Classify each element as a metal, nonmetal, or semimetal. a) Kr b) Te c) Al d)...
Classify each element as a metal, nonmetal, or semimetal.
a) Kr
b) Te
c) Al
d) Ba
e) Fe
f) F
Homework Answers
any query please comment.
If satisfied please rate it thanks.
Add Answer to:
Classify each element as a metal, nonmetal, or semimetal.
a) Kr
b) Te
c) Al
d)...
3. Identify the metal or nonmetal oxides that react with water to make the following acids....
3. Identify the metal or nonmetal oxides that react with water to make the following acids. Write the balanced equation in each case. (a) K(OH) (b) Al(OH)3 (c) HNO3 (d) H2CO3 (e) Ba(OH)2
An element has the following electronic configuration: [Kr]4d15s2 (a) What period does it belong to? (b)...
An element has the following electronic configuration:
[Kr]4d15s2
(a) What period does it belong to?
(b) What is its group number? (Use group numbers from 1 to
18)
(c) What kind of element is it? (Main group metal, transition
metal, metalloid, nonmetal?)
(d) How many unpaired electrons are there in an atom of this
element?
(e) What element has this electronic configuration? (attached
figure)
Thank you!!! :)
4p AS 3d
Chapter 2 Homework 10. 142 points value: ll: metal12: metal: (3]: nonmetal c. Which element has...
Chapter 2 Homework 10. 142 points value: ll: metal12: metal: (3]: nonmetal c. Which element has the smallest atomic radius? (select) d. Which element has the largest atomic radius? (select) ". e. Which element has the largest ionization energy? select) f. Which element has the smallest ionization energy? (select) g. How many valence electrons does each element possess? References eBook & Resources Multipart Answer Difficulty Hare Chapter 2- Atoms and the Periodic Table Section 02 10
An atom of which element below has the most unpaired electrons? A) Ba B) Al C)...
An atom of which element below has the most unpaired electrons? A) Ba B) Al C) P D) F E) O
1. An element belongs to Group 9. What common name might be used to describe the...
1. An element belongs to Group 9. What common name might be used to describe the group to which the element belongs? a) alkaline earth b) semimetal c) nonmetal d) transition metal e) noble gas 2. Which of the following elements is most likely to react with oxygen? a) aluminium b) argon c) magnesium d) nitrogen e) silicon 3. Which element X is most likely to react to form the compound XF5? a) carbon b) antimony c) chlorine d) calcium...
3. Which element has the following ground-state electron configuration? [Kr] 5s24d105p3 A) Sb B) Sn C)...
3. Which element has the following ground-state electron configuration? [Kr] 5s24d105p3 A) Sb B) Sn C) Pb D) Bi E) Te 4. Which element has the following ground-state electron configuration? [Kr]5s24d105ps A)As B) C) Br D) Se 5. If one electron is added to the outer shell of silicon, it would have the same electron configuration as what element?
13) Which of the following is the correct classification for both calcium and iron? A) Ca...
13) Which of the following is the correct classification for both calcium and iron? A) Ca is a transition element and a metal and Fe is a transition element and a metal B) Ca is a transition element and a metal and Fe is a transition element and a nonmetal. C) Ca is an alkali metal element and a metal and Fe is a transition element and a nonmetal D) Ca is an alkaline earth element and a metal and...
3.35 Classify each of the following elements into the s, p, d, or f area of...
3.35 Classify each of the following elements into the s, p, d, or f area of the periodic table on the basis of the distinguishing electron: a. Kr b. tin c. Pu d. element 40
Answer these questions about the substance given by the formula CBr₄: a.) Classify the substance: is it an element, a co...
Answer these questions about the substance given by the formula CBr₄: a.) Classify the substance: is it an element, a compound, a homogenous mixture, or a heterogeneous mixture? b.) If the substance is an element, is it a metal, nonmetal, or a metalloid? c.) If the substance is a compound, is it an ionic compound or a molecular compound? d.) What is the name of the substance? e.) What is the mass of a mole of the substance? f.) In...
Part A Review Constants Periodic Table Learning Goal: Consider the following element combinations. Classify the bonds...
Part A Review Constants Periodic Table Learning Goal: Consider the following element combinations. Classify the bonds formed between each pair as ionic, polar covalent, or nonpolar covalent qualitatively based solely on each element's position on the periodic table. To use electronegativity or metal versus nonmetal classifications to distinguish covalent polar covalent, and ionic bonds. not conduct calculations. Drag the appropriate items to their respective bins. When two bonded atoms attract electrons with View Available Hint(s) equal strength, the result is...
3. Identify the metal or nonmetal oxides that react with water to make the following acids. Write the balanced equation in each case. (a) K(OH) (b) Al(OH)3 (c) HNO3 (d) H2CO3 (e) Ba(OH)2
An element has the following electronic configuration:
[Kr]4d15s2
(a) What period does it belong to?
(b) What is its group number? (Use group numbers from 1 to
18)
(c) What kind of element is it? (Main group metal, transition
metal, metalloid, nonmetal?)
(d) How many unpaired electrons are there in an atom of this
element?
(e) What element has this electronic configuration? (attached
figure)
Thank you!!! :)
4p AS 3d
Chapter 2 Homework 10. 142 points value: ll: metal12: metal: (3]: nonmetal c. Which element has the smallest atomic radius? (select) d. Which element has the largest atomic radius? (select) ". e. Which element has the largest ionization energy? select) f. Which element has the smallest ionization energy? (select) g. How many valence electrons does each element possess? References eBook & Resources Multipart Answer Difficulty Hare Chapter 2- Atoms and the Periodic Table Section 02 10
3. Which element has the following ground-state electron configuration? [Kr] 5s24d105p3 A) Sb B) Sn C) Pb D) Bi E) Te 4. Which element has the following ground-state electron configuration? [Kr]5s24d105ps A)As B) C) Br D) Se 5. If one electron is added to the outer shell of silicon, it would have the same electron configuration as what element?
13) Which of the following is the correct classification for both calcium and iron? A) Ca is a transition element and a metal and Fe is a transition element and a metal B) Ca is a transition element and a metal and Fe is a transition element and a nonmetal. C) Ca is an alkali metal element and a metal and Fe is a transition element and a nonmetal D) Ca is an alkaline earth element and a metal and...
3.35 Classify each of the following elements into the s, p, d, or f area of the periodic table on the basis of the distinguishing electron: a. Kr b. tin c. Pu d. element 40
Part A Review Constants Periodic Table Learning Goal: Consider the following element combinations. Classify the bonds formed between each pair as ionic, polar covalent, or nonpolar covalent qualitatively based solely on each element's position on the periodic table. To use electronegativity or metal versus nonmetal classifications to distinguish covalent polar covalent, and ionic bonds. not conduct calculations. Drag the appropriate items to their respective bins. When two bonded atoms attract electrons with View Available Hint(s) equal strength, the result is...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 40 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago