Homework Answers
Add Answer to:
4. (24 points) a) Circle one of the alkyl bromide (A or B) that most likely...
4.(18 points) Using the arrow, provide the detailed reaction conditions necessary to give the following. You...
4.(18 points) Using the arrow, provide the detailed reaction conditions necessary to give the following. You do not need to provide any starting material or product, just the reaction conditions (see example below) 1.B Example: Show reagent 'B' followed by aqueous acid: 2. H30 a. Markovnikov addition of H2O to a double bond: b. Anti-Markovnikov addition of H2O to a double bond: c. Markovnikov addition to form an alkyl bromide from an alkene: d. Reaction conditions to change 1,2-dimethylcyclohexene into...
4. Predict the products of the following reactions & indicate whether they are most likely to...
4. Predict the products of the following reactions & indicate whether they are most likely to go through an SN2, SN1, E1, or E2 mechanism. NaCN DMSO NaOH CH3OH heat Only one product is formed in the following E2 elimination reaction. Draw an arrow-pushing mechanism for the reaction and provide the correct product structure. Include a 3-D drawing (chair conformation) displaying proper stereochemistry of the transition state to explain formation of only the major product. CH3 •Br NaOCH3 ~"'CHS
ehydrogen 5. Compound A (C>H1sBr) is not a primary alkyl bromide. It yields a single alkene...
ehydrogen 5. Compound A (C>H1sBr) is not a primary alkyl bromide. It yields a single alkene (compound B) on being heated with sodium ethoxide in ethanol. Hydrogenation of compound B yields 2, 4-dimethylpentane. A) Identify compound A, provide structure formula of A. (3 points) CH3 8 енg A=HC-CH-CH-CH-CH3 B) Write the chemical equation of A with sodium ethoxide to produce B. (2 points) ntr) (2 poimts C) What is the symbol of reaction mechanism? (SN1, SN2, E1 OR E2) 6...
20. Arrange the following molecules based on their reactivity for SN1 mechanism (the most reactive to...
20. Arrange the following molecules based on their reactivity for SN1 mechanism (the most reactive to the least reactive) [4pts] Br Br CH3Br Br 21. Considering the SN1, SN2, E1, and E2 mechanisms, the energy diagram shown below corresponds to [4Pts] a. only the SN1 mechanism b. only the E1 mechanism c. both the SN2 and E2 mechanisms d. only the SN2 mechanism. e. only the E2 mechanism f. both the SN1 and El mechanisms energy rxn coordinate 22. If...
CHE241/240 Assignment 2: SN2 and SN1 Name:Alexo.adio Hesker 1. Indicate whether the following substitution reactions will...
CHE241/240 Assignment 2: SN2 and SN1 Name:Alexo.adio Hesker 1. Indicate whether the following substitution reactions will proceed by Sy or Sy? [3] Racemic NaCN DMSO 2. Draw a mechanism for the following Sy reaction? [3] SH + NaSH NASH - - NaBr + NaBt 3. Draw the transition state for the following Sy2 reaction? [3] 1. Indicate whether the following substitution reactions will proceed by SNP or Sn"? [3] MOH problemi CXCHANS H.0 NaCN DMSO 2. Draw a mechanism for...
Problem 2 (10 pts) Circle the bromocyclohexane derivative that most likely corresponds to the reaction coordinate...
Problem 2 (10 pts) Circle the bromocyclohexane derivative that most likely corresponds to the reaction coordinate diagram for the reaction shown below. Indicate the probable reaction type: Draw the major product of the reaction. Label point A as either a transition-state (TS) or an intermediate (Int). Label point B as either a transition-state (TS) or an intermediate (Int). > Draw the structures of A and B. CH3OH reaction coordinate
3. Based on your answer in 2. select the most likely reaction pathway. Explain how the...
3. Based on your answer in 2. select the most likely reaction pathway. Explain how the substitution mechanism forms the product structure(s) shown. 2points А, H Br off and add NH toi O position because it Would Rick Ph Ph Ph- B H NH2 Ph Ph + NH 4. Identify the reaction components and solvents as more soluble in the aqueous (A) or organic (O) layer during separation of substitution and protonation steps. 3 pts Br HN НN CIO NH3...
Draw a labelled reaction coordinate diagram for the both SN reactions. Label the activation energy (free...
Draw a labelled reaction coordinate diagram for the both SN reactions. Label the activation energy (free energy of activation) and give the approximate structures of the intimal state, the transition states, the intermediate and product at the correct points along the reaction coordinate. Also, can you decide on the basis of the kinetic expression whether the t-butyl chloride-hydroxide ion reaction proceeds by a one-step or a two-step mechanism? Explain why observed kinetic expression is consistent with the mechanism you chose.
4. a) In the following substitution reaction, circle and clearly label the individual atoms that perform the follo...
4. a) In the following substitution reaction, circle and clearly label the individual atoms that perform the following roles: Nucleophile, Electrophile, and Leaving Group. Br OCH2CH3 Ethanol +HBr b) What effect on the overall rate of this reaction would result if the starting concentrations of both 2-bromo-2- methylbutane and ethanol were halved? c) What general effect on the overall rate of this reaction would result if the solvent were changed from acetone to 2-propanol? d) Draw an Energy versus Reaction...
4. a) In the following substitution reaction, circle and clearly label the individual atoms that perform the follow...
4. a) In the following substitution reaction, circle and clearly label the individual atoms that perform the following roles: Nucleophile, Electrophile, and Leaving Group teens . فرا | Br. Ethanol * مرا OCH CH3. HBO د . b) What effect on the overall rate of this reaction would result if the starting concentrations of both 2 bromo-2- methylbutane and ethanol were halved? c) What general effect on the overall rate of this reaction would result if the solvent were changed...
4.(18 points) Using the arrow, provide the detailed reaction conditions necessary to give the following. You do not need to provide any starting material or product, just the reaction conditions (see example below) 1.B Example: Show reagent 'B' followed by aqueous acid: 2. H30 a. Markovnikov addition of H2O to a double bond: b. Anti-Markovnikov addition of H2O to a double bond: c. Markovnikov addition to form an alkyl bromide from an alkene: d. Reaction conditions to change 1,2-dimethylcyclohexene into...
4. Predict the products of the following reactions & indicate whether they are most likely to go through an SN2, SN1, E1, or E2 mechanism. NaCN DMSO NaOH CH3OH heat Only one product is formed in the following E2 elimination reaction. Draw an arrow-pushing mechanism for the reaction and provide the correct product structure. Include a 3-D drawing (chair conformation) displaying proper stereochemistry of the transition state to explain formation of only the major product. CH3 •Br NaOCH3 ~"'CHS
ehydrogen 5. Compound A (C>H1sBr) is not a primary alkyl bromide. It yields a single alkene (compound B) on being heated with sodium ethoxide in ethanol. Hydrogenation of compound B yields 2, 4-dimethylpentane. A) Identify compound A, provide structure formula of A. (3 points) CH3 8 енg A=HC-CH-CH-CH-CH3 B) Write the chemical equation of A with sodium ethoxide to produce B. (2 points) ntr) (2 poimts C) What is the symbol of reaction mechanism? (SN1, SN2, E1 OR E2) 6...
20. Arrange the following molecules based on their reactivity for SN1 mechanism (the most reactive to the least reactive) [4pts] Br Br CH3Br Br 21. Considering the SN1, SN2, E1, and E2 mechanisms, the energy diagram shown below corresponds to [4Pts] a. only the SN1 mechanism b. only the E1 mechanism c. both the SN2 and E2 mechanisms d. only the SN2 mechanism. e. only the E2 mechanism f. both the SN1 and El mechanisms energy rxn coordinate 22. If...
CHE241/240 Assignment 2: SN2 and SN1 Name:Alexo.adio Hesker 1. Indicate whether the following substitution reactions will proceed by Sy or Sy? [3] Racemic NaCN DMSO 2. Draw a mechanism for the following Sy reaction? [3] SH + NaSH NASH - - NaBr + NaBt 3. Draw the transition state for the following Sy2 reaction? [3] 1. Indicate whether the following substitution reactions will proceed by SNP or Sn"? [3] MOH problemi CXCHANS H.0 NaCN DMSO 2. Draw a mechanism for...
Problem 2 (10 pts) Circle the bromocyclohexane derivative that most likely corresponds to the reaction coordinate diagram for the reaction shown below. Indicate the probable reaction type: Draw the major product of the reaction. Label point A as either a transition-state (TS) or an intermediate (Int). Label point B as either a transition-state (TS) or an intermediate (Int). > Draw the structures of A and B. CH3OH reaction coordinate
3. Based on your answer in 2. select the most likely reaction pathway. Explain how the substitution mechanism forms the product structure(s) shown. 2points А, H Br off and add NH toi O position because it Would Rick Ph Ph Ph- B H NH2 Ph Ph + NH 4. Identify the reaction components and solvents as more soluble in the aqueous (A) or organic (O) layer during separation of substitution and protonation steps. 3 pts Br HN НN CIO NH3...
4. a) In the following substitution reaction, circle and clearly label the individual atoms that perform the following roles: Nucleophile, Electrophile, and Leaving Group. Br OCH2CH3 Ethanol +HBr b) What effect on the overall rate of this reaction would result if the starting concentrations of both 2-bromo-2- methylbutane and ethanol were halved? c) What general effect on the overall rate of this reaction would result if the solvent were changed from acetone to 2-propanol? d) Draw an Energy versus Reaction...
4. a) In the following substitution reaction, circle and clearly label the individual atoms that perform the following roles: Nucleophile, Electrophile, and Leaving Group teens . فرا | Br. Ethanol * مرا OCH CH3. HBO د . b) What effect on the overall rate of this reaction would result if the starting concentrations of both 2 bromo-2- methylbutane and ethanol were halved? c) What general effect on the overall rate of this reaction would result if the solvent were changed...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 11 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 42 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago