can someone please break this down and explain this? thank you
this is the critical damping equation
Homework Answers
Add Answer to:
can someone please break this down and explain this? thank
you
this is the critical damping...
Can someone please break this right down for me? Thank you 0.6% w 0.5 22 AGA...
Can
someone please break this right down for me?
Thank you
0.6% w 0.5 22 AGA 0.62 30-42 © Iov -21A Solve using the superposition method to find v.
Im having trouble with this problem. Can someone break it down for me please? Model rockets...
Im
having trouble with this problem. Can someone break it down for me
please?
Model rockets have tiny engines that fire for around 2 seconds. Your rocket has a mass of 0.5 kg and you want to know its maximum speed. Using a radar gun you measure the velocity of the rocket to be 47 m/s the moment the engine runs out of fuel. Calculate the force this engine exerts on your rocket. Hint: There are two forces in play...
This C++ code, can someone create notes for this and break down what each line means...
This C++ code, can someone create notes for this and break down what each line means line by line? int readFloatMap(string fileName, double arr[][4], int rows) { ifstream f(fileName.c_str()); if(f.fail()) { return -1; } double a, b, c, d; int r = 0; while((r < rows) && (f >> a >> b >> c >> d)) { arr[r][0] = a; arr[r][1] = b; arr[r][2] = c; arr[r][3] = d; r++; } return r; // success }
Can someone please help me with these 3 problems and explain it clear. thank you :)...
Can someone please help me with these 3 problems and explain it
clear. thank you :)
Consiaer the reaCtIon 75. CO(g)2 H2 (g) = CH3OH(g) K, = 2.26 x 104 at 25 °C Calculate AG,,n for the reaction at 25 °C under each of the following conditions: a. standard conditions b. at equilibrium 1.0 atm; Pco с. Рсн, он = 0.010 atm PH2 Consider the reaction 76. 2(g)Cl2(g)= 2 ICI(g) Kp = 81.9 at 25 °C Calculate AG,,n for the...
Can someone please explain how to do #5?? Please and Thank you! Use the following information...
Can someone please explain how to do #5?? Please and Thank you!
Use the following information for questions 2 5: A 5.0kg mass and an 8.0kg mass collide. Prior to the collision the velocity of the 5.0kg mass was esi-4.0% E and that of the 8.0kg mass was Uni- 1.0 + 3.0쯤j. After the collision the velocity of the 5.0kg mass is v5f- 3.0 2. What is the total momentum immediately after the collision? (a) 8.0%8mî+ 9.0 kg,mj (b) 8.0*9mi+24.0*9mj...
Im having trouble with this question. Can someone break this down to me? You roll out...
Im having trouble with this question. Can someone break this
down to me?
You roll out of bed in the morning. Typically beds are 0.5 m off the ground. What is the magnitude of the average force you will experience once you hit the floor if the collision tales 0.1 seconds. You may assume a mass for the average person is 65kg. A. 6370 N B. 2035 N C. 1018 N D. 3185 N
chemical reaction breakdown or buildup? help please!!! thank you CHEMICAL REACTION break down? or build up?...
chemical reaction breakdown or buildup? help please!!! thank
you
CHEMICAL REACTION break down? or build up? catabolic or anabolic? energy released? or energy required? AG>O? or AG<0? spontaneous? or not spontaneous? reaction? - H H-C-OH нсон reaction?
Please use the equation sheet. Write neat please. Draw a picture please (draw forces (FBD))Please show how you got the e...
Please use the equation sheet. Write neat please. Draw
a picture please (draw forces (FBD))Please show how you got the
equation. Show step by step please. Box in answers please. Note:
thermal expansion in (°C) gasses in (K) pressure in (pa) and volume
in (m³)
Q.4 A horizontal block-spring system with the block on a frictionless surface has total 30 mechanical energy equal to 47.0 J and a maximum displacement of 0.240 m from equilibrium position (a) What is the...
Could you please break down the problems. Thank you! 1. Identify the compound with the least...
Could you please break down the problems. Thank you!
1. Identify the compound with the least polar bond. A) HF B) LiF C) IBr D) HCI 2. Choose the best Lewis structure for OC12. A):CI=Ö=o1: B):C1-0-: c):ÇI==C1: D):C1-ö=ci: 3. Draw the best Lewis structure for Cl3". What is the formal charge on the central Cl atom? A)-1 B)-2 C) +1 D) +2 4. Use the molecular orbital diagram on the equation page to determine which of the following has the...
Can someone please help explain this problem Find the critical numbers of f(x) . x.a- 0.3....
Can someone please help explain this problem
Find the critical numbers of f(x) . x.a- 0.3. 12 12 12 0.4,7 0,3, 12 0,3, 12 10. pts A) B The graph of a function y-f) is shown. At which V point(s) are the following true? (a) and are both positive. dx dx dy 0) dand dr are both negative (C) dx is negative but d? is positive. f(A dy g (x) HINT of the curve at that point
Can
someone please break this right down for me?
Thank you
0.6% w 0.5 22 AGA 0.62 30-42 © Iov -21A Solve using the superposition method to find v.
Im
having trouble with this problem. Can someone break it down for me
please?
Model rockets have tiny engines that fire for around 2 seconds. Your rocket has a mass of 0.5 kg and you want to know its maximum speed. Using a radar gun you measure the velocity of the rocket to be 47 m/s the moment the engine runs out of fuel. Calculate the force this engine exerts on your rocket. Hint: There are two forces in play...
Can someone please help me with these 3 problems and explain it
clear. thank you :)
Consiaer the reaCtIon 75. CO(g)2 H2 (g) = CH3OH(g) K, = 2.26 x 104 at 25 °C Calculate AG,,n for the reaction at 25 °C under each of the following conditions: a. standard conditions b. at equilibrium 1.0 atm; Pco с. Рсн, он = 0.010 atm PH2 Consider the reaction 76. 2(g)Cl2(g)= 2 ICI(g) Kp = 81.9 at 25 °C Calculate AG,,n for the...
Can someone please explain how to do #5?? Please and Thank you!
Use the following information for questions 2 5: A 5.0kg mass and an 8.0kg mass collide. Prior to the collision the velocity of the 5.0kg mass was esi-4.0% E and that of the 8.0kg mass was Uni- 1.0 + 3.0쯤j. After the collision the velocity of the 5.0kg mass is v5f- 3.0 2. What is the total momentum immediately after the collision? (a) 8.0%8mî+ 9.0 kg,mj (b) 8.0*9mi+24.0*9mj...
Im having trouble with this question. Can someone break this
down to me?
You roll out of bed in the morning. Typically beds are 0.5 m off the ground. What is the magnitude of the average force you will experience once you hit the floor if the collision tales 0.1 seconds. You may assume a mass for the average person is 65kg. A. 6370 N B. 2035 N C. 1018 N D. 3185 N
chemical reaction breakdown or buildup? help please!!! thank
you
CHEMICAL REACTION break down? or build up? catabolic or anabolic? energy released? or energy required? AG>O? or AG<0? spontaneous? or not spontaneous? reaction? - H H-C-OH нсон reaction?
Please use the equation sheet. Write neat please. Draw
a picture please (draw forces (FBD))Please show how you got the
equation. Show step by step please. Box in answers please. Note:
thermal expansion in (°C) gasses in (K) pressure in (pa) and volume
in (m³)
Q.4 A horizontal block-spring system with the block on a frictionless surface has total 30 mechanical energy equal to 47.0 J and a maximum displacement of 0.240 m from equilibrium position (a) What is the...
Could you please break down the problems. Thank you!
1. Identify the compound with the least polar bond. A) HF B) LiF C) IBr D) HCI 2. Choose the best Lewis structure for OC12. A):CI=Ö=o1: B):C1-0-: c):ÇI==C1: D):C1-ö=ci: 3. Draw the best Lewis structure for Cl3". What is the formal charge on the central Cl atom? A)-1 B)-2 C) +1 D) +2 4. Use the molecular orbital diagram on the equation page to determine which of the following has the...
Can someone please help explain this problem
Find the critical numbers of f(x) . x.a- 0.3. 12 12 12 0.4,7 0,3, 12 0,3, 12 10. pts A) B The graph of a function y-f) is shown. At which V point(s) are the following true? (a) and are both positive. dx dx dy 0) dand dr are both negative (C) dx is negative but d? is positive. f(A dy g (x) HINT of the curve at that point
Most questions answered within 3 hours.
-
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 7 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 8 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 22 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago