Homework Answers
Add Answer to:
Question II- Answer by False or True , if a statement is False , please correct...
Name: Date: Period: Acid Base Worksheet 1. Identify whether each is an acid or base: Turns...
Name: Date: Period: Acid Base Worksheet 1. Identify whether each is an acid or base: Turns blue litmus paper red Turns red litmus paper blue Tastes sour Tastes bitter 2. A Bronsted-Lowry acid is an proton 3. A Bronsted-Lowry base is an proton 4. A Lewis acid is an electron pair 5. A Lewis base is an electron pair 6. True or False According to the Arrhenius system, water is neither an acid nor a base. A solution with a...
please help with this hw ?! Answer the Q. In the spaces below. Use the back...
please help with this hw ?!
Answer the Q. In the spaces below. Use the back of the page if necessary. 1. Give the conjugate bases for the following Bronsted-Lowry acids: a) H2SO4 b) HNO; c) H20 d) OH e) H3PO4 Ans. a). 2. Give the conjugate acids for the following Bronsted-Lowry bases: a) CO32- b) HPO42. c) H2PO4 d)NH2 e) NH3 Ans. a) b) 3. Calculate the pH of a 0.025 M solution of barium hydroxide. 4. Show how...
Answer by true or false - if false correct the statement. ( 7-) The mixture of...
Answer by true or false - if
false correct the statement.
( 7-) The mixture of equi 0.2M solution of sodium acetate and acetic acid has lower buffer capacity than the mixture of equi 0.5M NaCl and HCI. 8- Electron pair donor) is the definition of Lewis acid. false= acceptor if acid donor if base (9-) Ka of NH4OH is 5.376x10-10. (10- pH for 0.1 M Acetic acid ( Ka = 1.8 x10 -S) is 1.73.
please help. Week 9: pH of Buffer Solutions Pre-lab (20 points) Email answers to your instructor...
please help.
Week 9: pH of Buffer Solutions Pre-lab (20 points) Email answers to your instructor on the date of your regularly scheduled lab (Tues, mar 24" ...) What is the definition of a Bronsted Lowry Acid-? What is the definition of a Bronsted-Lowry Base? Water is amphoteric. That is can act like either an acid or a base. Write the self-ionization reaction for water. Kw, the ion product of and pkw has a value of - pH is defined...
1. Identify the acid, base, conjugate acid and conjugate base in the following reaction: HPO42+ H20...
1. Identify the acid, base, conjugate acid and conjugate base in the following reaction: HPO42+ H20 OH H2PO4 2. Calculate the following a) pH of a [H30*] = 2.76 x 104 M b) pH of a [OH] - 8.5 x 10-6 M c) [H30*] and [OH] for a soln pH 5.73 3. Show how an incoming acid [H30*] is neutralized by the buffer system HCO3 /CO32 system. You should also be able to show the neutralization of incoming base [OH']...
please show me how to answer these 13. Which of the following combinations would be best...
please show me how to answer these
13. Which of the following combinations would be best to buffer an aqueous solution at a pH of 2.0? a. H3PO4 and H2PO4, Kat = 7.5 x 103 b. HNO2 and NO2, Ka 4.5 x 10 c. CH3COOH and CH3COO, Ka 1.8 x 105 d. H2PO and HPO 2, Ka2 6.2x 10 14. Molecules or ions that can alternately behave as either a Bronsted-Lowry acid or base are called a. polyanions b. hydronium...
Polar molecules tend to be soluble in water. a) True b) False Which liquid is miscible...
Polar molecules tend to be soluble in water. a) True b) False Which liquid is miscible with water? a) carbon tetrachloride b) ethyl alcohol c) bromine d) oil Which anion will not precipitate silver ion? a) chloride b) nitrate c) bromide d) carbonate Which pH listed below is most acidic? a) 3 d) 7 c)9 d) 14 A hydrogen ion consists of a(n) a) electron. b) proton. c) neutron. d) proton and electron. Bronsted and Lowry defined an acid as...
i want answer to all questions please Answer: 29) Consider the following generalized buffer solution equilibrium: When a small amount of a strong base such as sodium hydroxide is added to the so...
i want answer to all questions please
Answer: 29) Consider the following generalized buffer solution equilibrium: When a small amount of a strong base such as sodium hydroxide is added to the solution, which of the four species shown would experience an increase in concentration? A) BH B)H C) HO D)B E None of the species would increase in concentration. Answer: ( 30) What is true about a solution whose pH is less than 7 at 25°C? A) It has...
CHM 202F19 HW 9B Name Answer the q. in the spaces below. Use the back of...
CHM 202F19 HW 9B Name Answer the q. in the spaces below. Use the back of the page if necessary. 1. Give the conjugate bases for the following Bronsted-Lowry acids: a) H2SO4 b) HNO; CHO DOH e) HPO4 Ansa) b) c) d) 2. Give the conjugate acids for the following Bronsted-Lowry bases: a) 0,2 b) HPO4? c) H2PO4 d) NH) e) NH3 Ans. a) _ d) e) 3. Calculate the pH of a 0.025 M solution of barium hydroxide. 4....
I.C.E. Problems Consider the following reversible reaction: CuS(s) + O2(g) Cu(s) + SO2(g) A reaction mixture...
I.C.E. Problems Consider the following reversible reaction: CuS(s) + O2(g) Cu(s) + SO2(g) A reaction mixture initially contains 1.50 MO. The equilibrium constant K-1.5. Determine the concentrations of So, and O, at equilibrium. 6) What is the conjugate base of SO,? A. HSO, B. H SO. C. it does not exist. D. SO 7) What is the conjugate base of HSO.? A HSO, B. HO C. SO 2 D. H SO 1) What is [SO] at equilibrium? A. 1.13 M...
Name: Date: Period: Acid Base Worksheet 1. Identify whether each is an acid or base: Turns blue litmus paper red Turns red litmus paper blue Tastes sour Tastes bitter 2. A Bronsted-Lowry acid is an proton 3. A Bronsted-Lowry base is an proton 4. A Lewis acid is an electron pair 5. A Lewis base is an electron pair 6. True or False According to the Arrhenius system, water is neither an acid nor a base. A solution with a...
please help with this hw ?!
Answer the Q. In the spaces below. Use the back of the page if necessary. 1. Give the conjugate bases for the following Bronsted-Lowry acids: a) H2SO4 b) HNO; c) H20 d) OH e) H3PO4 Ans. a). 2. Give the conjugate acids for the following Bronsted-Lowry bases: a) CO32- b) HPO42. c) H2PO4 d)NH2 e) NH3 Ans. a) b) 3. Calculate the pH of a 0.025 M solution of barium hydroxide. 4. Show how...
Answer by true or false - if
false correct the statement.
( 7-) The mixture of equi 0.2M solution of sodium acetate and acetic acid has lower buffer capacity than the mixture of equi 0.5M NaCl and HCI. 8- Electron pair donor) is the definition of Lewis acid. false= acceptor if acid donor if base (9-) Ka of NH4OH is 5.376x10-10. (10- pH for 0.1 M Acetic acid ( Ka = 1.8 x10 -S) is 1.73.
please help.
Week 9: pH of Buffer Solutions Pre-lab (20 points) Email answers to your instructor on the date of your regularly scheduled lab (Tues, mar 24" ...) What is the definition of a Bronsted Lowry Acid-? What is the definition of a Bronsted-Lowry Base? Water is amphoteric. That is can act like either an acid or a base. Write the self-ionization reaction for water. Kw, the ion product of and pkw has a value of - pH is defined...
1. Identify the acid, base, conjugate acid and conjugate base in the following reaction: HPO42+ H20 OH H2PO4 2. Calculate the following a) pH of a [H30*] = 2.76 x 104 M b) pH of a [OH] - 8.5 x 10-6 M c) [H30*] and [OH] for a soln pH 5.73 3. Show how an incoming acid [H30*] is neutralized by the buffer system HCO3 /CO32 system. You should also be able to show the neutralization of incoming base [OH']...
please show me how to answer these
13. Which of the following combinations would be best to buffer an aqueous solution at a pH of 2.0? a. H3PO4 and H2PO4, Kat = 7.5 x 103 b. HNO2 and NO2, Ka 4.5 x 10 c. CH3COOH and CH3COO, Ka 1.8 x 105 d. H2PO and HPO 2, Ka2 6.2x 10 14. Molecules or ions that can alternately behave as either a Bronsted-Lowry acid or base are called a. polyanions b. hydronium...
Polar molecules tend to be soluble in water. a) True b) False Which liquid is miscible with water? a) carbon tetrachloride b) ethyl alcohol c) bromine d) oil Which anion will not precipitate silver ion? a) chloride b) nitrate c) bromide d) carbonate Which pH listed below is most acidic? a) 3 d) 7 c)9 d) 14 A hydrogen ion consists of a(n) a) electron. b) proton. c) neutron. d) proton and electron. Bronsted and Lowry defined an acid as...
i want answer to all questions please
Answer: 29) Consider the following generalized buffer solution equilibrium: When a small amount of a strong base such as sodium hydroxide is added to the solution, which of the four species shown would experience an increase in concentration? A) BH B)H C) HO D)B E None of the species would increase in concentration. Answer: ( 30) What is true about a solution whose pH is less than 7 at 25°C? A) It has...
CHM 202F19 HW 9B Name Answer the q. in the spaces below. Use the back of the page if necessary. 1. Give the conjugate bases for the following Bronsted-Lowry acids: a) H2SO4 b) HNO; CHO DOH e) HPO4 Ansa) b) c) d) 2. Give the conjugate acids for the following Bronsted-Lowry bases: a) 0,2 b) HPO4? c) H2PO4 d) NH) e) NH3 Ans. a) _ d) e) 3. Calculate the pH of a 0.025 M solution of barium hydroxide. 4....
I.C.E. Problems Consider the following reversible reaction: CuS(s) + O2(g) Cu(s) + SO2(g) A reaction mixture initially contains 1.50 MO. The equilibrium constant K-1.5. Determine the concentrations of So, and O, at equilibrium. 6) What is the conjugate base of SO,? A. HSO, B. H SO. C. it does not exist. D. SO 7) What is the conjugate base of HSO.? A HSO, B. HO C. SO 2 D. H SO 1) What is [SO] at equilibrium? A. 1.13 M...
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 29 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 4 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago