Homework Answers
![съби a Bor ос.H3 B91 So R.D.S Step Reciction will follow SNL path way Step [ formation of casbocation] C) + bse Step 2 [1,2]](http://img.homeworklib.com/questions/793d11d0-7d12-11eb-88e2-6344f210cf80.png?x-oss-process=image/resize,w_560)
Add Answer to:
Draw the mechanism for each
Сн,он Сосын, а. Br Br NaOCH Осн. b. CH,CH,OCHCH
Determine the product for each reaction. HBr А. CHa он Br ОСн-CHз "он он осн-сHа mCHA...
Determine the product for each reaction. HBr А. CHa он Br ОСн-CHз "он он осн-сHа mCHA [11 CH3CH2O Na В. ОН -С—С—Н T I CH3 H Нас [2] H20 OCH2CH3 TE OH CH3 "Вг Н-с-С—CH он A OCH2CH3 CH,CH-он С. Нин. nCH3 "CHз H2SO4 H
11. Consider this list of compounds: ch,San,CH, c,&ch, Сн,он син,соон Calcium Сн, соон сан,осн, CH Can'...
11. Consider this list of compounds: ch,San,CH, c,&ch, Сн,он син,соон Calcium Сн, соон сан,осн, CH Can' C.H. Can CH,CH,COOH CH, CH.CH CH, COCH, CH,CHCH, CH, CH, OCHCH CH, COCH, CH, CH, CH, OH bH Cage Which ONE of them is responsible for this IR and this 'H NMR spectrum? IR SPECTRUM ALS 1600 1600 1400 190 oo NMR SPECTRUM R PHASE liquid film NMR SOLVENT CCIA
e сн, осн, снснснснсн,сн, CH снснснснсн,сн, осн, сн, с сн Cla сн-снсн-снсH,сн, снрн When 2-methyl-3. besene...
e сн, осн, снснснснсн,сн, CH снснснснсн,сн, осн, сн, с сн Cla сн-снсн-снсH,сн, снрн When 2-methyl-3. besene is treated with Cly in methanol, three products are formed (neglecting stereohomers). Draw curved arrews to show the movement of electroas in this step of the reaction mechanism Arrow paching Instructions но— сн, :б—сн, CH :0- сн На -C-CH Cн но — сн, Н,с- CH Нас —с Sab A Ery Anoe rs
Propose mechanisms consistent with the following reactions 8-48 H.SO н.о Br HBr ъ) Он (а) ROOR...
Propose mechanisms consistent with the following reactions 8-48 H.SO н.о Br HBr ъ) Он (а) ROOR Br СHBE, Вг Br Вг HЕr (d) NaOH осH CH, Cl Вr НС Br Br CH CH OH Cн CH, Он Н н'. Н,о Он Н "сн CH, CH,CH CH,CH Он н' (g) CH Oн осн, н CH—С-С (h) 2 н Н Н Н
Propose mechanisms consistent with the following reactions 8-48 H.SO н.о Br HBr ъ) Он (а) ROOR Br СHBE, Вг Br...
What is the product of the nucleophilic substitution reaction shown below? Br + сн,он OCH, "Осн.
What is the product of the nucleophilic substitution reaction shown below? Br + сн,он OCH, "Осн.
Part D Drag the appropriate compounds to their respective bins. HOCH o ОСН-СН, НО НО СН,ОН...
Part D Drag the appropriate compounds to their respective bins. HOCH o ОСН-СН, НО НО СН,ОН ОН НО. CH OH НО CH OH ОН ОН ОН ОН ОСН, Reducing Sugar Non-Reducing Suger Submit Request Answer
1. Classify each reaction by type. +Br a. b. сH,CH,сHсH сн, Cн,CH3CHCHсн, он c. 2. Draw...
1. Classify each reaction by type. +Br a. b. сH,CH,сHсH сн, Cн,CH3CHCHсн, он c. 2. Draw an energy diagram for a two- step reaction where the first step is endothermic, second is exothermic and overall is endothermic. The first step is rate limiting. Label reactants, products and intermediates 3. The treatment of t-butyl alcohol with HCl gives t-butyl chloride as shown below. When the [HCI] doubles the rate doubles. When the [alcohol] triples the rate is tripled. Write a rate...
Propose a synthesis for the following transformations 5-6 NO2 Br (а) осн, оснз Br NO2 (b)...
Propose a synthesis for the following transformations
5-6 NO2 Br (а) осн, оснз Br NO2 (b) но NO2 (с) Он NO2 (d)
Which intermediate is involved in the mechanism of this base-promoted hydrolysis? о ОН HO -d-oCH,сну -...
Which intermediate is involved in the mechanism of this base-promoted hydrolysis? о ОН HO -d-oCH,сну - (А) *CH-CH, (В) OCH CH3 (С) -2-осн,сн, ОН ОН (D) -c-oCH,CH,
нс Br СН,ОН HC CH a. Write the rate law for this reaction. How does this...
нс Br СН,ОН HC CH a. Write the rate law for this reaction. How does this compare to the rate law for an SN1 reaction? b. Do you think that both E1 and Sn1 reactions will have similar reaction energy diagrams? Why or why not? 2. Show the mechanism and product or products for an E2 reaction. (Mechanism 9.5 in your text walks you through this example). -CH3 + Hope НАС Сн, CH,CH-OH Br a. What is the rate law...
Determine the product for each reaction. HBr А. CHa он Br ОСн-CHз "он он осн-сHа mCHA [11 CH3CH2O Na В. ОН -С—С—Н T I CH3 H Нас [2] H20 OCH2CH3 TE OH CH3 "Вг Н-с-С—CH он A OCH2CH3 CH,CH-он С. Нин. nCH3 "CHз H2SO4 H
11. Consider this list of compounds: ch,San,CH, c,&ch, Сн,он син,соон Calcium Сн, соон сан,осн, CH Can' C.H. Can CH,CH,COOH CH, CH.CH CH, COCH, CH,CHCH, CH, CH, OCHCH CH, COCH, CH, CH, CH, OH bH Cage Which ONE of them is responsible for this IR and this 'H NMR spectrum? IR SPECTRUM ALS 1600 1600 1400 190 oo NMR SPECTRUM R PHASE liquid film NMR SOLVENT CCIA
e сн, осн, снснснснсн,сн, CH снснснснсн,сн, осн, сн, с сн Cla сн-снсн-снсH,сн, снрн When 2-methyl-3. besene is treated with Cly in methanol, three products are formed (neglecting stereohomers). Draw curved arrews to show the movement of electroas in this step of the reaction mechanism Arrow paching Instructions но— сн, :б—сн, CH :0- сн На -C-CH Cн но — сн, Н,с- CH Нас —с Sab A Ery Anoe rs
Propose mechanisms consistent with the following reactions 8-48 H.SO н.о Br HBr ъ) Он (а) ROOR Br СHBE, Вг Br Вг HЕr (d) NaOH осH CH, Cl Вr НС Br Br CH CH OH Cн CH, Он Н н'. Н,о Он Н "сн CH, CH,CH CH,CH Он н' (g) CH Oн осн, н CH—С-С (h) 2 н Н Н Н
Propose mechanisms consistent with the following reactions 8-48 H.SO н.о Br HBr ъ) Он (а) ROOR Br СHBE, Вг Br...
What is the product of the nucleophilic substitution reaction shown below? Br + сн,он OCH, "Осн.
Part D Drag the appropriate compounds to their respective bins. HOCH o ОСН-СН, НО НО СН,ОН ОН НО. CH OH НО CH OH ОН ОН ОН ОН ОСН, Reducing Sugar Non-Reducing Suger Submit Request Answer
1. Classify each reaction by type. +Br a. b. сH,CH,сHсH сн, Cн,CH3CHCHсн, он c. 2. Draw an energy diagram for a two- step reaction where the first step is endothermic, second is exothermic and overall is endothermic. The first step is rate limiting. Label reactants, products and intermediates 3. The treatment of t-butyl alcohol with HCl gives t-butyl chloride as shown below. When the [HCI] doubles the rate doubles. When the [alcohol] triples the rate is tripled. Write a rate...
Propose a synthesis for the following transformations
5-6 NO2 Br (а) осн, оснз Br NO2 (b) но NO2 (с) Он NO2 (d)
Which intermediate is involved in the mechanism of this base-promoted hydrolysis? о ОН HO -d-oCH,сну - (А) *CH-CH, (В) OCH CH3 (С) -2-осн,сн, ОН ОН (D) -c-oCH,CH,
нс Br СН,ОН HC CH a. Write the rate law for this reaction. How does this compare to the rate law for an SN1 reaction? b. Do you think that both E1 and Sn1 reactions will have similar reaction energy diagrams? Why or why not? 2. Show the mechanism and product or products for an E2 reaction. (Mechanism 9.5 in your text walks you through this example). -CH3 + Hope НАС Сн, CH,CH-OH Br a. What is the rate law...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago