Homework Answers
Add Answer to:
Chat Consider the following reactions. Adiprotic acid H2A will react with water as shown in the...
Consider the following diprotic acid. H2AH20 Ho+HA Kal-5.0x105 +A2- The initial concentration of H2A = 1.0...
Consider the following diprotic acid. H2AH20 Ho+HA Kal-5.0x105 +A2- The initial concentration of H2A = 1.0 × 10-5 M. HA" + H20 H30" Kai = 4.5 x 10-5 Lal 1. Since the Ka and Ka2 values are very close, treat both reactions simultaneously. (a) Determine the H3+ at equilibrium 2 Now, as a comparison, ignore the second reaction (a) Determine the [H0. 3. Is the approximation of ignoring the second reaction valid?
Credit for work! Thank you! 11) Hydrogen sulfide will react with water as shown in the following reactions. H2S(g) + H2...
Credit for work! Thank you!
11) Hydrogen sulfide will react with water as shown in the following reactions. H2S(g) + H2O(l) ** 30"(aq) + HS-(aq) Ki-1.0 x 10-7 HS (aq) + H2O(l) + 30*(aq) + $9-(aq) K2-? H2S(8) + 2H2O(1) + 3O*(aq) + 52 (aq) Ks- 1.3 x 10-20 What is the value of K2? Show calculation steps.
The following pictures represent solutions that contain a weak acid HA (pka = 5.0) and its...
The following pictures represent solutions that contain a weak acid HA (pka = 5.0) and its potassium salt KA. Unshaded spheres represent H atoms and shaded spheres represent A-ions. (K+, H30, OH-, and solvent H2O molecules have been omitted for clarity.) -HA -A IC (1) 12) Which of these solutions are buffers? A) (1) and (2) C) (1), (2) and (3) B) (1) and (3) D) All are buffer solutions. following pictures represent solutions at various stages in the titration...
The following pictures represent solutions that contain a weak acid HA (pka = 5.0) and its...
The following pictures represent solutions that contain a weak acid HA (pka = 5.0) and its potassium salt KA. Unshaded spheres represent H atoms and shaded spheres represent A-ions. (K, H30, OH", and solvent H2O molecules have been omitted for clarity.) -HA -A (3) (1) 12) 12) Which of these solutions are buffers? A) (1) and (2) C) (1), (2) and (3) B) (1) and (3) D) All are buffer solutions The following pictures represent solutions at various stages in...
The following pictures represent solutions that contain a weak acid HA (pka = 5.0) and its...
The following pictures represent solutions that contain a weak acid HA (pka = 5.0) and its potassium salt KA. Unshaded spheres represent H atoms and shaded spheres represent A-ions. (K, H30, OH", and solvent H2O molecules have been omitted for clarity.) -HA -A (1) 12) 12) Which of these solutions are buffers? A) (1) and (2) C) (1), (2) and (3) B) (1) and (3) D) All are buffer solutions The following pictures represent solutions at various stages in the...
1. Which of the following will have the greatest standard molar entropy (Sº)? a. NH3(g) d....
1. Which of the following will have the greatest standard molar entropy (Sº)? a. NH3(g) d. H:0(1) b. He(g) e. CaCO(s) c. C(s, graphite) 2. Indicate which of the following has the highest entropy at 298 K. a. 0.5 g of HCN b. 1 mol of HCN c. 2 kg of HCN d. 2 mol of HCN e. All of the above have the same entropy at 298 K. EVALUATING AS FOR REACTIONS (non-math recognition) 3. Indicate which one of...
Exercise #1: (4 marks) Balance each of the following redox reactions in acid condition: a) Mg(s)...
Exercise #1: (4 marks) Balance each of the following redox reactions in acid condition: a) Mg(s) + H2O(g) → Mg(OH)2(s) + H2(8) b) Cr(NO3)3(aq) + Al(s) + Al(NO3)2(aq) + Cr(s) (6 marks) Exercise #2: In both cases write the balanced formula equation of the reaction and then answer to the question. a) If 25.98 mL of 0.1180 M KOH solution reacts with 52.50 mL of CH,COOH solution, what is the molarity of the acid solution? b) If 26.25 mL of...
if you can't answer all ,please don't answer 1) of the reactions below, which one is...
if you can't answer all ,please don't answer
1) of the reactions below, which one is a decomposition reaction? A) Ca(NO3)2 + Na2S -- CdS +2NaNO3 B) NH4Cl- NH3 + HCI C) 2Mg + 02 - 2MgO D) 2N2 + 3H2 → 2NH3 E) 2CH4 + 402 - 2002 + 4H20 miches of - x 1? 2 2) Calculate the percentage by mass of ammonia in cisplatin, PtCl2/NH3 12. A) 12.53 B) 5.68 C) 18.09 D) 11.35 E) 4.67 3)...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of w...
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of whole numbers? __Cas(PO4h + H2SO4 - Caso + HPO. A) 3 B) 8 C) 10 D) 11 2) What is the coefficient of H20 when the following equation is properly balanced with smallest set of whole numbers? ALC + H2O - AM(OH), + CHE A) 3 B) 4 C) 6 D) 12 E) 24 3) of the reactions below, which one is...
Consider the following diprotic acid. H2AH20 Ho+HA Kal-5.0x105 +A2- The initial concentration of H2A = 1.0 × 10-5 M. HA" + H20 H30" Kai = 4.5 x 10-5 Lal 1. Since the Ka and Ka2 values are very close, treat both reactions simultaneously. (a) Determine the H3+ at equilibrium 2 Now, as a comparison, ignore the second reaction (a) Determine the [H0. 3. Is the approximation of ignoring the second reaction valid?
Credit for work! Thank you!
11) Hydrogen sulfide will react with water as shown in the following reactions. H2S(g) + H2O(l) ** 30"(aq) + HS-(aq) Ki-1.0 x 10-7 HS (aq) + H2O(l) + 30*(aq) + $9-(aq) K2-? H2S(8) + 2H2O(1) + 3O*(aq) + 52 (aq) Ks- 1.3 x 10-20 What is the value of K2? Show calculation steps.
The following pictures represent solutions that contain a weak acid HA (pka = 5.0) and its potassium salt KA. Unshaded spheres represent H atoms and shaded spheres represent A-ions. (K+, H30, OH-, and solvent H2O molecules have been omitted for clarity.) -HA -A IC (1) 12) Which of these solutions are buffers? A) (1) and (2) C) (1), (2) and (3) B) (1) and (3) D) All are buffer solutions. following pictures represent solutions at various stages in the titration...
The following pictures represent solutions that contain a weak acid HA (pka = 5.0) and its potassium salt KA. Unshaded spheres represent H atoms and shaded spheres represent A-ions. (K, H30, OH", and solvent H2O molecules have been omitted for clarity.) -HA -A (3) (1) 12) 12) Which of these solutions are buffers? A) (1) and (2) C) (1), (2) and (3) B) (1) and (3) D) All are buffer solutions The following pictures represent solutions at various stages in...
The following pictures represent solutions that contain a weak acid HA (pka = 5.0) and its potassium salt KA. Unshaded spheres represent H atoms and shaded spheres represent A-ions. (K, H30, OH", and solvent H2O molecules have been omitted for clarity.) -HA -A (1) 12) 12) Which of these solutions are buffers? A) (1) and (2) C) (1), (2) and (3) B) (1) and (3) D) All are buffer solutions The following pictures represent solutions at various stages in the...
1. Which of the following will have the greatest standard molar entropy (Sº)? a. NH3(g) d. H:0(1) b. He(g) e. CaCO(s) c. C(s, graphite) 2. Indicate which of the following has the highest entropy at 298 K. a. 0.5 g of HCN b. 1 mol of HCN c. 2 kg of HCN d. 2 mol of HCN e. All of the above have the same entropy at 298 K. EVALUATING AS FOR REACTIONS (non-math recognition) 3. Indicate which one of...
Exercise #1: (4 marks) Balance each of the following redox reactions in acid condition: a) Mg(s) + H2O(g) → Mg(OH)2(s) + H2(8) b) Cr(NO3)3(aq) + Al(s) + Al(NO3)2(aq) + Cr(s) (6 marks) Exercise #2: In both cases write the balanced formula equation of the reaction and then answer to the question. a) If 25.98 mL of 0.1180 M KOH solution reacts with 52.50 mL of CH,COOH solution, what is the molarity of the acid solution? b) If 26.25 mL of...
if you can't answer all ,please don't answer
1) of the reactions below, which one is a decomposition reaction? A) Ca(NO3)2 + Na2S -- CdS +2NaNO3 B) NH4Cl- NH3 + HCI C) 2Mg + 02 - 2MgO D) 2N2 + 3H2 → 2NH3 E) 2CH4 + 402 - 2002 + 4H20 miches of - x 1? 2 2) Calculate the percentage by mass of ammonia in cisplatin, PtCl2/NH3 12. A) 12.53 B) 5.68 C) 18.09 D) 11.35 E) 4.67 3)...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of whole numbers? __Cas(PO4h + H2SO4 - Caso + HPO. A) 3 B) 8 C) 10 D) 11 2) What is the coefficient of H20 when the following equation is properly balanced with smallest set of whole numbers? ALC + H2O - AM(OH), + CHE A) 3 B) 4 C) 6 D) 12 E) 24 3) of the reactions below, which one is...
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 12 minutes ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 35 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 7 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 7 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 7 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago