Homework Answers
z
Add Answer to:
AlF3 Name: aluminum fluoride (b) S and F O ionic O covalent Empirical formula: SFO ®...
Be sure to answer all parts. For each of the following pairs of elements, state whether...
Be sure to answer all parts. For each of the following pairs of elements, state whether the binary compound they form is likely to be ionic or covalent. Write the empirical formula and name of the compound. (a) Al and F o ionic o covalent Empirical formula: Name: (select) (b) S and F o ionic covalent Empirical formula: Name: (select)
Will the compound be ionic or covalent? What is the Empirical formula? What is the name?...
Will the compound be ionic or covalent? What is the Empirical formula? What is the name? A) Al and F B) S and F
Be sure to answer all parts. For each of the following pairs of elements, state whether...
Be sure to answer all parts. For each of the following pairs of elements, state whether the binary compound they form is likely to be ionic or covalent. Write the empirical formula and name of the compound: Formula Name Type (a) K and Br (select)potassium bromatepotassium bromidepotassium dibromidepotassium bromite ionic covalent (b) C and Br (select)carbon monobromidecarbon bromitecarbon bromatecarbon tetrabromide ionic covalent
For each of the following pairs of elements, state whether the binary compound they form is...
For each of the following pairs of elements, state whether the binary compound they form is likely to be ionic or covalent. Write the empirical formula and name of the compound: Formula Name Type N and F _________ ____________ ionic covalent Li and CI ______________ _____________ ionic covalent
please, type if they are ionic or covelent and check my formula and name. for the...
please, type if they are ionic or covelent and check my
formula and name.
for the number 1) please type and answer in short sentences.
thank you
D. Compounds and formulas Ionic or covalent? Name ionic nickel(II) oxide Formula calcium nitride conic Covalent Nio (az Na sulfur dichloride Sch aluminum nitrate AL (NO3), carbon tetrafluoride diarsenic pentoxide CF4 P4010 lithium nitride silicon dioxide chlorine pentafluoride 43W SiO2 CIFG Phcly lead(IV) chloride Ionic or covalent? Name Formula covalent NCI; Covedent SO2...
2. Predict the formula of the ionic compounds formed from the following pairs of elements using L...
2. Predict the formula of the ionic compounds formed from the following pairs of elements using Lewis symbols. Name the compounds. a. Al and I b. Rb andS 3. Rank the following in order of increasing bond length and bond strength. a. Si-F Si-C; Si-o 4. Calculate the amount of energy necessary to break all the bonds in formaldehyde CH20. What type of process is this? -O 5. Predict which pairs give ionic, polar covalent, or nonpolar covalent compounds by...
Answer all plz!!! 4. Name the following compounds by first deciding whether they are ionic or...
Answer
all plz!!!
4. Name the following compounds by first deciding whether they are ionic or covalent, then use the appropriate nomenclature. Where applicable, you may use common names SAN4 K2O2 Pb(OH)2: Na2S Fe2O3 PF 3 ZnCr2O7 Mg3P2 BeF2 CIF 3 Ca(CIO)2: CH4 Bi(OH)3 SnCl4 3 6. Write the formulas for the following compounds. If a compound is ionic, be sure to balance charge. In case of a binary aqueous acid, include the symbol "(aq)" in the formula. Lithium cyanide...
Select the strongest bond in the following group. C-S C-O C=C C=N C-F A nonpolar covalent...
Select the strongest bond in the following group. C-S C-O C=C C=N C-F A nonpolar covalent bond(i.e., pure covalent) would form in which of these pairs of atoms? Na-Cl H-Cl Li-Br Se-Br Br-Br Arrange aluminum, nitrogen, phosphorous, and indium in order of increasing electronegativity. Al< ln <N< P Al < ln < P <N ln < Al < P < N ln < p < Al < N None of these order is correct. Which of these Lewis structure is...
Ionic & Covalent Virtual Lab Pre-Virtual Lab Questions: Answer these before going to the website to...
Ionic & Covalent Virtual Lab Pre-Virtual Lab Questions: Answer these before going to the website to begin the virtual lab. 1. Where are metal atoms located on the periodic table? Where are non metal atoms located on the periodic table? 2. What subatomic particles) participate in chemical bonding? 3. In your own words, define valence electrons. 4. How can you determine the number of valence electrons in an atom using the periodic table? 5. Draw a Lewis Dot Structure for...
1) What is the term for a compound containing two nonmetals? A) binary acid B) ionic...
1) What is the term for a compound containing two nonmetals? A) binary acid B) ionic compound C) molecular compound D) ternary acid 2) The compound TiO2 is classified as which of the following? A) binary acid B) ionic compound C) molecular compound D) ternary acid 3) What is the name for S2-? A) sulfur ion B) sulfide ion C) sulfite ion D) sulfate ion 4) What is the chemical formula for the nitrite ion? A) NO3- B) NO32- C)...
Be sure to answer all parts. For each of the following pairs of elements, state whether the binary compound they form is likely to be ionic or covalent. Write the empirical formula and name of the compound. (a) Al and F o ionic o covalent Empirical formula: Name: (select) (b) S and F o ionic covalent Empirical formula: Name: (select)
For each of the following pairs of elements, state whether the binary compound they form is likely to be ionic or covalent. Write the empirical formula and name of the compound: Formula Name Type N and F _________ ____________ ionic covalent Li and CI ______________ _____________ ionic covalent
please, type if they are ionic or covelent and check my
formula and name.
for the number 1) please type and answer in short sentences.
thank you
D. Compounds and formulas Ionic or covalent? Name ionic nickel(II) oxide Formula calcium nitride conic Covalent Nio (az Na sulfur dichloride Sch aluminum nitrate AL (NO3), carbon tetrafluoride diarsenic pentoxide CF4 P4010 lithium nitride silicon dioxide chlorine pentafluoride 43W SiO2 CIFG Phcly lead(IV) chloride Ionic or covalent? Name Formula covalent NCI; Covedent SO2...
2. Predict the formula of the ionic compounds formed from the following pairs of elements using Lewis symbols. Name the compounds. a. Al and I b. Rb andS 3. Rank the following in order of increasing bond length and bond strength. a. Si-F Si-C; Si-o 4. Calculate the amount of energy necessary to break all the bonds in formaldehyde CH20. What type of process is this? -O 5. Predict which pairs give ionic, polar covalent, or nonpolar covalent compounds by...
Answer
all plz!!!
4. Name the following compounds by first deciding whether they are ionic or covalent, then use the appropriate nomenclature. Where applicable, you may use common names SAN4 K2O2 Pb(OH)2: Na2S Fe2O3 PF 3 ZnCr2O7 Mg3P2 BeF2 CIF 3 Ca(CIO)2: CH4 Bi(OH)3 SnCl4 3 6. Write the formulas for the following compounds. If a compound is ionic, be sure to balance charge. In case of a binary aqueous acid, include the symbol "(aq)" in the formula. Lithium cyanide...
Select the strongest bond in the following group. C-S C-O C=C C=N C-F A nonpolar covalent bond(i.e., pure covalent) would form in which of these pairs of atoms? Na-Cl H-Cl Li-Br Se-Br Br-Br Arrange aluminum, nitrogen, phosphorous, and indium in order of increasing electronegativity. Al< ln <N< P Al < ln < P <N ln < Al < P < N ln < p < Al < N None of these order is correct. Which of these Lewis structure is...
Ionic & Covalent Virtual Lab Pre-Virtual Lab Questions: Answer these before going to the website to begin the virtual lab. 1. Where are metal atoms located on the periodic table? Where are non metal atoms located on the periodic table? 2. What subatomic particles) participate in chemical bonding? 3. In your own words, define valence electrons. 4. How can you determine the number of valence electrons in an atom using the periodic table? 5. Draw a Lewis Dot Structure for...
1) What is the term for a compound containing two nonmetals? A) binary acid B) ionic compound C) molecular compound D) ternary acid 2) The compound TiO2 is classified as which of the following? A) binary acid B) ionic compound C) molecular compound D) ternary acid 3) What is the name for S2-? A) sulfur ion B) sulfide ion C) sulfite ion D) sulfate ion 4) What is the chemical formula for the nitrite ion? A) NO3- B) NO32- C)...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 38 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 6 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 6 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago