Ammonia is manufactured in an exothermic reaction between nitrogen and hydrogen in the presence of an...
Ammonia is manufactured in an exothermic reaction between nitrogen and hydrogen in the presence of an iron catalyst: The nitrogen and hydrogen mixture is passed into a reaction chamber at a pressure of 200 atmospheres and a temperature of 4500C. The reaction is reversible.
(a) Why is a catalyst needed? The mixture of gases leaving the reaction chamber still contains some unreacted nitrogen and hydrogen- and Explain how the ammonia can be separated from this unreacted nitrogen and hydrogen.
(c) What is done with the unreacted nitrogen and hydrogen once the ammonia has been removed?
Ammonia can be reacted with nitric acid to make the fertiliser ammonium nitrate NH4NO3.
(d) Write a balanced chemical equation for the reaction between ammonia and nitric acid.
(e) Describe a chemical test you could do to show that ammonium nitrate contains ammonium ions.
Homework Answers
Add Answer to:
Ammonia is manufactured in an exothermic reaction
between nitrogen and hydrogen in the presence of an...
Nitric acid is often manufactured from the atmospheric gases nitrogen and oxygen, plus hydrogen prepared by...
Nitric acid is often manufactured from the atmospheric gases nitrogen and oxygen, plus hydrogen prepared by reforming of natural gas, in a two-step process. In the first step, nitrogen and hydrogen react to form ammonia:N2(g)+3H2(g)→2NH3(g)In the second step, ammonia and oxygen react to form nitric acid and water:NH3(g)+2O2(g)→HNO3(g)+H2O(g)Write the net chemical equation for the production of nitric acid from nitrogen, hydrogen and oxygen. Be sure your equation is balanced.
Question 5 of 10 > The reaction between nitrogen and hydrogen to produce ammonia is described...
Question 5 of 10 > The reaction between nitrogen and hydrogen to produce ammonia is described by the equilibrium reaction 3H, +N, = 2NH What substances are present in the reaction mixture when equilibrium has been obtained? H NH NH ON
pts) The synthesis of ammonia from nitrogen and hydrogen is exothermic N2(g) + 3H2(g) → 2NH3(g)...
pts) The synthesis of ammonia from nitrogen and hydrogen is exothermic N2(g) + 3H2(g) → 2NH3(g) + Heat )If heat is removed, will the forward rate of the reaction increase or decrease? Why? ) If nitrogen gas is added, will the forward rate of the reaction increase or decrease? Why? If the volume of the reaction container is increased, how will this affect the rate of the forward reaction? Why? )
2. a. Nitrogen dioxide and hydrogen are reacted in the gas phase, in the presence of...
2. a. Nitrogen dioxide and hydrogen are reacted in the gas phase, in the presence of a catalyst, to produce ammonia and water; write a balanced equation for this reaction. (2 pts) b. If 73.2 g of nitrogen dioxide and 10.6 g of hydrogen are mixed together and react to form ammonia, identify the limiting reactant and calculate the theoretical yield (in grams) of ammonia produced. (6 pts) c. 12.9 g of ammonia is actually produced in this reaction; based...
Nitric acid is often manufactured from the atmospheric gases nitrogen and oxygen, and hydrogen prepared by...
Nitric acid is often manufactured from the atmospheric gases nitrogen and oxygen, and hydrogen prepared by reforming natural gas, in a two-step process. In the first step, nitrogen and hydrogen react to form ammonia: N2+3H2=2NH3 In the second step, ammonia and oxygen react to form nitric acid HNO3 and water: NH3+ 2O2=HNO3+H2O Suppose the yield of the first step is 96.% and the yield of the second step is 85.%. Calculate the mass of hydrogen required to make 5.0kg of...
The reaction between nitrogen and hydrogen to produce ammonia is described by the equilibrium reaction 3H,...
The reaction between nitrogen and hydrogen to produce ammonia is described by the equilibrium reaction 3H, +N, 2NH What substances are present in the reaction mixture when equilibrium has been obtained? NH NH ON OH, y po m o contact us help a **
Nitric acid is often manufactured from the atmospheric gases nitrogen and oxygen, and hydrogen prepared by...
Nitric acid is often manufactured from the atmospheric gases nitrogen and oxygen, and hydrogen prepared by reforming natural gas, in a two-step process. In the first step, nitrogen and hydrogen react to form ammonia: 2 NH,(8) N2(8) + 3H2(8) In the second step, ammonia and oxygen react to form nitric acid (HNO) and water: NH5()+ 20,(8) HNO,(8) + H,O(8) Suppose the yleld of the first step is 62. % and the yield of the second step is 71.%. Calculate the...
Nitrogen and hydrogen combine at high temperature, in the presence of a catalyst, to produce ammonia....
Nitrogen and hydrogen combine at high temperature, in the presence of a catalyst, to produce ammonia. Ng) +3H Assume 4 molecules of nitrogen and 9 molecules of hydrogen are present. Number After complete reaction, how manyn molecules of ammonia are produced? Number How many molecules of H2 remain?D Number How many molecules of N remain?D O hydrogern O nitrogen What is the limiting reactant?
Nitrogen and hydrogen combine at high temperature, in the presence of a catalyst, to produce ammonia
Nitrogen and hydrogen combine at high temperature, in the presence of a catalyst, to produce ammonia. N2(g)+3H2(g)-->2NH3(g) Assume 4 molecules of nitrogen and 9 molecules of hydrogen are present. After complete reaction, how many molecules of ammonia are produced? How many molecules of H2 remain? How many molecules of N2 remain? What is the limiting reactant?
The production of ammonia from nitrogen and hydrogen: N2(g) 3 H2gNH3(g) is an exothermic reaction: when...
The production of ammonia from nitrogen and hydrogen: N2(g) 3 H2gNH3(g) is an exothermic reaction: when 10.0 g of ammonia are produced in a bomb calorimeter, the temperature rises 3.92°C Determine the internal energy change (kJ mol-1) of this reaction. Take Ceal 3.07 kJ/oC h.s TARIS WTH THD.OR
Question 5 of 10 > The reaction between nitrogen and hydrogen to produce ammonia is described by the equilibrium reaction 3H, +N, = 2NH What substances are present in the reaction mixture when equilibrium has been obtained? H NH NH ON
pts) The synthesis of ammonia from nitrogen and hydrogen is exothermic N2(g) + 3H2(g) → 2NH3(g) + Heat )If heat is removed, will the forward rate of the reaction increase or decrease? Why? ) If nitrogen gas is added, will the forward rate of the reaction increase or decrease? Why? If the volume of the reaction container is increased, how will this affect the rate of the forward reaction? Why? )
2. a. Nitrogen dioxide and hydrogen are reacted in the gas phase, in the presence of a catalyst, to produce ammonia and water; write a balanced equation for this reaction. (2 pts) b. If 73.2 g of nitrogen dioxide and 10.6 g of hydrogen are mixed together and react to form ammonia, identify the limiting reactant and calculate the theoretical yield (in grams) of ammonia produced. (6 pts) c. 12.9 g of ammonia is actually produced in this reaction; based...
The reaction between nitrogen and hydrogen to produce ammonia is described by the equilibrium reaction 3H, +N, 2NH What substances are present in the reaction mixture when equilibrium has been obtained? NH NH ON OH, y po m o contact us help a **
Nitric acid is often manufactured from the atmospheric gases nitrogen and oxygen, and hydrogen prepared by reforming natural gas, in a two-step process. In the first step, nitrogen and hydrogen react to form ammonia: 2 NH,(8) N2(8) + 3H2(8) In the second step, ammonia and oxygen react to form nitric acid (HNO) and water: NH5()+ 20,(8) HNO,(8) + H,O(8) Suppose the yleld of the first step is 62. % and the yield of the second step is 71.%. Calculate the...
Nitrogen and hydrogen combine at high temperature, in the presence of a catalyst, to produce ammonia. Ng) +3H Assume 4 molecules of nitrogen and 9 molecules of hydrogen are present. Number After complete reaction, how manyn molecules of ammonia are produced? Number How many molecules of H2 remain?D Number How many molecules of N remain?D O hydrogern O nitrogen What is the limiting reactant?
The production of ammonia from nitrogen and hydrogen: N2(g) 3 H2gNH3(g) is an exothermic reaction: when 10.0 g of ammonia are produced in a bomb calorimeter, the temperature rises 3.92°C Determine the internal energy change (kJ mol-1) of this reaction. Take Ceal 3.07 kJ/oC h.s TARIS WTH THD.OR
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 14 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago