Homework Answers
plz
give up thumb for rating.
Add Answer to:
3. For each of the following reactions: H2SO4(aq) + H20 = H30+(aq) + H50,- (aq) HS04...
5. In the following reactions, identify the conjugate acid-base pairs. H2SO4 (aq) + H2O(1) → H30+...
5. In the following reactions, identify the conjugate acid-base pairs. H2SO4 (aq) + H2O(1) → H30+ (aq) + HS0ǐ (aq) 1st pair: CH-NH2(aq) + H20(f) CH3NH扎aq) + OH-(aq) 1st pair: HF(aq) + NH3(aq) 근 NH (aq) + F-(aq) 1t pair: a. 2nd pair: 2nd pair: 2nd pair:
Problem 10.8 identify the reactant that is a Brønsted - Lowry acid in the following reaction:...
Problem 10.8 identify the reactant that is a Brønsted - Lowry acid in the following reaction: co32-(aq) + H2O(l) HCO'. (aq) + OH-(aq) Express your answer as a chemical formula a ? Submit Request Answer Part B Identify the reactant that is a Bronsted Lowry base in the following reaction: co32-(aq) + H2O() HCO3 (aq) + OH' (aq) Express your answer as a chemical formula. Submit Request Answer ▼ Part C identily the reactant that is a Brønsted - Lowry...
Identify the conjugate acid-base pairs in each of the following equations: 1) HF(aq)+CO32?(aq)?F?(aq)+HCO3?(aq) Check all that...
Identify the conjugate acid-base pairs in each of the following equations: 1) HF(aq)+CO32?(aq)?F?(aq)+HCO3?(aq) Check all that apply. a) F?/HCO3? b) HF/F? c) HF/CO32? d) HCO3?/CO32? 2) HCl(aq)+OH?(aq)?Cl?(aq)+H2O(l) a) HCl/OH? b) HCl/Cl? c) H2O/OH? d) H2O/Cl?
For which of the following reactions will the reactants be favored at equilibrium? NH3(aq) + H30+...
For which of the following reactions will the reactants be favored at equilibrium? NH3(aq) + H30+ (aq) = NH4+ (aq) + H20(1) CO32- (aq) + H30+ (aq) = HCO3(aq) + H2O(1) CH3COOH(aq) + OH(aq) = CH3COO" (aq) + H2O(1) HSO3- (aq) + H3O+ (aq) =H2SO3(aq) + H2O(1) CIOA" (aq) + H3PO4(aq) = HCIO4(aq) + H2PO4" (aq)
HCN(aq) + SO *(aq) + Use the lowest possible coefficients. Use the pull-down boxes to specify...
HCN(aq) + SO *(aq) + Use the lowest possible coefficients. Use the pull-down boxes to specify states such as (aq) or (s). If a box is not needed, leave it blank.) Acid Base Strongest HC104 acids H2SO4 C104- HSO4- Weakest bases HI I HBr Br HCI Ci HNO3 NO3- H30+ H2O HSO4 SO42- H2SO3 HSO3- H3PO4 H2PO4- HNO2 NO2 HF F HC2H302 C2H2O2- Al(H20)63+ Al(H20); OH H2CO3 HCO3 HAS HS HCIO C10- HBrO Br0 NH4+ NH HCN CN HCN CN...
late for class please just help with these dont have time to make more posts 4....
late for class please just
help with these dont have time to make more posts
4. The equilibrium constant values for a number of reactions are listed below. Indicate whether the products or reactants are favored. Reaction Which side is favored? NH3(aq) + H2O(l) 5 NH4+ (aq) + OH(aq) K = 5.0 x 1012 2 HBr 5 2 Hz Brz K = 5.8 x 10-18 CH3CH(OH)COOH(aq) = CH3CH(OH)COO"(aq) + H+(aq) K= 1.4 x 10-4 5. Hydrogen chloride can be made...
Consider the following reaction: HNO2 (aq) + HPO42-(aq) ⇌ NO2-(aq) + H2PO4-(aq) a.)Identify the Brønsted-Lowry acids...
Consider the following reaction: HNO2 (aq) + HPO42-(aq) ⇌ NO2-(aq) + H2PO4-(aq) a.)Identify the Brønsted-Lowry acids and bases in the forward reaction b.)State the conjugate pairs for the above reaction. Be specific. Identify the acids and bases in the following reactions and identify the conjugate pairs. HF(aq) + H2O(l) ⇌ H3O+(aq) + F-(aq) CH3NH2(aq) + H2O(l) ⇌ OH-(aq) + CH3NH3+(aq) HCO3-(aq) + HSO4-(aq) ⇌ H2CO3(aq) + SO42-(aq) Complete the following reactions: ____________(aq) + Br-(aq) ⇌ NH3(aq) + HBr(aq) CH3COOH(aq) +...
(d) Conjugate acid: OH"; conjugate base: H3* (e) None of these 5. Identify the conjugate acid/base...
(d) Conjugate acid: OH"; conjugate base: H3* (e) None of these 5. Identify the conjugate acid/base pairs in the following equation (10) HASO4 + H2O <H2AsO4 + OH (A). HASO. (acid)HAsO4 (base): H2O (acid)/ OH (base) (B). HASO4 (acid)/HASO. (base): H2O (acid)/ OH (base) (C). H2AsO4 (acid)/ OH (base) ; H2O (acid)/HASO4 (base) (D). H AsO4 and H20 (acids): OH and HASO4(bases) (E). None of these 6. Which is an INCORRECT statement?(10) a) The conjugate base of H2O is OH....
Identify conjugate acid-base pairs in each of the following reactions. NH3(aq) + H2O(l) = NH4+ (aq)...
Identify conjugate acid-base pairs in each of the following reactions. NH3(aq) + H2O(l) = NH4+ (aq) + OH- (aq) Check all that apply. H2O/NH3 NH4+/NH3 H2O/OH NH4+/OH- Submit Request Answer Part B OH(aq) + HF(aq) = H20(1)+F- (aq) Check all that apply. H2O/F- H20/OH HF/F- HF/OH
Be sure to answer all parts. Identify and label the species in each reaction. (a) NH(aq)...
Be sure to answer all parts. Identify and label the species in each reaction. (a) NH(aq) + H2O(1) = NH3(aq) + Hz0+ (aq) o acid conjugate acid conjugate acid o O acid base base e conjugate base conjugate base (b) CN (aq) + H2O(1) = HCN(aq) + OH(aq) acid conjugate acid acid base conjugate acid base conjugate base conjugate base
5. In the following reactions, identify the conjugate acid-base pairs. H2SO4 (aq) + H2O(1) → H30+ (aq) + HS0ǐ (aq) 1st pair: CH-NH2(aq) + H20(f) CH3NH扎aq) + OH-(aq) 1st pair: HF(aq) + NH3(aq) 근 NH (aq) + F-(aq) 1t pair: a. 2nd pair: 2nd pair: 2nd pair:
Problem 10.8 identify the reactant that is a Brønsted - Lowry acid in the following reaction: co32-(aq) + H2O(l) HCO'. (aq) + OH-(aq) Express your answer as a chemical formula a ? Submit Request Answer Part B Identify the reactant that is a Bronsted Lowry base in the following reaction: co32-(aq) + H2O() HCO3 (aq) + OH' (aq) Express your answer as a chemical formula. Submit Request Answer ▼ Part C identily the reactant that is a Brønsted - Lowry...
For which of the following reactions will the reactants be favored at equilibrium? NH3(aq) + H30+ (aq) = NH4+ (aq) + H20(1) CO32- (aq) + H30+ (aq) = HCO3(aq) + H2O(1) CH3COOH(aq) + OH(aq) = CH3COO" (aq) + H2O(1) HSO3- (aq) + H3O+ (aq) =H2SO3(aq) + H2O(1) CIOA" (aq) + H3PO4(aq) = HCIO4(aq) + H2PO4" (aq)
HCN(aq) + SO *(aq) + Use the lowest possible coefficients. Use the pull-down boxes to specify states such as (aq) or (s). If a box is not needed, leave it blank.) Acid Base Strongest HC104 acids H2SO4 C104- HSO4- Weakest bases HI I HBr Br HCI Ci HNO3 NO3- H30+ H2O HSO4 SO42- H2SO3 HSO3- H3PO4 H2PO4- HNO2 NO2 HF F HC2H302 C2H2O2- Al(H20)63+ Al(H20); OH H2CO3 HCO3 HAS HS HCIO C10- HBrO Br0 NH4+ NH HCN CN HCN CN...
late for class please just
help with these dont have time to make more posts
4. The equilibrium constant values for a number of reactions are listed below. Indicate whether the products or reactants are favored. Reaction Which side is favored? NH3(aq) + H2O(l) 5 NH4+ (aq) + OH(aq) K = 5.0 x 1012 2 HBr 5 2 Hz Brz K = 5.8 x 10-18 CH3CH(OH)COOH(aq) = CH3CH(OH)COO"(aq) + H+(aq) K= 1.4 x 10-4 5. Hydrogen chloride can be made...
(d) Conjugate acid: OH"; conjugate base: H3* (e) None of these 5. Identify the conjugate acid/base pairs in the following equation (10) HASO4 + H2O <H2AsO4 + OH (A). HASO. (acid)HAsO4 (base): H2O (acid)/ OH (base) (B). HASO4 (acid)/HASO. (base): H2O (acid)/ OH (base) (C). H2AsO4 (acid)/ OH (base) ; H2O (acid)/HASO4 (base) (D). H AsO4 and H20 (acids): OH and HASO4(bases) (E). None of these 6. Which is an INCORRECT statement?(10) a) The conjugate base of H2O is OH....
Identify conjugate acid-base pairs in each of the following reactions. NH3(aq) + H2O(l) = NH4+ (aq) + OH- (aq) Check all that apply. H2O/NH3 NH4+/NH3 H2O/OH NH4+/OH- Submit Request Answer Part B OH(aq) + HF(aq) = H20(1)+F- (aq) Check all that apply. H2O/F- H20/OH HF/F- HF/OH
Be sure to answer all parts. Identify and label the species in each reaction. (a) NH(aq) + H2O(1) = NH3(aq) + Hz0+ (aq) o acid conjugate acid conjugate acid o O acid base base e conjugate base conjugate base (b) CN (aq) + H2O(1) = HCN(aq) + OH(aq) acid conjugate acid acid base conjugate acid base conjugate base conjugate base
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 7 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 11 hours ago