Homework Answers
Acetogens are microorganism which can work in aerobic conditios only. Thermodynamically it doesn't give insight into how much energy an organism actually captures or how much it can be useful. Thus thermodynamically using ethanol is favourable
Add Answer to:
2) Based on thermodynamics, is ethanol more likely to be used as an electron donor for...
Consider the metabolism of ethanol (CHaCH20H) by microorganisms. Ethanol is being oxidized to CO2...
Please Helpe me out with this!
1. first balance everything that is not 0 or H
2. balance O with H2o
3. balance H
4. balance charge with electrons
Do the proces for each one! separate! ethanol a,
ethanol b, ethanol c....
Consider the metabolism of ethanol (CHaCH20H) by microorganisms. Ethanol is being oxidized to CO2. The three available electron acceptors are: (a) Nitrate (NO3) reduced to N2 (b) Oxygen (02) reduced to H20 (c) Sulfur (S) reduced to H2S...
1. Why are two photosystems needed when H2O is used as an electron donor? 2. How...
1. Why are two photosystems needed when H2O is used as an electron donor? 2. How do antenna chlorophylls differ from reaction center chlorophylls? 3. What are the ways that organisms obtain energy and carbon from the environment? What are the names used to describe these organisms?
5. The alcohol CH CH SH has an unusually small pka of approximately 9.4 relative to ethanol, CH CH OH (pka - 16). a...
5. The alcohol CH CH SH has an unusually small pka of approximately 9.4 relative to ethanol, CH CH OH (pka - 16). a. Is CH,CH,SH more or less acidic than ethanol? (2 pts) b. Draw the conjugate base for each and explain the difference in acidity between CH, CH SH and CH CH2OH by analyzing the structures of the conjugate bases. (4 pts) c. Provide an arrow-pushing scheme for the reaction of one mole of CH,CH,SH with one mole...
52. Based on the information in Table 20.1 below, which of the following is more likely...
52. Based on the information in Table 20.1 below, which of the following is more likely to spontaneously occur? Page 10 A) Silver (Ag*')ion is reduced to silver metal. B) Zinc (Zn) ion is reduced to zinc metal. C) Zinc metal is oxidized to zine (Zn) ion. D) Copper (Cu) metal is oxidized to copper ion (Cu) TABLE 20.1 - Standard Reduction Potentials in Water at 25°C EV Reduction Half-Reaction FAG) +262 Flag +1.51 Mno," + H+ 3M + 4H00...
Redox: The best initial electron donor for an organism performing fermentation would be ___, while the best final electron acceptor would be ___ . Use the information from the redox couples below to a...
Redox: The best initial electron donor for an
organism performing fermentation would be ___, while the best final
electron acceptor would be ___ .
Use the information from the redox couples below to answer the fill in the blank questions, using the letter after each substance. (i.e. if you believe that the answer is CoQ fill in the appropriate blank with the letter A). Each letter (substance) may be used more than once. Hint: put the redox couples into an...
Redox : If members of the redox couples above were used to set up the most energetically favorable chemical reaction, the initial electron donor should be ___and the final electron acceptor should be...
Redox : If members of the redox couples above were used to set
up the most energetically favorable chemical
reaction, the initial electron donor should be
___and the final electron acceptor should be
___.
Use the information from the redox couples below to answer the fill in the blank questions, using the letter after each substance. (i.e. if you believe that the answer is CoQ fill in the appropriate blank with the letter A). Each letter (substance) may be used...
2. Based on the chemical formula of methanol (CH,OH), ethanol (C2H5OH), propanol (C3H7OH) and butanol (C4H9OH),...
2. Based on the chemical formula of methanol (CH,OH), ethanol (C2H5OH), propanol (C3H7OH) and butanol (C4H9OH), arrange these alcohols in order of increasing value ?? (lowest to highest), Explain your reasoning for your proposed order of increasing AH values for these four alcohols. 3.
2. (3 pts) Would proper termination of transcription in eukaryotes be more likely to be blocked...
2. (3 pts) Would proper termination of transcription in eukaryotes be more likely to be blocked by a mutation that inactivated CstF or polyA polymerase? Explain. Grading: 1 pt for indicating which mutation would be more likely to prevent proper termination. 0.5 pt for explaining the normal function of CstF; 0.5 pt for explaining the normal function of polyA polymerase; 1 pt for explaining why the mutation you chose would be more likely to prevent proper termination, with reference to...
1. Why is iPS cell therapy using third-party donor cells more feasible than using cells donated...
1. Why is iPS cell therapy using third-party donor cells more feasible than using cells donated from the patient being treated? O Treatment with iPS cells is much more cost prohibitive when iPS cells are donated by the patient being treated. O Donor iPS cells from the patient cannot be used because they contain the disease being treated. O Third-party donor cells are less likely to contain dangerous mutations that can lead to tumor formation. O Third-party donors are screened...
Date: Thermodynamics Data Part 1 Temperature of Ca(OH)2 solution: 20°C Molarity of the HCl solution used...
Date: Thermodynamics Data Part 1 Temperature of Ca(OH)2 solution: 20°C Molarity of the HCl solution used for the titration: 0.05 M H CH Titration 1 Titration 2 Titration 3 Initial buret reading Final buret reading 10 mL 19 mi 9mL 11 mL 20 ml | 28 mc 36.4 9 mL q.4mL Volume HCl used avg=8.8 mL Part II Temperature of Ca(OH)solution: 84 c Molarity of the HCl solution used for the titration: 0.05 M HCI Titration 1 Titration 2 Titration...
Please Helpe me out with this!
1. first balance everything that is not 0 or H
2. balance O with H2o
3. balance H
4. balance charge with electrons
Do the proces for each one! separate! ethanol a,
ethanol b, ethanol c....
Consider the metabolism of ethanol (CHaCH20H) by microorganisms. Ethanol is being oxidized to CO2. The three available electron acceptors are: (a) Nitrate (NO3) reduced to N2 (b) Oxygen (02) reduced to H20 (c) Sulfur (S) reduced to H2S...
5. The alcohol CH CH SH has an unusually small pka of approximately 9.4 relative to ethanol, CH CH OH (pka - 16). a. Is CH,CH,SH more or less acidic than ethanol? (2 pts) b. Draw the conjugate base for each and explain the difference in acidity between CH, CH SH and CH CH2OH by analyzing the structures of the conjugate bases. (4 pts) c. Provide an arrow-pushing scheme for the reaction of one mole of CH,CH,SH with one mole...
52. Based on the information in Table 20.1 below, which of the following is more likely to spontaneously occur? Page 10 A) Silver (Ag*')ion is reduced to silver metal. B) Zinc (Zn) ion is reduced to zinc metal. C) Zinc metal is oxidized to zine (Zn) ion. D) Copper (Cu) metal is oxidized to copper ion (Cu) TABLE 20.1 - Standard Reduction Potentials in Water at 25°C EV Reduction Half-Reaction FAG) +262 Flag +1.51 Mno," + H+ 3M + 4H00...
Redox: The best initial electron donor for an
organism performing fermentation would be ___, while the best final
electron acceptor would be ___ .
Use the information from the redox couples below to answer the fill in the blank questions, using the letter after each substance. (i.e. if you believe that the answer is CoQ fill in the appropriate blank with the letter A). Each letter (substance) may be used more than once. Hint: put the redox couples into an...
Redox : If members of the redox couples above were used to set
up the most energetically favorable chemical
reaction, the initial electron donor should be
___and the final electron acceptor should be
___.
Use the information from the redox couples below to answer the fill in the blank questions, using the letter after each substance. (i.e. if you believe that the answer is CoQ fill in the appropriate blank with the letter A). Each letter (substance) may be used...
2. Based on the chemical formula of methanol (CH,OH), ethanol (C2H5OH), propanol (C3H7OH) and butanol (C4H9OH), arrange these alcohols in order of increasing value ?? (lowest to highest), Explain your reasoning for your proposed order of increasing AH values for these four alcohols. 3.
2. (3 pts) Would proper termination of transcription in eukaryotes be more likely to be blocked by a mutation that inactivated CstF or polyA polymerase? Explain. Grading: 1 pt for indicating which mutation would be more likely to prevent proper termination. 0.5 pt for explaining the normal function of CstF; 0.5 pt for explaining the normal function of polyA polymerase; 1 pt for explaining why the mutation you chose would be more likely to prevent proper termination, with reference to...
1. Why is iPS cell therapy using third-party donor cells more feasible than using cells donated from the patient being treated? O Treatment with iPS cells is much more cost prohibitive when iPS cells are donated by the patient being treated. O Donor iPS cells from the patient cannot be used because they contain the disease being treated. O Third-party donor cells are less likely to contain dangerous mutations that can lead to tumor formation. O Third-party donors are screened...
Date: Thermodynamics Data Part 1 Temperature of Ca(OH)2 solution: 20°C Molarity of the HCl solution used for the titration: 0.05 M H CH Titration 1 Titration 2 Titration 3 Initial buret reading Final buret reading 10 mL 19 mi 9mL 11 mL 20 ml | 28 mc 36.4 9 mL q.4mL Volume HCl used avg=8.8 mL Part II Temperature of Ca(OH)solution: 84 c Molarity of the HCl solution used for the titration: 0.05 M HCI Titration 1 Titration 2 Titration...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 20 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago