Homework Answers
Add Answer to:
Study Assignment 5, Ionic Formulas Write the formula of each ion on the line below the...
Study Exercise 1 Name Write the formula for each ion on the line below en compound...
Study Exercise 1 Name Write the formula for each ion on the line below en compound formed by the combination of the ions. ion on the line below each name, then fill in the blanks with the correct formula and name of the Chloride Hydroxide Nitrate Sulfide Sulfate Phosphate Sodium Copper (I) Ammonium Calcium Ferrous [Iron (II)] Ferric (Iron (III)] Aluminum
Write formula for compounds wite the correct formula for the following compounds: sodium bromide calcium chloride...
Write formula for compounds
wite the correct formula for the following compounds: sodium bromide calcium chloride calcium sulfide copper(I) carbonate sulfuric acid diphosphorus pentoxide _ chloric acicd ammonium sulfate hydrochloric acid mercury(II) acetate lead (II) nitrite ammonium sulfite sodium sulfate nitrous acid nitric acid iron(III) sulfate barium fluoride copper(I) sulfite ammonium nitrate iron(III) hydroxide mercury(II) nitrate sulfurous acid hydrosulfuric acid iron(II) hydroxide lead(II) chloride calcium hydrogen carbonate sulfur trioxide phosphoric acid bromine pentafluoride dinitrogen tetroxide carbon monoxide aluminum carbonate ammonium...
Part E – Ionic Compounds Name Formula Formula Name Silver (I) chloride KNO2 Sodium acetate CrCl3...
Part E – Ionic Compounds Name Formula Formula Name Silver (I) chloride KNO2 Sodium acetate CrCl3 Calcium fluoride Mg(IO3)2 Iron (III) oxide CuBr2 Cobalt (III) sulfite NaNO3 Magnesium sulfide Al2O3 Zinc (II) phosphate NaHCO3 Nickel (II) bromide BaS Iron (II) carbonate MnO2 Sodium sulfate KH2PO4 Lithium nitrate CuCO3 Barium phosphate NaI Chromium (VI) bromate Fe(IO4)3 Potassium hydrogen carbonate MgF2 Titanium (IV) chloride Co(ClO2)3 Magnesium nitrite LiC2H3O2 Zinc (II) sulfite Ni(HSO4)2 Sodium hypobromite KCN Calcium carbonate Fe(OH)2
Write the formula, total ionic, and net ionic equations for reactions 1-21 listed below. When no...
Write the formula, total ionic,
and net ionic equations for reactions 1-21 listed below. When no
reaction is expected, write NAR for no apparent reaction.
Write answer such that for
example:
1a) formula for #1
1b) total ionic for #1
1c) net ionic for #1
1. sulfuric acid + potassium phosphate 2. sulfuric acid + lithium sulfate 3. sulfuric acid + magnesium nitrate 4. sulfuric acid + sodium carbonate 5. sulfuric acid + sodium hydroxide 6. sulfuric acid + strontium...
Compounds and Their Bonds 3. Names of ionic compounds Formula Positive Ion Negative Ion Name Ks...
Compounds and Their Bonds 3. Names of ionic compounds Formula Positive Ion Negative Ion Name Ks s2- Potassium sulfide BaF2 Barium fluoride Mgo Magnesium oxide Na₃N AICI: Mg3P2 Sodium Nitråde Aluminum Chloride Magnesium Phosphide C. Metals in Ionic Compounds with Variable Charge 1. Physical properties Compound Iron(III) chloride, FeCl3 Appearance Density Melting Point 2. Formulas of ionic compounds
Negative ion S²- 3. Names of ionic compounds Formula Positive ion Cu2s Cut |Fe₂O₃ CuCl2 FeS Ag,0 FeBr2 Name Copper(...
Negative ion S²- 3. Names of ionic compounds Formula Positive ion Cu2s Cut |Fe₂O₃ CuCl2 FeS Ag,0 FeBr2 Name Copper(I) sulfide Iron (I) oxide Copper (I) chloride Iron (II) sulfide Silver Oxide Iron(i) bromide
Write the molar equation and net ionic equation for each reaction. Reaction 1. silver nitrate +...
Write the molar equation and net ionic equation for each
reaction.
Reaction 1. silver nitrate + sodium chloride AgNO3 Nach 2. silver nitrate + sodium bromide AS Noz doim Narse 3. silver nitrate + potassium iodide A No3 KI 4. silver nitrate + sodium phosphate AS NO3 Naz PO 4 5. barium nitrate + potassium sulfate BaCNO3)2 Krsou 6. lead(II) nitrate + potassium sulfate Tome Pb(NO372 ksoy 7. barium chloride + sodium phosphate Dim Back Na₃PO4 8. calcium nitrate +...
Anion analysis 5. Complete the table below as shown by the example. Combine the lons into...
Anion analysis
5. Complete the table below as shown by the example. Combine the lons into a correct formula and name the compound. KBr potassium bromide Zn2 B; 6. (Optional) Complete the table below as shown by the example. Write the formula for each ion and combine the ions into a formula of a compound. nitrate sulfite phosphate cuprous CUNO, nickel(II) mercurous lead(IV) ferric
Chemical Reactions For each reaction you observed, the names of the reactants and products are given...
Chemical Reactions For each reaction you observed, the names of the reactants and products are given below. You must: 1. Write the correct formula for each reactant and product. Balance each equation. 2. A. Combination reactions magnesium oxide 1. Magnesium + oxygen (unbalanced) Mg+ O, MgO sulfur dioxide 2. Sulfur + oxygen B. Analysis of the Copper Content of a Penny po zinc chloride + hydrogen zinc + hydrochloric acid HCI ZnCl, 1. (unbalanced) н, Zn + C. Single Replacement...
2. Write the correct formula for each of the following:
2. Write the correct formula for each of the following: A. sodium chloride B. magnesium bromide 3. Write the correct formula for each of the following: A. copper (II) oxide B. iron (III) oxide 4. Write the correct formula for the following: A. ammonium chloride 5. Write the correct formula for the following: A. magnesium carbonate 6. Name the following compounds: A. MgCI2 B. AICI3 7. Name the following compounds: A NaO
Study Exercise 1 Name Write the formula for each ion on the line below en compound formed by the combination of the ions. ion on the line below each name, then fill in the blanks with the correct formula and name of the Chloride Hydroxide Nitrate Sulfide Sulfate Phosphate Sodium Copper (I) Ammonium Calcium Ferrous [Iron (II)] Ferric (Iron (III)] Aluminum
Write formula for compounds
wite the correct formula for the following compounds: sodium bromide calcium chloride calcium sulfide copper(I) carbonate sulfuric acid diphosphorus pentoxide _ chloric acicd ammonium sulfate hydrochloric acid mercury(II) acetate lead (II) nitrite ammonium sulfite sodium sulfate nitrous acid nitric acid iron(III) sulfate barium fluoride copper(I) sulfite ammonium nitrate iron(III) hydroxide mercury(II) nitrate sulfurous acid hydrosulfuric acid iron(II) hydroxide lead(II) chloride calcium hydrogen carbonate sulfur trioxide phosphoric acid bromine pentafluoride dinitrogen tetroxide carbon monoxide aluminum carbonate ammonium...
Write the formula, total ionic,
and net ionic equations for reactions 1-21 listed below. When no
reaction is expected, write NAR for no apparent reaction.
Write answer such that for
example:
1a) formula for #1
1b) total ionic for #1
1c) net ionic for #1
1. sulfuric acid + potassium phosphate 2. sulfuric acid + lithium sulfate 3. sulfuric acid + magnesium nitrate 4. sulfuric acid + sodium carbonate 5. sulfuric acid + sodium hydroxide 6. sulfuric acid + strontium...
Compounds and Their Bonds 3. Names of ionic compounds Formula Positive Ion Negative Ion Name Ks s2- Potassium sulfide BaF2 Barium fluoride Mgo Magnesium oxide Na₃N AICI: Mg3P2 Sodium Nitråde Aluminum Chloride Magnesium Phosphide C. Metals in Ionic Compounds with Variable Charge 1. Physical properties Compound Iron(III) chloride, FeCl3 Appearance Density Melting Point 2. Formulas of ionic compounds
Negative ion S²- 3. Names of ionic compounds Formula Positive ion Cu2s Cut |Fe₂O₃ CuCl2 FeS Ag,0 FeBr2 Name Copper(I) sulfide Iron (I) oxide Copper (I) chloride Iron (II) sulfide Silver Oxide Iron(i) bromide
Write the molar equation and net ionic equation for each
reaction.
Reaction 1. silver nitrate + sodium chloride AgNO3 Nach 2. silver nitrate + sodium bromide AS Noz doim Narse 3. silver nitrate + potassium iodide A No3 KI 4. silver nitrate + sodium phosphate AS NO3 Naz PO 4 5. barium nitrate + potassium sulfate BaCNO3)2 Krsou 6. lead(II) nitrate + potassium sulfate Tome Pb(NO372 ksoy 7. barium chloride + sodium phosphate Dim Back Na₃PO4 8. calcium nitrate +...
Anion analysis
5. Complete the table below as shown by the example. Combine the lons into a correct formula and name the compound. KBr potassium bromide Zn2 B; 6. (Optional) Complete the table below as shown by the example. Write the formula for each ion and combine the ions into a formula of a compound. nitrate sulfite phosphate cuprous CUNO, nickel(II) mercurous lead(IV) ferric
Chemical Reactions For each reaction you observed, the names of the reactants and products are given below. You must: 1. Write the correct formula for each reactant and product. Balance each equation. 2. A. Combination reactions magnesium oxide 1. Magnesium + oxygen (unbalanced) Mg+ O, MgO sulfur dioxide 2. Sulfur + oxygen B. Analysis of the Copper Content of a Penny po zinc chloride + hydrogen zinc + hydrochloric acid HCI ZnCl, 1. (unbalanced) н, Zn + C. Single Replacement...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 49 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago