Explain the solubility of amines and amides in water If I could also have any sorces...
Explain the solubility of amines and amides in water
If I could also have any sorces that could help explain it, Thanks!!!
Homework Answers
Amines and Amides are organic compounds.generally organic compounds are non-polar and their solubility in polar solvent like water is less.Where amines and amides are polar in nature, so they are soluble in water.but lower members of amines and amides are soluble and higher members are insoluble due to increase in carbon part.Among amines and amides, amides are more polar than amines and the solubility of amides is higher than amines.
Add Answer to:
Explain the solubility of amines and amides in water
If I could also have any sorces...
6) Applying resonance. Amides such as acetamide (CH3CONH2) are much weaker bases than amines, such as...
6) Applying resonance. Amides such as acetamide (CH3CONH2) are much weaker bases than amines, such as ethylamine (CH3CH2NH2). Explain why (try resonance). Predict also how protonation (reaction with H+ ) of both species would go (again, resonance can help).
What are two interesting properties of amines? How do these properties explain the solubility of amines...
What are two interesting properties of amines? How do these properties explain the solubility of amines in water? 7. Name each of the amine structures below AND indicate whether each is a primary, secondary or tertiary amine. 8. NH2 NH2 H2N B. NH
those I choose is wrong please help Amides are formed from the reaction of carboxylic acids...
those I choose is wrong please help
Amides are formed from the reaction of carboxylic acids with 1° amines carboxylic acids with 2 amines carboxylic acids with 3 amines Only A and B All of the above What are the hydrolysis products of N-methylpropanamide? propanoic acid and methylamine propanoic acid, methylamine, and water propanoic acid and ammonia
can you help with the stared questions Properties of Amines: Solubility, Basicity and Amine Salts To...
can you help with the stared questions
Properties of Amines: Solubility, Basicity and Amine Salts To My wedydd iedereen C horoby aming the Now where they. Check the path W e Salability 5. Base Hydrolysis of Amides Marea of he Namas praded Neutraline solutio n ep I by adding & M HCL racion d o the solution drop-by Chemical Equat mofthene salt Lab 9-8 4. Properties of Amines: Solubility, Basicity and Amine Salts Place 3 drops of triethylamine in a...
Pka and structure of various amides. I need some help better understanding primary, secondary, and alpha-amides...
Pka and structure of various amides. I need some help better understanding primary, secondary, and alpha-amides associated with the following pka values. I got these values from our class pka chart. Primary amide pka = 15, Seccondary amide pka = 15, alpha-amide pka =25. Particularly, I need help seeing how the alpha-amide is different structurally (molecular structure and/or lewis strucutre) than the primary amide. Thanks!
Questions and Problems 553 ation for the reaction that would produse cach of the following amines...
Questions and Problems 553 ation for the reaction that would produse cach of the following amines b. N.Methylpropanamine c. N.N-Diethylpentanamine 15.37 Briefly explain why the lower molar massamines (lewer than five carbons) exhibit appreciable solubility in water 15.38 Why is the salt of an amine appreciably more soluble in water than the mine from which it was formed 15.39 Most drugs containing amine groups are not administered as the mine but rather the amount you suggeste son why? 15.40 Why...
Does 1,3 - dimethylcyclohexane have a higher or lower vapor pressure than water? Please explain why...
Does 1,3 - dimethylcyclohexane have a higher or lower vapor pressure than water? Please explain why and what factor size has on this situation. I will vote thumbs up for a quick and detailed response. Thanks (: Also, if you could explan why dimethylcyclohexane is not soluble in water, that would be much appreciated!
Organic Chemistry Lab Structure & Solubility: Explain how you could distinguish between the following pairs of...
Organic Chemistry Lab Structure & Solubility: Explain how
you could distinguish between the following pairs of compounds?
Which compounds would be water soluble?
STRUCTURE AND SOLUBILITY Name: Lab Section: I. Esplin how you could distinguish between the following pairs of compounds. Which compounds would be water soluble? 1. Butane and 2-chlorobutane 2. Butane and 1-butanol 3. 1-butanol and 2-butanol 4. 1-butanol and butanoic acid
Can someone help me with the questions that are stared? 4. Properties of Amines: Solubility, Basicity...
Can someone help me with the questions that are stared?
4. Properties of Amines: Solubility, Basicity and Amine Salts Place 3 drops of triethylamine in a test tube. Cautiously note the odor of the amine by fanning the vapor with your hand toward your nose. Odor Now add 2 ml of DI water. Observe the solubility. Check the pll of the solution. Write an equation that shows the amine has been ionized as a weak base in water. Name the...
hi team! could i have some help filling in the blanks? Also, could you please double-check...
hi team! could i have some help filling in the blanks? Also,
could you please double-check my answers at the bottom of the
page?
info:
mass of filter paper + weigh boat = 3.051 g
mass of filter paper + weigh boat + dry aspirin = 4.971
g
mass of aspirin = 1.92 g
Data and Results: Preparation of Aspirin Section Mass of salicylic acid used Volume of acetic anhydride used Mass of acetic anhydride used (density = 1.08 g/mL.)...
What are two interesting properties of amines? How do these properties explain the solubility of amines in water? 7. Name each of the amine structures below AND indicate whether each is a primary, secondary or tertiary amine. 8. NH2 NH2 H2N B. NH
those I choose is wrong please help
Amides are formed from the reaction of carboxylic acids with 1° amines carboxylic acids with 2 amines carboxylic acids with 3 amines Only A and B All of the above What are the hydrolysis products of N-methylpropanamide? propanoic acid and methylamine propanoic acid, methylamine, and water propanoic acid and ammonia
can you help with the stared questions
Properties of Amines: Solubility, Basicity and Amine Salts To My wedydd iedereen C horoby aming the Now where they. Check the path W e Salability 5. Base Hydrolysis of Amides Marea of he Namas praded Neutraline solutio n ep I by adding & M HCL racion d o the solution drop-by Chemical Equat mofthene salt Lab 9-8 4. Properties of Amines: Solubility, Basicity and Amine Salts Place 3 drops of triethylamine in a...
Questions and Problems 553 ation for the reaction that would produse cach of the following amines b. N.Methylpropanamine c. N.N-Diethylpentanamine 15.37 Briefly explain why the lower molar massamines (lewer than five carbons) exhibit appreciable solubility in water 15.38 Why is the salt of an amine appreciably more soluble in water than the mine from which it was formed 15.39 Most drugs containing amine groups are not administered as the mine but rather the amount you suggeste son why? 15.40 Why...
Organic Chemistry Lab Structure & Solubility: Explain how
you could distinguish between the following pairs of compounds?
Which compounds would be water soluble?
STRUCTURE AND SOLUBILITY Name: Lab Section: I. Esplin how you could distinguish between the following pairs of compounds. Which compounds would be water soluble? 1. Butane and 2-chlorobutane 2. Butane and 1-butanol 3. 1-butanol and 2-butanol 4. 1-butanol and butanoic acid
Can someone help me with the questions that are stared?
4. Properties of Amines: Solubility, Basicity and Amine Salts Place 3 drops of triethylamine in a test tube. Cautiously note the odor of the amine by fanning the vapor with your hand toward your nose. Odor Now add 2 ml of DI water. Observe the solubility. Check the pll of the solution. Write an equation that shows the amine has been ionized as a weak base in water. Name the...
hi team! could i have some help filling in the blanks? Also,
could you please double-check my answers at the bottom of the
page?
info:
mass of filter paper + weigh boat = 3.051 g
mass of filter paper + weigh boat + dry aspirin = 4.971
g
mass of aspirin = 1.92 g
Data and Results: Preparation of Aspirin Section Mass of salicylic acid used Volume of acetic anhydride used Mass of acetic anhydride used (density = 1.08 g/mL.)...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 18 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago