Homework Answers
Answer:
NaCl is an ionic solid, so it dissolves and dissociate in water to its constituent ions, i.e. sodium ion and chloride ion.
O2 gas is dissolved in water in small amount. This is the reason that marine animal can live in water because they can take the dissolved oxygen.
CaCO3 doesn't dissolves in pure water. So no reaction will happen.
HF is a weak acid and it dissolves in water to generate proton and fluoride anion.
Add Answer to:
Complete the following chemical equations: (see Section 4.3 for examples) ote: Consider the solutes and predict...
1) Fill in the blanks to complete the chemical equations. Identify which compound is the acid...
1) Fill in the blanks to complete the chemical equations. Identify which compound is the acid and which is the base. Indicate if it is strong or weak. HC2H3O2 + NaOH ? ______ + ______ HCl + NaOH ? ______ + ______ 2) Given the following data, i. NO2(g) ? N2(g) + O2(g)ii. NO2(g) ? NO(g) + O2(g) ?H1 = ?33.9kJ ?H2 = 56.5 kJ What is ?H for the reaction N2 (??) + O2 (??) ? NO(??) ? (Hint:...
23. Balance each chemical equation. TEVSMIVC On MISSED THIS? Read Section 4.2; Watch KCV 4.2, IWE 4.2, 4.3 a. CO2(...
23. Balance each chemical equation. TEVSMIVC On MISSED THIS? Read Section 4.2; Watch KCV 4.2, IWE 4.2, 4.3 a. CO2(8) +CaSiO3(s) + H2O(1) SiO2(s) +Ca(HCO3)2(ag) b. Co(NO3)3(aq) + (NH4)2S(aq) c. Cu2O(s) +C(s) d. H2(g) + Cl2(g) HCl(g) > Co2S3(s) + NHNO3(ag) _ Cu(s) +CO(g) onah chomical eauation 25. Consider the unbalanced equation for the combustion of hexane: C&H14(8) + O2(8) CO2(g) + H2O(g) Balance the equation and determine how many moles of O, are required to react completely with 7.2...
Balancing Equations Balance the following chemical equations. Sicla(l)+ SiO (s)HCl(aq) 2. As 3 NaOH NaOH H2...
Balancing Equations Balance the following chemical equations. Sicla(l)+ SiO (s)HCl(aq) 2. As 3 NaOH NaOH H2 3. Ha Au + н,s но-> voC+ H20 5. -Hg(OH)2 + H3PO4 H20 SiO2 + HF→ SiF4 + -ho 7. 2 Zn Ha → ZnClz + H2 8. HCIO4 02(g)HO HNOs(aq) NH4NO3 ut Chemistry http://chemistry.about.com Balancing Equations Balance the following chemical equations но 2. cr→ Naa 3.4 A1 +302 -Al2O3 NH3 5. CO(g) + HO 6. FeO3(s) +-- CO(g) → Fel)+ CO2(9) 7. HSO_...
****** Balance all of the following equations******* Part A Na2CO3(aq)+HCl(aq)→NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq)+HCl(aq)→NaCl(aq)+H2O(l)+CO2(g) Express your answer as a chemical...
****** Balance all of the following equations******* Part A Na2CO3(aq)+HCl(aq)→NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq)+HCl(aq)→NaCl(aq)+H2O(l)+CO2(g) Express your answer as a chemical equation. Identify all of the phases in your answer. Part B Submit Request Answer HgO(s)→Hg(l)+O2(g)HgO(s)→Hg(l)+O2(g) Express your answer as a chemical equation. Identify all of the phases in your answer. Part C Submit Request Answer Fe(s)+O2(g)→Fe2O3(s)Fe(s)+O2(g)→Fe2O3(s) Express your answer as a chemical equation. Identify all of the phases in your answer. Part D Submit Request Answer Na(s)+Cl2(g)→NaCl(s)Na(s)+Cl2(g)→NaCl(s) Express your answer as a chemical equation....
All of the following chemical equations correspond to a standard enthalpy of formationEXCEPT a) CaO(s) +...
All of the following chemical equations correspond to a standard enthalpy of formationEXCEPT a) CaO(s) + C(s) + O2(g)→CaCO3(s) b) H2(g) +½O2(g)→H2O(g) c) H2(g) +½O2(g)→H2O(l) d) N2(g) + 2 O2(g)→N2O4(g)e) C(s) + O2(g)→CO2(g) Answer: a Can someone explain why its answer A?
Which of the following is a typical chemical equation that represents a hydration reaction? 2 KClO3...
Which of the following is a typical chemical equation that represents a hydration reaction? 2 KClO3 (s) → 2 KCl (s) + 3 O2 (g) K2CO3 (s) ⟶H2O 2K+(aq) + CO3 2-(aq) HCl (aq) + NaOH (aq) → NaCl (aq) + H2O (l) C6H12O6 (s) + 6 O2 (g) → 6 CO2 (g) + 6 H2O (l)
1. Provide balanced chemical equations for each of the chemical reactions that you performed. [Reaction (2b)...
1. Provide balanced chemical equations for each of the chemical reactions that you performed. [Reaction (2b) is omitted here.] (1a) _______ Pb(NO3)2 (aq) + ________ K2CrO4 (aq) → ________ KNO3 (aq) + ________ PbCrO4 (s) (1b) _______ Pb(NO3)2 (aq) + ________ Na2SO4 (aq) → ________ NaNO3 (aq) + ________ PbSO4 (s) (2a) _______ HCl (aq) + ________ Mg (s) → ________ MgCl2 (aq) + ________ H2 (g) (2c) _____ HC2H3O2 (aq) + ______NaHCO3 (s) → ______ NaC2H3O2 (aq) + _____...
Balance the following chemical equations. Write the word "Balanced" if the equation is already balanced. a)...
Balance the following chemical equations. Write the word "Balanced" if the equation is already balanced. a) 2 H2(g) + O2(g) → 2 H20(1) b) 2NH3(g) + H2SO4(90) → (NH4)2SO4(94) Decomposition Reactions a) 2H2O2(0) → 2 H2O(l) + O2(g) b) "Balanced" CaCO3(s) → "Balanced" CaQ/s) + "Balanced" CO2(g) Single Displacement Reactions a) Mg(s) + 2HCl(aq) → MgCl2(aq) + H2(g) b) 2Nas) + 2H2O(1) ► 2NaOH(aq) + H2(g double Displacement Reactions a) AgNO3(aq) + NaCl(aq) → AgCl(s) + NaNO3(aq) “Balanced" b) H2SO4(aq)...
15. Determine the net ionic equation for the following chemical reaction: NaOH(aq) + HCl(aq) ----------> NaCl(aq)...
15. Determine the net ionic equation for the following chemical reaction: NaOH(aq) + HCl(aq) ----------> NaCl(aq) + H20 hint: NaOH(aq) is strong base HCl(aq) is a strong acid OH-(aq) + H+ (aq) ----> H2O(1) 20H-(aq) + 2C1-(aq) -----> H2O(l) + C12(8) NaOH(aq) + CIO-(aq) -----> C12(g) + O2(g) + H2(g) + Na(s) H+(aq) + NaOH(aq)- H2O(1)+ Na(s) 13. A compound contains 20.24% Al and 79.76% Cl. Calculate the empirical formula. molar masses: Al = 26.98 g/mole and Cl = 35.45...
6 Which of the following chemical equations is an example of an acid-base reaction? ed Select...
6 Which of the following chemical equations is an example of an acid-base reaction? ed Select one: a. 2 HCl (aq) +Po(NO)2 (aq) PbC2 (s)+2 HNOs (aq) b. HF (aq) NH3 (ag) NH&F (aq) c. 2 HCl (aq) + Zn (s) → H2 (g) + ZnCl2 (aq) d. Ba(OH)2 (aa) + K2S04 (aq) → Baso, (s) + 2 KOH (aq) e. 3 NaOH (aq) + AIClg (aa)-Al(OH)3 (s) + 3 NaCl (aq) out of ag ion
23. Balance each chemical equation. TEVSMIVC On MISSED THIS? Read Section 4.2; Watch KCV 4.2, IWE 4.2, 4.3 a. CO2(8) +CaSiO3(s) + H2O(1) SiO2(s) +Ca(HCO3)2(ag) b. Co(NO3)3(aq) + (NH4)2S(aq) c. Cu2O(s) +C(s) d. H2(g) + Cl2(g) HCl(g) > Co2S3(s) + NHNO3(ag) _ Cu(s) +CO(g) onah chomical eauation 25. Consider the unbalanced equation for the combustion of hexane: C&H14(8) + O2(8) CO2(g) + H2O(g) Balance the equation and determine how many moles of O, are required to react completely with 7.2...
Balancing Equations Balance the following chemical equations. Sicla(l)+ SiO (s)HCl(aq) 2. As 3 NaOH NaOH H2 3. Ha Au + н,s но-> voC+ H20 5. -Hg(OH)2 + H3PO4 H20 SiO2 + HF→ SiF4 + -ho 7. 2 Zn Ha → ZnClz + H2 8. HCIO4 02(g)HO HNOs(aq) NH4NO3 ut Chemistry http://chemistry.about.com Balancing Equations Balance the following chemical equations но 2. cr→ Naa 3.4 A1 +302 -Al2O3 NH3 5. CO(g) + HO 6. FeO3(s) +-- CO(g) → Fel)+ CO2(9) 7. HSO_...
Balance the following chemical equations. Write the word "Balanced" if the equation is already balanced. a) 2 H2(g) + O2(g) → 2 H20(1) b) 2NH3(g) + H2SO4(90) → (NH4)2SO4(94) Decomposition Reactions a) 2H2O2(0) → 2 H2O(l) + O2(g) b) "Balanced" CaCO3(s) → "Balanced" CaQ/s) + "Balanced" CO2(g) Single Displacement Reactions a) Mg(s) + 2HCl(aq) → MgCl2(aq) + H2(g) b) 2Nas) + 2H2O(1) ► 2NaOH(aq) + H2(g double Displacement Reactions a) AgNO3(aq) + NaCl(aq) → AgCl(s) + NaNO3(aq) “Balanced" b) H2SO4(aq)...
15. Determine the net ionic equation for the following chemical reaction: NaOH(aq) + HCl(aq) ----------> NaCl(aq) + H20 hint: NaOH(aq) is strong base HCl(aq) is a strong acid OH-(aq) + H+ (aq) ----> H2O(1) 20H-(aq) + 2C1-(aq) -----> H2O(l) + C12(8) NaOH(aq) + CIO-(aq) -----> C12(g) + O2(g) + H2(g) + Na(s) H+(aq) + NaOH(aq)- H2O(1)+ Na(s) 13. A compound contains 20.24% Al and 79.76% Cl. Calculate the empirical formula. molar masses: Al = 26.98 g/mole and Cl = 35.45...
6 Which of the following chemical equations is an example of an acid-base reaction? ed Select one: a. 2 HCl (aq) +Po(NO)2 (aq) PbC2 (s)+2 HNOs (aq) b. HF (aq) NH3 (ag) NH&F (aq) c. 2 HCl (aq) + Zn (s) → H2 (g) + ZnCl2 (aq) d. Ba(OH)2 (aa) + K2S04 (aq) → Baso, (s) + 2 KOH (aq) e. 3 NaOH (aq) + AIClg (aa)-Al(OH)3 (s) + 3 NaCl (aq) out of ag ion
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 44 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago