Please help. How do I do a mechanism for each of these
reactions? Thank you!
Homework Answers
Add Answer to:
Please help. How do I do a mechanism for each of these
reactions? Thank you!
Overall...
can someone please answer this? thank you! For each reaction shown below, identify the primary product....
can
someone please answer this? thank you!
For each reaction shown below, identify the primary product. B regiochemistry and stereochemistry if applicable. Br2, H2O KMnO4, NaOH cold 1. Hg(OAc)2, H2O 2. NABH4 1. O3 2. Zn/ACOH 1. BH3 2. H-О, NaOH Cl2 Write the mechanism of the first reaction, the bromohydrin r
Identify the products of the following reactions and propose a mechanism for its formation. Please explain each step i.e. protonation, deprotonation, loss of leaving group, or nucleophilic attack and...
Identify the products of the following reactions and propose a
mechanism for its formation. Please explain each step i.e.
protonation, deprotonation, loss of leaving group, or nucleophilic
attack and describe what kind of reactions they are. Include BOTH
major and minor products. Thank you in advance.
NaOEt EtOH Me H0 2 CI 6 12 CI acetone
NaOEt EtOH Me
H0 2 CI 6 12 CI acetone
Oxidation of an Aldehyde (Vanillin III) Please write the mechanism for the reactions. Thank you, I...
Oxidation of an Aldehyde (Vanillin III)
Please write the mechanism for the reactions. Thank you, I
will rate as soon as possible!
Oxidation of an Aldehyde (vanillin III) Write the mechanism for the reactions Ag2 0,55°c No он , ho HO OM CO2H HEL, H₂O ome OMe
I need help with detailed steps of the reactions , thank you ! 3. Complete the...
I need help with detailed steps of the reactions ,
thank you !
3. Complete the following reactions of the compound shown by drawing the correct products with CORRECT stereochemistry if important (10 pts). 05-0 YBY TH Brz in H2O 1.0 2. Mes CHO H/Pd 1. Hg(OAc), in THF/water 2. NaBH, NaOH 1. BH -THE 2. H2O2, NaOH peroxyacid HBO HBr/peroxide 1. OsO4 2. NaHSO3
help please and thank you! 3. Draw a reasonable mechanism for each of the following reactions...
help please and thank you!
3. Draw a reasonable mechanism for each of the following reactions below. он HBr H,SO, он heat HBr ОН
13) A16.16 Give mechanisms for the following reactions and thereby identify the main product in each...
13) A16.16 Give mechanisms for the following reactions and thereby identify the main product in each case. Buting tone 14) A16.17 Show how the following transformation proceeds. Meo нсомео OH OH ACOH, HCI, H,0 ACOM, HCI MO 80-90*C, 1h Me Ref. Org. Synth., Coll. Vol. 6,471 (1988). M (15) A16.18 Sulfonation of toluene with concentrated sulfuric acid at 25 C gives mainly o- and p-tol uenesulfonic acid, but the reaction at 150 °C gives mainly the meta product. Explain these...
please answer only questions 2 and 4. thank you. Questions 1. Suggest a mechanism for the...
please answer only questions 2 and 4. thank you.
Questions 1. Suggest a mechanism for the basic hydrolysis of methyl benzoate. 2. What is the general formula for a soap? Write an equation for the reac- tion of ethyl stearate and sodium hydroxide. Explain briefly how a soap works. 3. Is sodium hydroxide a catalyst or a reactant? Explain. 4. Why is basic hydrolysis irreversible? 5. Provide the hydrolysis products in the reactions below: a. O II C- OCH +...
Hi, could you please help me identify these organic chemistry reactions throughout? Thanks! c. H2, PIO2 MaOH OTBS a. Buli, THF b. DMP d. AcOH, H20 CH2Ch Me 50 C 20 + O Me Me MeO оме g. TPAP, NMO h. Na...
Hi, could you please help me identify these organic chemistry
reactions throughout? Thanks!
c. H2, PIO2 MaOH OTBS a. Buli, THF b. DMP d. AcOH, H20 CH2Ch Me 50 C 20 + O Me Me MeO оме g. TPAP, NMO h. NaCIO2 e TBAF, TH OTBS 0 Me Me Nal2PO Me2C-CH(Me) Mel Me Hz0z. K2003 OTBS HIH Me Me O BocN BocN 24 25 . TMSCHN2 i TMSCI, LHMOS THF LACOH, Hz。 Me Me Me Me CH3CN 100 °C Me...
please answer these questions, thank you (8pts) Predict the product(s) of the following reactions? a. 2....
please answer these questions, thank you
(8pts) Predict the product(s) of the following reactions? a. 2. 1.NaNH2 2. Br 3.H2/ Lindlar's catalyst b. 1. NaH 2. CH3l 3.NH2NH2, KOH, C. CH,OH d. H,0 Give the product and the detailed arrow-pushing mechanism for the following reaction. NaOH, H20
Could someone please explain how to do this. Thank you. If you could explain in detail...
Could someone please explain how to do this. Thank you.
If you could explain in detail so I could understand I would
appreciate it very much!
Provide curved arrows to indicate the mechanism involved in each step of the following Hantzsch pyridine synthesis. 0 OH OH OH 0 он о O HO NH3 OH O H2N он он OH H
can
someone please answer this? thank you!
For each reaction shown below, identify the primary product. B regiochemistry and stereochemistry if applicable. Br2, H2O KMnO4, NaOH cold 1. Hg(OAc)2, H2O 2. NABH4 1. O3 2. Zn/ACOH 1. BH3 2. H-О, NaOH Cl2 Write the mechanism of the first reaction, the bromohydrin r
Identify the products of the following reactions and propose a
mechanism for its formation. Please explain each step i.e.
protonation, deprotonation, loss of leaving group, or nucleophilic
attack and describe what kind of reactions they are. Include BOTH
major and minor products. Thank you in advance.
NaOEt EtOH Me H0 2 CI 6 12 CI acetone
NaOEt EtOH Me
H0 2 CI 6 12 CI acetone
Oxidation of an Aldehyde (Vanillin III)
Please write the mechanism for the reactions. Thank you, I
will rate as soon as possible!
Oxidation of an Aldehyde (vanillin III) Write the mechanism for the reactions Ag2 0,55°c No он , ho HO OM CO2H HEL, H₂O ome OMe
I need help with detailed steps of the reactions ,
thank you !
3. Complete the following reactions of the compound shown by drawing the correct products with CORRECT stereochemistry if important (10 pts). 05-0 YBY TH Brz in H2O 1.0 2. Mes CHO H/Pd 1. Hg(OAc), in THF/water 2. NaBH, NaOH 1. BH -THE 2. H2O2, NaOH peroxyacid HBO HBr/peroxide 1. OsO4 2. NaHSO3
help please and thank you!
3. Draw a reasonable mechanism for each of the following reactions below. он HBr H,SO, он heat HBr ОН
13) A16.16 Give mechanisms for the following reactions and thereby identify the main product in each case. Buting tone 14) A16.17 Show how the following transformation proceeds. Meo нсомео OH OH ACOH, HCI, H,0 ACOM, HCI MO 80-90*C, 1h Me Ref. Org. Synth., Coll. Vol. 6,471 (1988). M (15) A16.18 Sulfonation of toluene with concentrated sulfuric acid at 25 C gives mainly o- and p-tol uenesulfonic acid, but the reaction at 150 °C gives mainly the meta product. Explain these...
please answer only questions 2 and 4. thank you.
Questions 1. Suggest a mechanism for the basic hydrolysis of methyl benzoate. 2. What is the general formula for a soap? Write an equation for the reac- tion of ethyl stearate and sodium hydroxide. Explain briefly how a soap works. 3. Is sodium hydroxide a catalyst or a reactant? Explain. 4. Why is basic hydrolysis irreversible? 5. Provide the hydrolysis products in the reactions below: a. O II C- OCH +...
Hi, could you please help me identify these organic chemistry
reactions throughout? Thanks!
c. H2, PIO2 MaOH OTBS a. Buli, THF b. DMP d. AcOH, H20 CH2Ch Me 50 C 20 + O Me Me MeO оме g. TPAP, NMO h. NaCIO2 e TBAF, TH OTBS 0 Me Me Nal2PO Me2C-CH(Me) Mel Me Hz0z. K2003 OTBS HIH Me Me O BocN BocN 24 25 . TMSCHN2 i TMSCI, LHMOS THF LACOH, Hz。 Me Me Me Me CH3CN 100 °C Me...
please answer these questions, thank you
(8pts) Predict the product(s) of the following reactions? a. 2. 1.NaNH2 2. Br 3.H2/ Lindlar's catalyst b. 1. NaH 2. CH3l 3.NH2NH2, KOH, C. CH,OH d. H,0 Give the product and the detailed arrow-pushing mechanism for the following reaction. NaOH, H20
Could someone please explain how to do this. Thank you.
If you could explain in detail so I could understand I would
appreciate it very much!
Provide curved arrows to indicate the mechanism involved in each step of the following Hantzsch pyridine synthesis. 0 OH OH OH 0 он о O HO NH3 OH O H2N он он OH H
Most questions answered within 3 hours.
-
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 1 minute ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 2 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 16 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago