Homework Answers
Ans: more polar molecule will elute first.
in reverse phase column chromatography some alkyl chains covalently bonded to the stationary phases particles in order to create a hydrophobic stationary phase, which has a stonger affinty for hydrophobic or less polar compounds.As a result, hydrophobic molecules(more non polar) in the column tend to adsorb to the hydrophobic stationary phase whereas hydrophilic molecules(more polar) pass throough the coumn and will elute first.
Add Answer to:
4. Will a more polar or more non-polar molecule elute off a column first in reverse...
Which is more polar and why? - Ferrocene, acetylferrocene or diacetylferrocene Which compound would elute off...
Which is more polar and why? - Ferrocene, acetylferrocene or diacetylferrocene Which compound would elute off a column first and which compound would elute off a column last and why?
7). a). Is the acetone molecule non-polar or polar? Circle. Non-polar Polar b). Sketch pictures of...
7). a). Is the acetone molecule non-polar or polar? Circle. Non-polar Polar b). Sketch pictures of the intermolecular forces that would occur between the molecules of acetone and the molecules of 2- propanone if you have a mixture of the two liquids. What would be the main type of IMF that is responsible for the attraction? (Give a name for the IMF). c). The pentane molecule and the 2-pentanone molecule both have five carbon atoms on their structures. Why 2-pentanone...
Between benzophenone and 4-nitro benzaldehyde which compound is more polar and which compound would elute first...
Between benzophenone and 4-nitro benzaldehyde which compound is more polar and which compound would elute first in column chromatography, which compound would be higher on a TLC plate and why?
7. Given a non-polar stationary phase C18 (reverse phase) and a slightly polar mobile phase (15%...
7. Given a non-polar stationary phase C18 (reverse phase) and a slightly polar mobile phase (15% water 85% acetonitrile) predict the order of elution for the following compounds (with 1 being the fastest and 4 being the slowest) (6 pts) Methanol CH OH 1-florobutane CH CH CH2CH2F Butanol CH,CH CHCHOH Cyclohexane CoH12 Briefly justify how you made your choice(s) Now increase the polarity of the mobile phase to 85% water and 15 % acetonitrile. Explain the relative shifts in retention...
question #2 please Reverse phase chromatography is the most common type of liquid chromatography which the...
question #2 please
Reverse phase chromatography is the most common type of liquid chromatography which the solid phase is made up of a packing material that is largely hydrophobic and the eluents are of varying polarities. In general, the more polar compounds elute first from the column followed by more hydrophobic compounds. PRELAB QUESTIONS 1. Draw structures for the following analytes for the simulation: a. acetophenone b. benzophenone c. butylparaben d. propiopheneone e. ethylparaben f. propylparaben g. ketoprofen h. 3-nitrophenol...
intermolecular forces experiment question The more polar mobile phase is the 20% acetone solution (since it...
intermolecular forces experiment question The more polar mobile phase is the 20% acetone solution (since it is 80% water). Paper is made from cellulose which contains a lot of oxygen atoms and OH groups. Write a short paragraph discussing which solvent best separated the ink components from the Vis-a-Vis pens. Consider in your discussion the relative attraction of the ink components for the solvent and for the paper. Does your discussion support the statement that these pens are water soluble?
1. Select an appropriate type of column for separating these steroids and give the rationale for...
1. Select an appropriate type of column for separating these steroids and give the rationale for your selection. HO HO ОН OH Prednisolone Prednisone 2. You are using a C18 Reverse Phase column and the parameters shown below to separate Acetaminophen, Caffeine, and Benzoic Acid. You observe three peaks in your chromatogram (Huzzah!). Which corresponds to which compound? Explain the rationale behind your assignment. OH C18 REVERSED PHASE COLUMN Acetaminophen HC N H, O Caffeine Column: Legacy L1 Size: 4.6...
1. What is the purpose of column chromatography 2. What is the stationary phase? Mobile phase?...
1. What is the purpose of column chromatography 2. What is the stationary phase? Mobile phase? 3. What is the purpose of the cotton (glass wool) in column chromatography? 4. What is the purpose of the sand? 5. Why is it important to prevent the column from drying? 6. What can happen if you disrupt your even layer of silica gel? 7. Which compounds come off the column first, polar or nonpolar? 8. Keyon synthesized acetylferrocene (orange) in organic chemistry...
You are fixing your car and get grease all over your hands. Grease is a high molecular weight, non-polar substance. You...
You are fixing your car and get grease all over your hands. Grease is a high molecular weight, non-polar substance. You have the following substances at your disposal to clean your hands: water, alcohol (ethanol: C2H5OH), gasoline (octane: C8H18), ammonia, hydrochloric acid, and salt (sodium chloride). 1. Identify the ionic compounds. Give reasons. 2. Using your knowledge of solubility, liquid properties, and intermolecular forces, which substance would you use to clean your hands? Choose one substance only. Give reasons for...
9. Draw all of the possible hydrogen bonds between the following molecule and water molecules. Indicate...
9. Draw all of the possible hydrogen bonds between the following molecule and water molecules. Indicate the hydrogen bonds with dotted lines. :N-CEN: H 10. Polar molecules can contain more than one type of attractive force. Fill in the following table answering the question "Is this attractive force present between molecules of the given compound?" Write yes or no for each force. Molecule Ionic Attraction H-Bond Dipole-Dipole London CHCl3 CH3OH NH2 65- *NH3-C-COO 11. For each of the following pairs...
7). a). Is the acetone molecule non-polar or polar? Circle. Non-polar Polar b). Sketch pictures of the intermolecular forces that would occur between the molecules of acetone and the molecules of 2- propanone if you have a mixture of the two liquids. What would be the main type of IMF that is responsible for the attraction? (Give a name for the IMF). c). The pentane molecule and the 2-pentanone molecule both have five carbon atoms on their structures. Why 2-pentanone...
7. Given a non-polar stationary phase C18 (reverse phase) and a slightly polar mobile phase (15% water 85% acetonitrile) predict the order of elution for the following compounds (with 1 being the fastest and 4 being the slowest) (6 pts) Methanol CH OH 1-florobutane CH CH CH2CH2F Butanol CH,CH CHCHOH Cyclohexane CoH12 Briefly justify how you made your choice(s) Now increase the polarity of the mobile phase to 85% water and 15 % acetonitrile. Explain the relative shifts in retention...
question #2 please
Reverse phase chromatography is the most common type of liquid chromatography which the solid phase is made up of a packing material that is largely hydrophobic and the eluents are of varying polarities. In general, the more polar compounds elute first from the column followed by more hydrophobic compounds. PRELAB QUESTIONS 1. Draw structures for the following analytes for the simulation: a. acetophenone b. benzophenone c. butylparaben d. propiopheneone e. ethylparaben f. propylparaben g. ketoprofen h. 3-nitrophenol...
1. Select an appropriate type of column for separating these steroids and give the rationale for your selection. HO HO ОН OH Prednisolone Prednisone 2. You are using a C18 Reverse Phase column and the parameters shown below to separate Acetaminophen, Caffeine, and Benzoic Acid. You observe three peaks in your chromatogram (Huzzah!). Which corresponds to which compound? Explain the rationale behind your assignment. OH C18 REVERSED PHASE COLUMN Acetaminophen HC N H, O Caffeine Column: Legacy L1 Size: 4.6...
1. What is the purpose of column chromatography 2. What is the stationary phase? Mobile phase? 3. What is the purpose of the cotton (glass wool) in column chromatography? 4. What is the purpose of the sand? 5. Why is it important to prevent the column from drying? 6. What can happen if you disrupt your even layer of silica gel? 7. Which compounds come off the column first, polar or nonpolar? 8. Keyon synthesized acetylferrocene (orange) in organic chemistry...
9. Draw all of the possible hydrogen bonds between the following molecule and water molecules. Indicate the hydrogen bonds with dotted lines. :N-CEN: H 10. Polar molecules can contain more than one type of attractive force. Fill in the following table answering the question "Is this attractive force present between molecules of the given compound?" Write yes or no for each force. Molecule Ionic Attraction H-Bond Dipole-Dipole London CHCl3 CH3OH NH2 65- *NH3-C-COO 11. For each of the following pairs...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago