What is meant by the term "strategic fit"? What are the advantages of pursuing strategic fit...
What is meant by the term "strategic fit"? What are the advantages of pursuing strategic fit and matchups in choosing which industries to diversify into?
Please type and no writing on paper thank you:)
Homework Answers
What is meant by the term strategic fit? What are the advantages of pursuing strategic fit and matchups in choosing which industries to diversify into?
A related diversification strategy involves building the company around businesses where there is good strategic fit across corresponding value chain activities. Strategic fit exists whenever one or more activities constituting the value chains of different businesses are sufficiently similar to present opportunities for cross-business sharing or transferring of the resources and capabilities that enable these activities. Related diversification is based on value chain matchups with respect to key value chain activities—those that play a central role in each business's strategy and that link to its industry's key success factors
Add Answer to:
What is meant by the term "strategic fit"? What are the
advantages of pursuing strategic fit...
What is meant by the term “strategic performance driver?” What is the relationship of HR activities...
What is meant by the term “strategic performance driver?” What is the relationship of HR activities to strategic performance drivers?
What are the advantages of using capital in the production process? What is meant by the...
What are the advantages of using capital in the production process? What is meant by the term "division of labor"? What are the advantages of specialization in the use of human and material resources? Explain why exchange is the necessary consequence of specialization.
What is meant by the term, 'leverage', and why is it important to managers? What are...
What is meant by the term, 'leverage', and why is it important to managers? What are some examples of some companies or industries that would tend to be more highly leveraged? Which ones might be less leveraged? Why do you think this is the case?
thank you in advance :) What is meant by the term risk-free interest? Why is the...
thank you in advance :)
What is meant by the term risk-free interest? Why is the U.S. Treasury bill yield used as the risk free interest rate?
It is essential that organizational leaders understand the competitive, financial, and strategic advantages that can result...
It is essential that organizational leaders understand the competitive, financial, and strategic advantages that can result from not only implementing self-managed virtual teams but also ensuring that they are effective, high-performing groups. What advantages and disadvantages do you see for leaders attempting to manage a virtual team consisting of employees around the globe? Please provide one advantage and one disadvantage.
4.) Describe what is meant by the term “missing value”. The user-defined values that indicate data...
4.) Describe what is meant by the term “missing value”. The user-defined values that indicate data are missing for a variable 5.) Describe the difference between wide format and long format data in SPSS. 6.) Describe what is meant by the term “syntax” in SPSS. Here you can see the Frequencies command, which specifies which variables you want to analyses
what are the differences between the best fit (strategic business-based) and the best practices perspectives such...
what are the differences between the best fit (strategic business-based) and the best practices perspectives such as higher competitive pay or performance-based pay. In your opinion, which is superior and why?
What is meant by the term commodity money? The use of coins to purchase commodities. A...
What is meant by the term commodity money? The use of coins to purchase commodities. A type of certificate of deposit that can be used to buy commodities. A share invested in commodities. A type of money that can also function as a commodity.
What is meant by the term one man’s terrorist is another man’s hero? What are your...
What is meant by the term one man’s terrorist is another man’s hero? What are your thoughts on communications as it relates to this statement? please elaborate
What is meant by the term “molecular clock”? What are the basic assumptions by which it...
What is meant by the term “molecular clock”? What are the basic assumptions by which it is presumed to operate? How have data from molecular clock analyses been used?
thank you in advance :)
What is meant by the term risk-free interest? Why is the U.S. Treasury bill yield used as the risk free interest rate?
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 35 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago