellow Write your answer in detail, and clearly explain: (1 mark) a) why the solution is initially deep yellow b) how each equilibrium will shift when NaF is added...
I need help with all three please and thank you! 1. In the following reaction at...
I need help with all three please and thank you!
1. In the following reaction at equilibrium, what will happen if more CO(g) is added? COC12(g) CO(g) + Cl2(g) A) reaction will shift to the right B) reaction will shift to the left C) nothing will happen D) the equilibrium constant will change E) not enough information given to predict 2. The following reaction is exothermic (with A and B reactants) and at equilibrium. What will happen if heat is...
The production of coffee pods results in environmental damages when consumers throw the pods away. Currently...
The production of coffee pods results in environmental damages when consumers throw the pods away. Currently consumers are not responsible for the costs of disposing of these coffee pods. MSC MPC The environmental damages caused by throwing away the coffee pods is an example of a: a. Positive externality b. Negative externality c. Private cost d. Private benefit Consider the market for coffee in the graph to the right. 1. Left unregulated, what is the equilibrium price and quantity? What...
Solubility Product A student determines that the concentration of OH" ions in a saturated solution of...
Solubility Product A student determines that the concentration of OH" ions in a saturated solution of calcium hydroxide, Ca(OH)2 is 0.054 M. What is Ksp for Ca(OH)2? Ca 7.9 x 10-5 Ob.5.4 x 10-3 Oc. 1.6 x 10-7 Od. 2.9x 10-3 Freezing Point Depression Which colligative property of solutions listed below is correctly stated. 1. The freezing point of a solution decreases as more solute is added. II. The boiling point of a solution increases as more solute is added....
Suppose the market for coffee is in equilibrium. Explain (using graphs) what would happen to the...
Suppose the market for coffee is in equilibrium. Explain (using graphs) what would happen to the equilibrium price and equilibrium quantity of coffee in each of the following scenarios. Please place your final equilibrium effects on price and quantity in the SNoodle box below (Ge,just say Equilibrium price increase/decreased etc and equilibrium quantity increased/decreased etc.). Be sure to put your graphical analysis on your scratch paper to be turned in. Credit will be given not only for the correct answers,...
Equilibrium Consider the following equilibrium: CH 3COOH(aq) + H 20(1) = CH 3COO "(aq) + H...
Equilibrium Consider the following equilibrium: CH 3COOH(aq) + H 20(1) = CH 3COO "(aq) + H 30 +(aq) What would be the effect of adding sodium acetate (CH 3COONa) a strong electrolyte to the reaction and what would happen to the pH of the solution? a. the equilbrium will shift to the right and the pH will decrease O b. the equilibrium will shift to the left and there will be no change in pH O c. the equilbrium will...
You are given the equilibrium system BiCl_3 (aq) bismuth (III) chloride(colorless) + H_2, O(l) BiOCl (s)...
You are given the equilibrium system BiCl_3 (aq) bismuth (III) chloride(colorless) + H_2, O(l) BiOCl (s) bismuth(III) oxychloride (white) + 2HCl (aq) at a point at which the solution is colorless and no BiOCl (s) is observed. a. which way should the equilibrium shift, to the left or to the right, when water is added until a change is observed? What would be observed? Explain the shift in terms of lessthanorequalto Chatelier's principle. b. Which way should the equilibrium shift...
Question 1: [5 marks]Explain the three reasons why the AD curve slopes downward. State an event...
Question 1: [5 marks]Explain the three reasons why the AD curve slopes downward. State an event that will shift the AD curve, which way it will shift the AD [5 marks]Suppose that the economy is in LR equilibrium. Draw a carefully labelled AD-AS diagram to show the initial LR equilibrium. [5 marks] Show on the above diagram the effect of a drought that destroys crops of many farmers. Carefully explain all 4 steps to show and explain what will happen...
Q.1 Figure 1 AD and AS Model of Macroeconomics a. Label both axes and all the...
Q.1 Figure 1 AD and AS Model of Macroeconomics a. Label both axes and all the lines on the graph and indicate Long Run equilibrium in the economy with the existing letters A, b. If the economy starts at C, explain how Trump's tax cut w move on the graph in terms the relevant line(s), equilibrium and variables in the short run. c. Explain the type d. Is the equilibriur why not. What would happen to this equilibrium in the...
lines provided. A few drops of NaCkeg) solution is deep yellow are added to a solution containing Fe3. The resulting to a colour Predict the effect of adding NaF㈣ to this deep solution,The win color. Equilibrium #1 +6 F() Feagan pale yellow Fe"(aa) pale yellow colourless Equilibrium #2 4 Cl(a) deep yellow Write your answer in detail, and clearly explain: (1 mark) a) why the solution is initially deep yellow b) how each equilibrium will shift when NaF is added...
I need help with all three please and thank you!
1. In the following reaction at equilibrium, what will happen if more CO(g) is added? COC12(g) CO(g) + Cl2(g) A) reaction will shift to the right B) reaction will shift to the left C) nothing will happen D) the equilibrium constant will change E) not enough information given to predict 2. The following reaction is exothermic (with A and B reactants) and at equilibrium. What will happen if heat is...
The production of coffee pods results in environmental damages when consumers throw the pods away. Currently consumers are not responsible for the costs of disposing of these coffee pods. MSC MPC The environmental damages caused by throwing away the coffee pods is an example of a: a. Positive externality b. Negative externality c. Private cost d. Private benefit Consider the market for coffee in the graph to the right. 1. Left unregulated, what is the equilibrium price and quantity? What...
Solubility Product A student determines that the concentration of OH" ions in a saturated solution of calcium hydroxide, Ca(OH)2 is 0.054 M. What is Ksp for Ca(OH)2? Ca 7.9 x 10-5 Ob.5.4 x 10-3 Oc. 1.6 x 10-7 Od. 2.9x 10-3 Freezing Point Depression Which colligative property of solutions listed below is correctly stated. 1. The freezing point of a solution decreases as more solute is added. II. The boiling point of a solution increases as more solute is added....
Suppose the market for coffee is in equilibrium. Explain (using graphs) what would happen to the equilibrium price and equilibrium quantity of coffee in each of the following scenarios. Please place your final equilibrium effects on price and quantity in the SNoodle box below (Ge,just say Equilibrium price increase/decreased etc and equilibrium quantity increased/decreased etc.). Be sure to put your graphical analysis on your scratch paper to be turned in. Credit will be given not only for the correct answers,...
Equilibrium Consider the following equilibrium: CH 3COOH(aq) + H 20(1) = CH 3COO "(aq) + H 30 +(aq) What would be the effect of adding sodium acetate (CH 3COONa) a strong electrolyte to the reaction and what would happen to the pH of the solution? a. the equilbrium will shift to the right and the pH will decrease O b. the equilibrium will shift to the left and there will be no change in pH O c. the equilbrium will...
You are given the equilibrium system BiCl_3 (aq) bismuth (III) chloride(colorless) + H_2, O(l) BiOCl (s) bismuth(III) oxychloride (white) + 2HCl (aq) at a point at which the solution is colorless and no BiOCl (s) is observed. a. which way should the equilibrium shift, to the left or to the right, when water is added until a change is observed? What would be observed? Explain the shift in terms of lessthanorequalto Chatelier's principle. b. Which way should the equilibrium shift...
Q.1 Figure 1 AD and AS Model of Macroeconomics a. Label both axes and all the lines on the graph and indicate Long Run equilibrium in the economy with the existing letters A, b. If the economy starts at C, explain how Trump's tax cut w move on the graph in terms the relevant line(s), equilibrium and variables in the short run. c. Explain the type d. Is the equilibriur why not. What would happen to this equilibrium in the...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 54 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago