The density of oxygen gas at a given temperature and pressure is 1.30 gL. The volume...
The density of oxygen gas at a given temperature and pressure is 1.30 gL. The volume of 21.0 ml of O2 is effused from a device for 1,000 s. When the same device is used under the same conditions, the effusion rate of an unknown gas is 15.0 mL / s. What is the density of the unknown gas? Answer:2.55g/L
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
The density of oxygen gas at a given temperature and
pressure is 1.30 gL. The volume...
1. If nitrogen gas has a density of 1.14 g/L, and an unknown gas has a...
1. If nitrogen gas has a density of 1.14 g/L, and an unknown gas
has a density of 4.2 g/L at the same temperature and pressure, what
is the ratio of the rate of effusion of the known gas to the rate
of effusion of nitrogen?
2. The combustion reaction for octane burning in oxygen is:
2 C8H18 (l) + 25 O2(g)
→ 16 CO2(g) +18 H2O(g)
∆H = -10869 kJ .
Suppose an oxygen bomb calorimeter is loaded with oxygen...
QUESTION 3 0.5 points Save Answer If nitrogen gas has a density of 1.14 g/L, and...
QUESTION 3 0.5 points Save Answer If nitrogen gas has a density of 1.14 g/L, and an unknown gas has a density of 5.67 g/L at the same temp and pressure, what is the ratio of the rate of effusion of the known gas to the rate of effusion of nitrogen? rate effusion unknown - 2 rate effusion N2 QUESTION 4 0.5 points Save Answer The combustion reaction for octane burning in oxygen is: 2 C8H18 (1) + 25 O2(g)...
Given: Room temperature: 293.0 K Barometric pressure: 764.0 mmHg Vapor of water: 17.5 mmHg Volume of...
Given: Room temperature: 293.0 K Barometric pressure: 764.0 mmHg Vapor of water: 17.5 mmHg Volume of O2 collected: 68.00 mL Density of H2O2: 1.01 g/mL % Composition H2O2: 3.02 % Volume of H2O2 used: 5.00 mL Letter of the unknown solution of H2O2: A Volume of O2 collected for the unknown: 43.00 mL Calculate the corrected barometric pressure. (mmHg) Calculate the volume of O2 at STP. (mL) Based on the reaction stoichiometry, calculate the number of moles of O2. (moles)...
A sample of oxygen gas at a pressure of and a temperature of, occupies a volume...
A sample of oxygen gas at a pressure of and a temperature of,
occupies a volume of. If the gas is compressed at constant
temperature until its pressure is, the volume of the gas sample
will be mL.
от и се спес 0 accc Ппрола напис п псиса по иппо чистио. A sample of oxygen gas at a pressure of 773 torr and a temperature of 22.5°C, occupies a volume of 571 mL. If the gas is compressed at constant temperature...
Answer both questions please and thank you!!! QUESTION 3 0.5 points If nitrogen gas has a...
Answer both questions please and thank you!!!
QUESTION 3 0.5 points If nitrogen gas has a density of 1.14 g/L, and an unknown gas has a density of 3.41 g/L at the same temperature and pressure, what is the ratio of the rate of effusion of the known gas to the rate of effusion of nitrogen? rate effusion unknown rate effusion N2 ? QUESTION 4 0.5 points The combustion reaction for octane burning in oxygen is: 2 C8H18 () 25...
A sample of oxygen gas has a density of g/L at a pressure of 0.912 atm and...
A sample of oxygen gas has a density of g/L at a pressure of 0.912 atm and a temperature of 47 °C. Assume ideal behavior. A 3.20 gram sample of an unknown gas is found to occupy a volume of 0.939 L at a pressure of 970 . mmHg and a temperature of 46 °C. Assume ideal behavior. The molar mass of the unknown gas is g/mol.
QUESTION 3 If nitrogen gas has a density of 1.14 g L, and an unknown gas has a density of 191 g/L at the same tempe...
QUESTION 3 If nitrogen gas has a density of 1.14 g L, and an unknown gas has a density of 191 g/L at the same temperature and pressure, what is the ratio of the rate of effusion of the known gas to the rate of effusion of nitrogen? rate effusion unknown . ? rate effusion N2
calculate the volume of oxygen required to burn 12L of ethane gas. C2H6 to produce carbon...
calculate the volume of oxygen required to burn 12L of ethane gas. C2H6 to produce carbon dioxide and water, if the volumes of C2H6 and O2 are measured under under the same conditions of temperature and pressure
Express your answer with the appropriate units. 1. How many milliliters of oxygen gas at STP...
Express your answer with the appropriate units. 1. How many milliliters of oxygen gas at STP are released from heating 2.05 g of mercuric oxide? 2HgO(s)→2Hg(l)+O2(g) 2.How many grams of iron(III) carbonate decompose to give 61.2 mL of carbon dioxide gas at STP?Fe2(CO3)3⟶ΔFe2O3(s)+3CO2(g) 3. How many milliliters of oxygen gas at STP are released from heating 2.05 g of mercuric oxide? 2HgO(s)→2Hg(l)+O2(g) 4.Assuming constant conditions, how many milliliters of chlorine gas react to yield 2.00 L of dichlorine trioxide?Cl2(g)+O2(g)→Cl2O3(g) 5.Assuming...
1) Given the following data, calculate the temperature of the gas in Kelvin, the pressure of the ...
1) Given the following data, calculate the temperature of the gas in Kelvin, the pressure of the gas in atm, the mass of the condensed liquid, the volume of the gas in L, the moles of gas in the flask and then calculate the molar mass of the unknown liquid Mass of empty flask and foil 78.639g 99.3°C 14.4 psi 79.118g Temperature of hot water atm Pressure in lab Mass of flask, foil and condensed unknown liquid AFTER heating and...
1. If nitrogen gas has a density of 1.14 g/L, and an unknown gas
has a density of 4.2 g/L at the same temperature and pressure, what
is the ratio of the rate of effusion of the known gas to the rate
of effusion of nitrogen?
2. The combustion reaction for octane burning in oxygen is:
2 C8H18 (l) + 25 O2(g)
→ 16 CO2(g) +18 H2O(g)
∆H = -10869 kJ .
Suppose an oxygen bomb calorimeter is loaded with oxygen...
QUESTION 3 0.5 points Save Answer If nitrogen gas has a density of 1.14 g/L, and an unknown gas has a density of 5.67 g/L at the same temp and pressure, what is the ratio of the rate of effusion of the known gas to the rate of effusion of nitrogen? rate effusion unknown - 2 rate effusion N2 QUESTION 4 0.5 points Save Answer The combustion reaction for octane burning in oxygen is: 2 C8H18 (1) + 25 O2(g)...
A sample of oxygen gas at a pressure of and a temperature of,
occupies a volume of. If the gas is compressed at constant
temperature until its pressure is, the volume of the gas sample
will be mL.
от и се спес 0 accc Ппрола напис п псиса по иппо чистио. A sample of oxygen gas at a pressure of 773 torr and a temperature of 22.5°C, occupies a volume of 571 mL. If the gas is compressed at constant temperature...
Answer both questions please and thank you!!!
QUESTION 3 0.5 points If nitrogen gas has a density of 1.14 g/L, and an unknown gas has a density of 3.41 g/L at the same temperature and pressure, what is the ratio of the rate of effusion of the known gas to the rate of effusion of nitrogen? rate effusion unknown rate effusion N2 ? QUESTION 4 0.5 points The combustion reaction for octane burning in oxygen is: 2 C8H18 () 25...
QUESTION 3 If nitrogen gas has a density of 1.14 g L, and an unknown gas has a density of 191 g/L at the same temperature and pressure, what is the ratio of the rate of effusion of the known gas to the rate of effusion of nitrogen? rate effusion unknown . ? rate effusion N2
1) Given the following data, calculate the temperature of the gas in Kelvin, the pressure of the gas in atm, the mass of the condensed liquid, the volume of the gas in L, the moles of gas in the flask and then calculate the molar mass of the unknown liquid Mass of empty flask and foil 78.639g 99.3°C 14.4 psi 79.118g Temperature of hot water atm Pressure in lab Mass of flask, foil and condensed unknown liquid AFTER heating and...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 51 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago