When 0.070 mol of propionic acid, C2H5CO2H, is dissolved in 450 mL of water, the equilibrium concentration of H3O+ ions is measured to be 2.19 x 10−3 M. What is Ka for this acid?
[C2H5CO2H] = mol of C2H5CO2H / volume in L
= 0.070 mol / 0.450 L
= 0.156 M
C2H5CO2H dissociates as:
C2H5CO2H
-----> H+ + C2H5CO2-
0.156
0 0
0.156-x
x x
Ka = [H+][C2H5CO2-]/[C2H5CO2H]
Ka = x*x/(c-x)
Ka = 2.19*10^-3*2.19*10^-3/(0.156-2.19*10^-3)
Ka = 3.118*10^-5
Answer: 3.12*10^-5
When 0.070 mol of propionic acid, C2H5CO2H, is dissolved in 450 mL of water, the equilibrium...
When 0.070 mol of propionic acid, C2H5CO2H, is dissolved in 300 mL of water, the equilibrium concentration of H3O+ ions is measured to be 2.01 x 10−3 M. What is Ka for this acid?
when 0.05 mol of propionic acid (C2H5CO2H) is dissolved in 0.5L of water, proton transfer occurs: C2H5CO2H+H2O—>C2H5CO2+H3O the equilibrium concentration of H3O ions is 1.15*10^-3M. evaluate Keq
Propionic acid, C2H5CO2H (Ka = 1.34 × × 10^−5), is used in the manufacture of calcium propionate, a food preservative. What is the pH of a 0.698-M solution of C2H5CO2H?
The acid dissociation Ka of propionic acid C2H5CO2H is ×1.310−5. Calculate the pH of a ×1.810−4M aqueous solution of propionic acid. Round your answer to 2 decimal places. The acid dissociation K, of propionic acid (C2H3COH) is 1.3 x 10–. Calculate the pH of a 1.8 x 10 *Maqueous solution of propionic acid. Round your answer to 2 decimal places. xs ?
When 0.607 mol of CH3COCOOH is dissolved in 0.358 L of water, proton transfer occurs. CH3COCOOH + H2O ⇄CH3COCOO- + H3O+ The equilibrium concentration of H3O+ ions is 0.0640 M. Evaluate Keq. Chapter 14, Question 33 Parameterization When 0.607 mol of CH3COCOOH is dissolved in 0.358 L of water, proton transfer occurs. CH3COCOOH H20 CH3C0COO + H30+ The equilibrium concentration of H30+ ions is 0.0640 M. Evaluate Kea the tolerance is +/-2%
When 0.950 mol of HCOOH is dissolved in 0.891 L of water, proton transfer occurs. HCOOH + H2O ⇄HCOO- + H3O+ The equilibrium concentration of H3O+ ions is 0.0137 M. Evaluate Keq.
1) When 0.519 mol of HCOOH is dissolved in 0.409 L of water, proton transfer occurs. HCOOH + H2O ⇄HCOO- + H3O+ The equilibrium concentration of H3O+ ions is 0.0149 M. Evaluate Keq.
Question 4 - propionic acid (HC.H.02) has a Ka of 1.34 x 10-5. Initially, 0.498g of propionic acid is dissolved in 10.00 mL of water. What will be the pOH of the solution at equilibrium?
1. A weak monoprotic acid has molar mass 180 g/mol. When 1.00 g of this acid is dissolved in enough water to obtain a 300 mL solution, the pH of the resulting solution is found to be 2.62. What is the value of Ka for this acid? 2. A weak monoprotic acid has pKa = 3.08. Calculate the percent ionization of a 0.35 M solution of this acid. 3. Calculate the pH of a solution that is 0.050 M in CH3COOH...
The following equation represents the dissociation of propionic acid in water. HC3H502(aq) + H20(1) = H30+(aq) + C3H502 (aq) The value for the acid-dissociation constant for propionic acid (HC3H502) is 1.3x10-5 at 25°C. Calculate the hydronium ion concentration present in a propionic acid solution that has the following equilibrium concentrations. 3.24x10-2 mol/L HC3H502 3.06x10-4 mol/L for propionic acid's conjugate base, C3H5027 The general form of the acid-dissociation constant is Ka = [H30'A ], where Ka is the acid-dissociation constant, [HA]...