Homework Answers
polyatomic ion as a molecule that has been ionized by gaining or losing electrons. In a polyatomic ion, the group of covalently bonded atoms carries a net charge because the total number of electrons in the molecule is not equal to the total number of protons in the molecule. When drawing Lewis dot structures, the overall charge on a polyatomic ion is equal to the sum of the formal charges on each atom in the ion.
Bond energies are quite accurately additive in saturated polyatomic ions notwithstanding the long-range interactions and the marked dependence on the complexity of the ion of the extent of the dispersal of the free charge. Additivity is a less good approximation for unsaturated polyatomic ions.
Polyatomic ions each carry a specific charge, which is determined by their numbers of valence electrons
Add Answer to:
What three defining issues are associated with polyatomic species? These issues are associated with bonding, charge,...
12. Why is defining what a species is so difficult? (3 pts) 13. Describe the three...
12. Why is defining what a species is so difficult? (3 pts) 13. Describe the three patterns of population dispersion and provide one example of a species that is dispersed in each pattern? (6 pts) 14. What does it mean to be a K-selected species versus an r-selected species? DO NOT JUST DEFINE THE TERMS! (4 pts) 15. A hypothetical population of 10,000 humans has 6840 individuals with the blood type AA, 2860 individuals with blood type AB and 300...
Name- Exercise 1. A conservation biologist is in charge of the recovery of an endangered species...
Name- Exercise 1. A conservation biologist is in charge of the recovery of an endangered species called the Giant Kangaroo Rat (GKR), depicted below. The GKR lives in arid grasslands in California and is endangered because most of its range has been developed into agriculture One of the issues threatening the remaining populations is that the kangaroo rats are becoming infected with ear mites that interfere with their hearing ability, which affects mating and survival. The biologist goes to three...
1. How many electrons appear in the Lewis symbol for an element whose electron configuration is...
1. How many electrons appear in the Lewis symbol for an element whose electron configuration is 1s'2s'2p? a. 2 b. d. 2. In which of the following ionic compounds are ions with a +2 charge present? a LiSe c Mg,Si d. SnO 3. The Roman numeral ." in the name iron(m) oxide indicates that: a. iron is present in the form of +3 ions b. there are three iron atoms per formula unit c. there are three oxygen atoms per...
I was wondering if someone could help me with problems on my test my teacher allows me to correct the wrong ones t...
I was wondering if someone could help me with problems on my
test my teacher allows me to correct the wrong ones then give them
back for half credit. Along with the correct answer for each I’d
like to know why the answer I chose is wrong what is the correct
answer and why it is the correct answer. The marked red problems
are the incorrect problems.
17. Which of the following generally indicates the possibility of a chemical change?...
1) What is the term for a compound containing two nonmetals? A) binary acid B) ionic...
1) What is the term for a compound containing two nonmetals? A) binary acid B) ionic compound C) molecular compound D) ternary acid 2) The compound TiO2 is classified as which of the following? A) binary acid B) ionic compound C) molecular compound D) ternary acid 3) What is the name for S2-? A) sulfur ion B) sulfide ion C) sulfite ion D) sulfate ion 4) What is the chemical formula for the nitrite ion? A) NO3- B) NO32- C)...
What results when a secondary alcohol is oxidized? a. a ketone d. an acid b. an...
What results when a secondary alcohol is oxidized? a. a ketone d. an acid b. an amine e. no reaction c. an aldehyde Which of the following combinations will react spontaneously? A. 12 + Cu2+ B. Pb2+ + Ag C. Zn2+ + Mg D. Sn2+ + Ni2+ The general formula for a cycloalkane can be represented by which of the following? a. C,H, C. CH b. C.H2n+2 d. C.H21-2 In a certain reaction AH =-136 kJ and E, = 96...
Identify 8 issues in regards to Recruitment and Selection, 3 issues for Labour Relation in the...
Identify 8 issues in regards to Recruitment and Selection, 3 issues for Labour Relation in the following case study : You have recently been hired as an HR Consultant in the new HR Department of Outrage Video Games. Outrage is a five year old, upstart company, run by two very bright young men - Will Bates – President, and his best friend Steve Cobbs, Vice President. This is a very exciting change for you because Outrage, which literally started in...
1. Socially Optimal Thneed Production (Graphical Analysis) based on Dr. Seuss’ The Lorax. There is only...
1. Socially Optimal Thneed Production (Graphical Analysis) based on Dr. Seuss’ The Lorax. There is only one question, but it has several parts, (a) through (J), below, plus (k) and (l) for extra credit. The demand curve and supply curve for Thneeds (“A fine something that all people need,” according to the Once-ler Group’s web site) are given by QD= 100 –5P and QS = 2.5P – 5 [HINT: these are regular—that is economically sensible—demand and supply curves that say...
please I need help with this Х Lab 11.pdf Lab 11.pdf INTRODUCTION The chemical and physical...
please I need help with this
Х Lab 11.pdf Lab 11.pdf INTRODUCTION The chemical and physical properties of substances are influenced by the way in which valence electrons are distributed and by the three-dimensional shape of the molecule or ion. X- ray and neutron diffraction, infrared, Raman and microwave absorption spectroscopy, as well as dipole moment measurements, are used to ascertain the three-dimensional structure of a substance. Thus, techniques are available which can identify the geometry of substances Results of...
please I need help with the data sheet INTRODUCTION The chemical and physical properties of substances...
please I need help with the data sheet
INTRODUCTION The chemical and physical properties of substances are influenced by the way in which valence electrons are distributed and by the three-dimensional shape of the molecule or ion. X- ray and neutron diffraction, infrared, Raman and microwave absorption spectroscopy, as well as dipole moment measurements are used to ascertain the three-dimensional structure of a substance. Thus, techniques are available which can identify the geometry of substances. Results of these measurements generally...
12. Why is defining what a species is so difficult? (3 pts) 13. Describe the three patterns of population dispersion and provide one example of a species that is dispersed in each pattern? (6 pts) 14. What does it mean to be a K-selected species versus an r-selected species? DO NOT JUST DEFINE THE TERMS! (4 pts) 15. A hypothetical population of 10,000 humans has 6840 individuals with the blood type AA, 2860 individuals with blood type AB and 300...
Name- Exercise 1. A conservation biologist is in charge of the recovery of an endangered species called the Giant Kangaroo Rat (GKR), depicted below. The GKR lives in arid grasslands in California and is endangered because most of its range has been developed into agriculture One of the issues threatening the remaining populations is that the kangaroo rats are becoming infected with ear mites that interfere with their hearing ability, which affects mating and survival. The biologist goes to three...
1. How many electrons appear in the Lewis symbol for an element whose electron configuration is 1s'2s'2p? a. 2 b. d. 2. In which of the following ionic compounds are ions with a +2 charge present? a LiSe c Mg,Si d. SnO 3. The Roman numeral ." in the name iron(m) oxide indicates that: a. iron is present in the form of +3 ions b. there are three iron atoms per formula unit c. there are three oxygen atoms per...
I was wondering if someone could help me with problems on my
test my teacher allows me to correct the wrong ones then give them
back for half credit. Along with the correct answer for each I’d
like to know why the answer I chose is wrong what is the correct
answer and why it is the correct answer. The marked red problems
are the incorrect problems.
17. Which of the following generally indicates the possibility of a chemical change?...
1) What is the term for a compound containing two nonmetals? A) binary acid B) ionic compound C) molecular compound D) ternary acid 2) The compound TiO2 is classified as which of the following? A) binary acid B) ionic compound C) molecular compound D) ternary acid 3) What is the name for S2-? A) sulfur ion B) sulfide ion C) sulfite ion D) sulfate ion 4) What is the chemical formula for the nitrite ion? A) NO3- B) NO32- C)...
What results when a secondary alcohol is oxidized? a. a ketone d. an acid b. an amine e. no reaction c. an aldehyde Which of the following combinations will react spontaneously? A. 12 + Cu2+ B. Pb2+ + Ag C. Zn2+ + Mg D. Sn2+ + Ni2+ The general formula for a cycloalkane can be represented by which of the following? a. C,H, C. CH b. C.H2n+2 d. C.H21-2 In a certain reaction AH =-136 kJ and E, = 96...
please I need help with this
Х Lab 11.pdf Lab 11.pdf INTRODUCTION The chemical and physical properties of substances are influenced by the way in which valence electrons are distributed and by the three-dimensional shape of the molecule or ion. X- ray and neutron diffraction, infrared, Raman and microwave absorption spectroscopy, as well as dipole moment measurements, are used to ascertain the three-dimensional structure of a substance. Thus, techniques are available which can identify the geometry of substances Results of...
please I need help with the data sheet
INTRODUCTION The chemical and physical properties of substances are influenced by the way in which valence electrons are distributed and by the three-dimensional shape of the molecule or ion. X- ray and neutron diffraction, infrared, Raman and microwave absorption spectroscopy, as well as dipole moment measurements are used to ascertain the three-dimensional structure of a substance. Thus, techniques are available which can identify the geometry of substances. Results of these measurements generally...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 33 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago