Homework Answers
calorimetry 1 2 NaOlt (aq) + Na 't H₂SO4 (aq) - 2 H-O-8-0-H H₂O (1) +...
calorimetry
1 2 NaOlt (aq) + Na 't H₂SO4 (aq) - 2 H-O-8-0-H H₂O (1) + 1 Na, sou da H-O-H SO50 Calorimetry - In a coffee cup calorimeter, 100.0 mL of 1.0 M. NaOH and 100.0 ml of 1.0M H₂SO are mixed. The initial temperature of each solution was 25.6°C. After the reaction, the temperature of the solution was 31.3°C Calculate how much heat does the reaction generate?
Na-OH H-o-s-o-H H-0. 0 0 HNOo 1. Calorimetry. In a coffee cup calorimeter, 100.0 mL of...
Na-OH H-o-s-o-H H-0. 0 0 HNOo 1. Calorimetry. In a coffee cup calorimeter, 100.0 mL of 1.0 M NaOH and 100.0 mL of 1.0 M H2SO4 are mixed. The initial temperature of eac solution was 25.6 0 C. After the reaction, the temperature of the solution was 31.3 o C Calculate how much heat does the reaction generate? kJ kJ 2. Using heat of formation Enthalpy's calculate how much heat does the reaction generate? 3. Using bond energies calculate how...
1. A volume of water was heated to 81.76 °C and immediately added to 48.80 mL of water at 20.55 °C contained within a co...
1. A volume of water was heated to 81.76 °C and immediately added to 48.80 mL of water at 20.55 °C contained within a coffee cup calorimeter. The final temperature of the mixture was 37.73 °C. The final volume of water inside the calorimeter was 92.03 mL. Assuming that them heat capacity of the solution is 4.18 J/g/°C, calculate the following: a. The volume of hot water added ml b. The mass of hot water (dwater = 1.00 g/mL) g...
2. A 49.21 mL volume of 1.00 M HCl was mixed with 48.05 mL of 2.00...
2. A 49.21 mL volume of 1.00 M HCl was mixed with 48.05 mL of 2.00 M NaOH in a coffee cup calorimeter (with calorimeter constant = 25.6 J/°C) at 20.32 °C. The final temperature of the aqueous solution after the reaction was 29.83 °C. Assuming that them heat capacity of the solution is 4.18 J/g/°C, calculate the following: a. The total mass of aqueous solution inside the calorimeter (dsoln = 1.00 g/mL) g correct 1/1 b. The change in...
Fill in the Blanks Let's use calorimetry to measure heats of reaction. Suppose you mix 25.0...
Fill in the Blanks Let's use calorimetry to measure heats of reaction. Suppose you mix 25.0 mL of 0.08M cesium hydroxide with 25.0 mL of 0.08M hydrochloric acid. Assume both solutions are at 28.0°C. The temperature of the solution after the reaction is 30.2°C. Because the temperature of the solution went up, the reaction is (endothermic/exothermic). Now compute the heat of the reaction assuming the heat capacities of the solutions are equal to pure water (4.18 J/g°C). Report the Q...
Calculate ?H for a reaction
Sodium metal reacts with water to produce hydrogen gas and sodium hydroxide according to the chemical equation shown below. When 0.030 mol of Na is added to 100.00g of water, the temperature of the resulting solution rises from 25.00°C to 37.90°C. If the specific heat of the solution is 4.18 J/(g · °C), calculate ?H for thereaction, as written.2 Na(s) + 2 H2O(l) --> 2 NaOH(aq) + H2(g)?H= ?Answer is one of the following:-90.0 kJ-360 kJ-5.41 kJ-180 kJ
1. Calculate the quantity of heat released when 8.Sg of hydrogen peroxide decomposes, given: atomic weights...
1. Calculate the quantity of heat released when 8.Sg of hydrogen peroxide decomposes, given: atomic weights 0=16, and H= 1. Hydrogen peroxide decomposes to water and oxygen according to the reaction: H = -196KJ 2. Given the speclflc heat, c,, of water Is 4.18 J/g 0c,how much heat Is needed to warm 200g of water from 22°c to 98°C? q=mC,AT 3. If 20.9KJ of heat were added to 250g of liquid water, how much would its temperature Increase? (Use 4.18 J/goc...
please answer the full thing 1. What would be the AE (in kJ) for the following...
please answer the full thing
1. What would be the AE (in kJ) for the following reaction if 6.300 moles of H20 were decomposed? 2 H2O + 2H2 + O AE = 483.6 kJ (for reaction as written) 2. The value of AE for the reaction below is -336 kJ. Determine the amount of heat (in kJ) evolved when 13.0 g of HCl is formed. CH4(9) + 3 Cl2(g) - CHCI) + 3HCIO) 3. If 1.00 cal = 4.18 J,...
2. A 49.45 mL volume of 1.00 M HCl was mixed with 49.14 mL of 2.00...
2. A 49.45 mL volume of 1.00 M HCl was mixed with 49.14 mL of 2.00 M NaOH in a coffee cup calorimeter (with calorimeter constant = 25.1 J/°C) at 21.34 °C. The final temperature of the aqueous solution after the reaction was 29.37 °C. Assuming that them heat capacity of the solution is 4.18 J/g/°C, calculate the following: e. The enthalpy change (∆H) for the neutralization in kJ/mol HCl ( this should be a negative number) e. The enthalpy...
6.A 12.8 g sample of ethanol (C,H,OH) is burned in a calorimeter with a heat capacity...
6.A 12.8 g sample of ethanol (C,H,OH) is burned in a calorimeter with a heat capacity of 5.65 kJ/°C. Assume the heat from the sample is negligible compared to the calorimeter. Determine the initial temperature of the calorimeter if the final temperature is 85.7°C. The molar mass of ethanol is 46.07 g/mol. С-Н,ОН , + 3 О,ее — 2 СОде + 3 Н,0 qrxn -1235 kJ 7. Two solutions, initially at 24.60 °C, are mixed in a coffee cup calorimeter...
calorimetry
1 2 NaOlt (aq) + Na 't H₂SO4 (aq) - 2 H-O-8-0-H H₂O (1) + 1 Na, sou da H-O-H SO50 Calorimetry - In a coffee cup calorimeter, 100.0 mL of 1.0 M. NaOH and 100.0 ml of 1.0M H₂SO are mixed. The initial temperature of each solution was 25.6°C. After the reaction, the temperature of the solution was 31.3°C Calculate how much heat does the reaction generate?
Na-OH H-o-s-o-H H-0. 0 0 HNOo 1. Calorimetry. In a coffee cup calorimeter, 100.0 mL of 1.0 M NaOH and 100.0 mL of 1.0 M H2SO4 are mixed. The initial temperature of eac solution was 25.6 0 C. After the reaction, the temperature of the solution was 31.3 o C Calculate how much heat does the reaction generate? kJ kJ 2. Using heat of formation Enthalpy's calculate how much heat does the reaction generate? 3. Using bond energies calculate how...
Fill in the Blanks Let's use calorimetry to measure heats of reaction. Suppose you mix 25.0 mL of 0.08M cesium hydroxide with 25.0 mL of 0.08M hydrochloric acid. Assume both solutions are at 28.0°C. The temperature of the solution after the reaction is 30.2°C. Because the temperature of the solution went up, the reaction is (endothermic/exothermic). Now compute the heat of the reaction assuming the heat capacities of the solutions are equal to pure water (4.18 J/g°C). Report the Q...
please answer the full thing
1. What would be the AE (in kJ) for the following reaction if 6.300 moles of H20 were decomposed? 2 H2O + 2H2 + O AE = 483.6 kJ (for reaction as written) 2. The value of AE for the reaction below is -336 kJ. Determine the amount of heat (in kJ) evolved when 13.0 g of HCl is formed. CH4(9) + 3 Cl2(g) - CHCI) + 3HCIO) 3. If 1.00 cal = 4.18 J,...
6.A 12.8 g sample of ethanol (C,H,OH) is burned in a calorimeter with a heat capacity of 5.65 kJ/°C. Assume the heat from the sample is negligible compared to the calorimeter. Determine the initial temperature of the calorimeter if the final temperature is 85.7°C. The molar mass of ethanol is 46.07 g/mol. С-Н,ОН , + 3 О,ее — 2 СОде + 3 Н,0 qrxn -1235 kJ 7. Two solutions, initially at 24.60 °C, are mixed in a coffee cup calorimeter...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 24 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago