![Consider A =?+ ? . Use this formula to answer questions 1-5. If A-20000, r= 0.075, n = 12, and 1-5, find P. 21 Solve the formula for P. 3] Solve the formula for r. 4] Letn-1 within the formula above. Then, solve the equation for t. Let P-l, r= 1, and t-1. What value, if any, does A approach if n approaches infinity](http://img.homeworklib.com/questions/942ceaa0-7a3d-11eb-a210-19dc833f95ea.png?x-oss-process=image/resize,w_560)
Homework Answers
Add Answer to:
Consider A =?+ ? . Use this formula to answer questions 1-5. If A-20000, r= 0.075,...
5. Let A = P(R). Define f : R → A by the formula f(x) =...
5. Let A = P(R). Define f : R → A by the formula f(x) = {y E RIy2 < x). (a) Find f(2). (b) Is f injective, surjective, both (bijective), or neither? Z given by f(u)n+l, ifn is even n - 3, if n is odd 6. Consider the function f : Z → Z given by f(n) = (a) Is f injective? Prove your answer. (b) Is f surjective? Prove your answer
Use the given equation to answer the following questions. 3 sin(.) = 5 cos(r) (a) Find...
Use the given equation to answer the following questions. 3 sin(.) = 5 cos(r) (a) Find all solutions of the equation. (Enter each answer in the form 0 + tek, 0 = 0 < 21. If there are any unused answer boxes, enter NONE in the last boxes.) 1.03038 + ak (smaller 8-value) 1.03038 + uk none (larger 6-value) (b) Use a calculator to solve the equation in the interval [0, 21). Round your answers to five decimal places. (If...
1. Consider the differential equation" = y2 - 4y - 5. a) Find any equilibrium solution(s)....
1. Consider the differential equation" = y2 - 4y - 5. a) Find any equilibrium solution(s). b) Create an appropriate table of values and then sketch (using the grid provided) a direction field for this differential equation on OSIS 3. Be sure to label values on your axes. c) Using the direction field, describe in detail the behavior of y ast approaches infinity. 2. Short answer: State whether or not the differential equation is linear. If it is linear, state...
Problem 05 In R Out For the circuit above, answer the following questions. 1. Derive the formula ...
Please Help!
Problem 05 In R Out For the circuit above, answer the following questions. 1. Derive the formula for the transfer function angular resonant frequency omega_res (enter the right hand side part of the formula only) Use exactly same notations for L,C and R as in the circuit diagram. Hints for solving the problem. (1) Ignore trivial solution omega_res 0 (2) In case obtaining the resonant frequency using the condition imag(H)0 fails, try finding the resonant frequency using impedance...
(5) Consider the problem: minimize I[r(.)] - /r2 dt 0 subject to the conditions x(0)-x()-0 and th...
(5) Consider the problem: minimize I[r(.)] - /r2 dt 0 subject to the conditions x(0)-x()-0 and the constraint 0 R is a C2 function that solves the above Suppose that x : [0, π] Let y : [0, π] → R be any other C2 function such that y(0) = Define problem y(n) 0. 0 an a(s) a. Explain why α(0)-1 and i'(0) b. Show that 0. i'(0)r'(t) y'(t) dt -X /x(t) y(t) dt 0 0 for some constant λ,...
Use the compound interest formula A=P(1+r)^t and the given information to solve for r
Use the compound interest formula A=P(1+r)^t and the given information to solve for r. A=9,000,000 P=60,000 t=40
. 1 Solve for f: - + 1 p f = 0 Preview Use the formula...
. 1 Solve for f: - + 1 p f = 0 Preview Use the formula from above to find f when p = 5 and q = 8. Answer as a reduced fraction or rounded to 2 decimal places. f = 0 Preview Get Help: VIDEO Written Example License Points possible: 1 This is attempt 1 of 5. Distance equals rate times time, d = rt. What is the total distance that two people travel in 3 hour if...
Answer ALL the questions. Some or all of them shall be marked. Question 1. Consider the...
Answer ALL the questions. Some or all of them shall be marked. Question 1. Consider the following system of differential equations: P.(D) [x] + P (D)) -(0) Px(D) [x] + P (D) x = f(t). (1) How do we determine the correct number of arbitrary constants in a general solution of the above system. (0) Explain briefly the difference between the operator method and the method of triangu- larization when used for solving the above system. Question 2. Determine whether...
Synthesis Questions Use available resources to help you answer the following questions. 1. Consider the Erlenmeyer...
Synthesis Questions Use available resources to help you answer the following questions. 1. Consider the Erlenmeyer flask with the stopper tightly inserted. How do you think the pressure would change if you doubled the number of molecules (moles) in the flask? Explain your prediction! 2. Based on your answer to the previous question, what kind of mathematical relationship is there between the pressure and number of moles nof a gas? What is the mathematical representation of that relationship? 3. Combine...
PROBLEM 5. TUNING A CIRCUIT: PRACTICAL RESONANCE. Consider a forced RLC circuit with L-1 (H), R-1...
PROBLEM 5. TUNING A CIRCUIT: PRACTICAL RESONANCE. Consider a forced RLC circuit with L-1 (H), R-10 (12) and C 丽0 (f). Suppose an alternating current supplies a electromotive force Et)100 coswt. The equation modeling the charge Q(t) on the capacitor is 650 Q"(t) 10Q650Q(t) 100 coswt. a. Is the damping over-, under- or critical? Find the form of the general solution. Identify the transient and steady-state parts of the solution. b. Find the amplitude C(w) of the steady-state piece (here...
5. Let A = P(R). Define f : R → A by the formula f(x) = {y E RIy2 < x). (a) Find f(2). (b) Is f injective, surjective, both (bijective), or neither? Z given by f(u)n+l, ifn is even n - 3, if n is odd 6. Consider the function f : Z → Z given by f(n) = (a) Is f injective? Prove your answer. (b) Is f surjective? Prove your answer
Use the given equation to answer the following questions. 3 sin(.) = 5 cos(r) (a) Find all solutions of the equation. (Enter each answer in the form 0 + tek, 0 = 0 < 21. If there are any unused answer boxes, enter NONE in the last boxes.) 1.03038 + ak (smaller 8-value) 1.03038 + uk none (larger 6-value) (b) Use a calculator to solve the equation in the interval [0, 21). Round your answers to five decimal places. (If...
1. Consider the differential equation" = y2 - 4y - 5. a) Find any equilibrium solution(s). b) Create an appropriate table of values and then sketch (using the grid provided) a direction field for this differential equation on OSIS 3. Be sure to label values on your axes. c) Using the direction field, describe in detail the behavior of y ast approaches infinity. 2. Short answer: State whether or not the differential equation is linear. If it is linear, state...
Please Help!
Problem 05 In R Out For the circuit above, answer the following questions. 1. Derive the formula for the transfer function angular resonant frequency omega_res (enter the right hand side part of the formula only) Use exactly same notations for L,C and R as in the circuit diagram. Hints for solving the problem. (1) Ignore trivial solution omega_res 0 (2) In case obtaining the resonant frequency using the condition imag(H)0 fails, try finding the resonant frequency using impedance...
(5) Consider the problem: minimize I[r(.)] - /r2 dt 0 subject to the conditions x(0)-x()-0 and the constraint 0 R is a C2 function that solves the above Suppose that x : [0, π] Let y : [0, π] → R be any other C2 function such that y(0) = Define problem y(n) 0. 0 an a(s) a. Explain why α(0)-1 and i'(0) b. Show that 0. i'(0)r'(t) y'(t) dt -X /x(t) y(t) dt 0 0 for some constant λ,...
. 1 Solve for f: - + 1 p f = 0 Preview Use the formula from above to find f when p = 5 and q = 8. Answer as a reduced fraction or rounded to 2 decimal places. f = 0 Preview Get Help: VIDEO Written Example License Points possible: 1 This is attempt 1 of 5. Distance equals rate times time, d = rt. What is the total distance that two people travel in 3 hour if...
Answer ALL the questions. Some or all of them shall be marked. Question 1. Consider the following system of differential equations: P.(D) [x] + P (D)) -(0) Px(D) [x] + P (D) x = f(t). (1) How do we determine the correct number of arbitrary constants in a general solution of the above system. (0) Explain briefly the difference between the operator method and the method of triangu- larization when used for solving the above system. Question 2. Determine whether...
Synthesis Questions Use available resources to help you answer the following questions. 1. Consider the Erlenmeyer flask with the stopper tightly inserted. How do you think the pressure would change if you doubled the number of molecules (moles) in the flask? Explain your prediction! 2. Based on your answer to the previous question, what kind of mathematical relationship is there between the pressure and number of moles nof a gas? What is the mathematical representation of that relationship? 3. Combine...
PROBLEM 5. TUNING A CIRCUIT: PRACTICAL RESONANCE. Consider a forced RLC circuit with L-1 (H), R-10 (12) and C 丽0 (f). Suppose an alternating current supplies a electromotive force Et)100 coswt. The equation modeling the charge Q(t) on the capacitor is 650 Q"(t) 10Q650Q(t) 100 coswt. a. Is the damping over-, under- or critical? Find the form of the general solution. Identify the transient and steady-state parts of the solution. b. Find the amplitude C(w) of the steady-state piece (here...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 31 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago