Homework Answers
Add Answer to:
4. The reduction of O2 to H2O in aqueous acid is an important half-reaction in the...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential O2...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential O2 (g) + 4H+ (aq) +4e− → 2H2O (l) =E0red+1.23V Zn+2 (aq) +2e− → Zn (s) =E0red−0.763V Answer the following questions about this cell. Write a balanced equation for the half-reaction that happens at the cathode. Write a balanced equation for the half-reaction that happens at the anode. Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is...
Refer to this table of reduction potentials to answer the questions. Reduction half-reaction Potential (V) +2.87...
Refer to this table of reduction potentials to answer the questions. Reduction half-reaction Potential (V) +2.87 Electrolytic cells use electricity to cause a nonspontaneous redox reaction to occur. An electrolytic cell is constructed using the following components: • a power source, such as a battery, • the substance that will undergo electrolysis, and • two inert electrodes (usually platinum), which serve as the electrical connection between the power source and the substance undergoing electrolysis. As with any cell, oxidation occurs...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential MnO2...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential MnO2 (s) + 4H+ (aq) +2e−→ Mn+2 ( aq) +2H2O(l) =E0red+1.23V Cl2 (g) +2e−→ 2Cl− (aq) =E0red+1.359V Answer the following questions about this cell Write a balanced equation for the half-reaction that happens at the cathode. Write a balanced equation for the half-reaction that happens at the anode. Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential Eped...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential Eped +1.23 V MnO,(s)+44*(aq)+2e → Mn2+(aq)+2H20(1) Cu2+(aq)+e → Cut(aq) Eped +0.153 V Answer the following questions about this cell. xs ? Write a balanced equation for the half- reaction that happens at the cathode. Write a balanced equation for the half- reaction that happens at the anode. Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential Cl...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential Cl 2 (g) + 2 e − → 2 Cl − (aq) = E 0 red + 1.359 V MnO − 4 (aq) + 2 H 2 O (l) + 3 e − → MnO 2 (s) + 4 OH − (aq) = E 0 red + 0.59 V cathode half reaction anode half reaction overall reaction cell potential at standard state
A chemist designs a galvanic cell that uses these two half-reactions half-reaction standard reduction potential red...
A chemist designs a galvanic cell that uses these two half-reactions half-reaction standard reduction potential red = +0.96 V red0.763 v NO, (ag)+4H(a)+3eNoo)+2 H,Ow Zan2+ (aq)+2e- → Zn(s) Answer the following questions about this cell Write a balanced equation for the half-reaction that happens at the cathode Write a balanced equation for the half-reaction that happens at the anode Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as written. Do...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential =...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential = +0.771 V Fe'+ (aq)+e — Fe2+(aq) N2(9)+4 H20(1)+44 → N2H4(aq)+4 OH(aq) Eed=-1.16 V Answer the following questions about this cell. Write a balanced equation for the half-reaction that happens at the cathode. Write a balanced equation for the half-reaction that happens at the anode. Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as written....
A certain half-reaction has a standard reduction potential +0.14 V. An engineer proposes using this half-reactio...
A certain half-reaction has a standard reduction potential +0.14 V. An engineer proposes using this half-reaction at the anode of a galvanic cell that must provide at least 0.80 V of electrical power. The cell will operate under standard conditions Note for advanced students: assume the engineer requires this half-reaction to happen at the anode of the cell. Is there a minimum standard reduction potential that the hall reaction used at the cathode of this cell can have? ves, there...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential Ecd=-0.13...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential Ecd=-0.13 V Cro2 (aq)+4 H2O(1)+3e" → Cr(OH)3(s)+50H (aq) Cu2+ (aq)+e → Cut(aq) = +0.153 V Answer the following questions about this cell. 0-0 Write a balanced equation for the half-reaction that happens at the cathode. DI X Write a balanced equation for the half-reaction that happens at the anode. Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction...
A certain half-reaction has a standard reduction potential E Ted =-0.99 V. An engineer proposes using...
A certain half-reaction has a standard reduction potential E Ted =-0.99 V. An engineer proposes using this half-reaction at the anode of a galvanic cell that must provide at least 0.90 V of electrical power. The cell will operate under standard conditions. Note for advanced students: assume the engineer requires this half-reaction to happen at the anode of the cell O- Is there a minimum standard reduction potential that the half-reaction used at the cathode of this cell can have?...
Refer to this table of reduction potentials to answer the questions. Reduction half-reaction Potential (V) +2.87 Electrolytic cells use electricity to cause a nonspontaneous redox reaction to occur. An electrolytic cell is constructed using the following components: • a power source, such as a battery, • the substance that will undergo electrolysis, and • two inert electrodes (usually platinum), which serve as the electrical connection between the power source and the substance undergoing electrolysis. As with any cell, oxidation occurs...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential Eped +1.23 V MnO,(s)+44*(aq)+2e → Mn2+(aq)+2H20(1) Cu2+(aq)+e → Cut(aq) Eped +0.153 V Answer the following questions about this cell. xs ? Write a balanced equation for the half- reaction that happens at the cathode. Write a balanced equation for the half- reaction that happens at the anode. Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous...
A chemist designs a galvanic cell that uses these two half-reactions half-reaction standard reduction potential red = +0.96 V red0.763 v NO, (ag)+4H(a)+3eNoo)+2 H,Ow Zan2+ (aq)+2e- → Zn(s) Answer the following questions about this cell Write a balanced equation for the half-reaction that happens at the cathode Write a balanced equation for the half-reaction that happens at the anode Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as written. Do...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential = +0.771 V Fe'+ (aq)+e — Fe2+(aq) N2(9)+4 H20(1)+44 → N2H4(aq)+4 OH(aq) Eed=-1.16 V Answer the following questions about this cell. Write a balanced equation for the half-reaction that happens at the cathode. Write a balanced equation for the half-reaction that happens at the anode. Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as written....
A certain half-reaction has a standard reduction potential +0.14 V. An engineer proposes using this half-reaction at the anode of a galvanic cell that must provide at least 0.80 V of electrical power. The cell will operate under standard conditions Note for advanced students: assume the engineer requires this half-reaction to happen at the anode of the cell. Is there a minimum standard reduction potential that the hall reaction used at the cathode of this cell can have? ves, there...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential Ecd=-0.13 V Cro2 (aq)+4 H2O(1)+3e" → Cr(OH)3(s)+50H (aq) Cu2+ (aq)+e → Cut(aq) = +0.153 V Answer the following questions about this cell. 0-0 Write a balanced equation for the half-reaction that happens at the cathode. DI X Write a balanced equation for the half-reaction that happens at the anode. Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction...
A certain half-reaction has a standard reduction potential E Ted =-0.99 V. An engineer proposes using this half-reaction at the anode of a galvanic cell that must provide at least 0.90 V of electrical power. The cell will operate under standard conditions. Note for advanced students: assume the engineer requires this half-reaction to happen at the anode of the cell O- Is there a minimum standard reduction potential that the half-reaction used at the cathode of this cell can have?...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 15 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 46 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago