Homework Answers
Add Answer to:
can you please explain each step and why its occurring!!
can you explain why each step...
Can you please explain why D is correct and other answers are incorrect? Thank you Which...
Can you please explain why D is correct and other answers are
incorrect? Thank you
Which alcohol will undergo acid-catalyzed dehydration under the mildest conditions? 56. (A) CH CH,CH,CH,OH (B) CH,CH2CH OH)CH3 (C) (CH)CHCHOH ( (CH),COH
NEED HELP WITH ORAGNIC ASAP! NEED STEP-BY-STEP REASONING AND EXPLAIN EVERYTHING.MUST SHOW ALL WORK AND STEPS...
NEED HELP WITH ORAGNIC ASAP! NEED STEP-BY-STEP
REASONING AND EXPLAIN EVERYTHING.MUST SHOW ALL WORK AND STEPS
PLEASE AND SHOW STEREOCHEMISTRY FOR EACH REACTION!!! (PLEASE DONT
REPOST OLD ANSWERS) The (-------) lines indicate unspecified
steriochemistry please identify those!!! And show all intermediate
via arrow pushing.PLEASE DO 2A AND 2B!
2A)- Indicate reagents and approximate reactions conditions that could be used to effect the following transformations. In the process, show each step of the reaction including resulting intermediates giving rise to the...
why is the answer C? Wouldn't 5 be meso? please explain each answer if you can...
why
is the answer C? Wouldn't 5 be meso? please explain each answer if
you can
BE 60 Which of the following are optically active compounds? CH3 H Br H2H HCH, H- CHg Br CH3 H H CH₃ CH3 H H H Br Br Br Br 3 CH₂ Br A. 1 and 4 B. 1,4, and 5 C. 2,3, and 5 D. 4 only
0113k NaDH.102 4. Please outline the reaction sequence for each of these multi-step syntheses. Note. You...
0113k NaDH.102 4. Please outline the reaction sequence for each of these multi-step syntheses. Note. You do not need to provide detailed reaction mechanisms (NAD KANA DA ) simply use arrows with reagents and reaction conditions written above and below showing each step of the sequence and the structures that are produced in those steps. NR
Can you please show ( step by step with arrows )the mechanism for how each reaction...
Can you please show ( step by step with arrows )the
mechanism for how each reaction came about with its product. Thank
you
1. Br, hv 2. NaOCH, CH,OH 1. BrMgCH2CH3 CH3CH2OCH2CH3 2. dilute HCI. H20 110 DIASTEREAMERS 1. NaBH, CH,OH 2. HCI, H20 Br 141 HBr (excess) NaOC(CH3), HOC(CH3)3
Please explain how you got your answer in detail, and why the other answer choices are...
Please explain how you got your answer in detail, and why the
other answer choices are incorrect. Thank you !
Use the reagents below in the proper order to convert 3-methyl-1-butene to 2-methyl-2-butene. You may assume that all steps produce exclusively the major product. The synthesis can be accomplished in fewer than 4 steps. e.g. if you think this can be accomplished using sodium ethoxide and then potassium tert-butoxide, you would write your answer as 49. HBr 1) Hg(OAC)2, H2O...
please explain why the answer is the answer step by step Retrosynthetic Analysis Give a reasonable...
please explain why the answer is the answer step by step
Retrosynthetic Analysis Give a reasonable synthesis for each of the following compounds from the indicated starting materials. You may use any other organic or inorganic reagents you wish unless otherwise indicated. The desired product for each reaction you propose must be the one of the predominant products. Give the reactants, conditions (where appropriate) and products of each synthetic step. If equal mixtures are anticipated (ie. ortho/para products) then indicate...
Electrophilic Aromatic Substitution: Reagents 1. Each of the following transformations can be carried out in one...
Electrophilic Aromatic Substitution: Reagents 1. Each of the following transformations can be carried out in one or two steps. Fill in the reagents required for each step. If a second step is not needed, please put an "X" through the second box 2. CI 2. OH 2. CH, CHE SO,H 2. 2.
Can you please answer all of them? Section B: Free Response (you must show your work...
Can you please answer all of them?
Section B: Free Response (you must show your work for full credit) 1. Draw Frost circle diagrams for each compound shown. Assume that all atoms in the ring are sp2 hybridized. Populate the pi electrons in the corresponding MO's. Identify the compound as aromatic or antiaromatic. (5 pts) 2. What is the Hückel number of pi electrons for the molecule shown below? How many pi electron pairs does it have? Would you expect...
Show the most efficient synthesis of the product from the starting material. Show all reagents your...
Show the most efficient synthesis of the product from the starting material. Show all reagents your need over each arrow, and draw all products and intermediates (do not combine steps). You do not need to show the mechanism for any steps. Show all molecules synthesized along the way, and pay attention to stereochemistry. If a racemic mixture is produced in any step, show both products formed. If you make a mixture of regioisomers in any of the steps, place a...
Can you please explain why D is correct and other answers are
incorrect? Thank you
Which alcohol will undergo acid-catalyzed dehydration under the mildest conditions? 56. (A) CH CH,CH,CH,OH (B) CH,CH2CH OH)CH3 (C) (CH)CHCHOH ( (CH),COH
NEED HELP WITH ORAGNIC ASAP! NEED STEP-BY-STEP
REASONING AND EXPLAIN EVERYTHING.MUST SHOW ALL WORK AND STEPS
PLEASE AND SHOW STEREOCHEMISTRY FOR EACH REACTION!!! (PLEASE DONT
REPOST OLD ANSWERS) The (-------) lines indicate unspecified
steriochemistry please identify those!!! And show all intermediate
via arrow pushing.PLEASE DO 2A AND 2B!
2A)- Indicate reagents and approximate reactions conditions that could be used to effect the following transformations. In the process, show each step of the reaction including resulting intermediates giving rise to the...
why
is the answer C? Wouldn't 5 be meso? please explain each answer if
you can
BE 60 Which of the following are optically active compounds? CH3 H Br H2H HCH, H- CHg Br CH3 H H CH₃ CH3 H H H Br Br Br Br 3 CH₂ Br A. 1 and 4 B. 1,4, and 5 C. 2,3, and 5 D. 4 only
0113k NaDH.102 4. Please outline the reaction sequence for each of these multi-step syntheses. Note. You do not need to provide detailed reaction mechanisms (NAD KANA DA ) simply use arrows with reagents and reaction conditions written above and below showing each step of the sequence and the structures that are produced in those steps. NR
Can you please show ( step by step with arrows )the
mechanism for how each reaction came about with its product. Thank
you
1. Br, hv 2. NaOCH, CH,OH 1. BrMgCH2CH3 CH3CH2OCH2CH3 2. dilute HCI. H20 110 DIASTEREAMERS 1. NaBH, CH,OH 2. HCI, H20 Br 141 HBr (excess) NaOC(CH3), HOC(CH3)3
Please explain how you got your answer in detail, and why the
other answer choices are incorrect. Thank you !
Use the reagents below in the proper order to convert 3-methyl-1-butene to 2-methyl-2-butene. You may assume that all steps produce exclusively the major product. The synthesis can be accomplished in fewer than 4 steps. e.g. if you think this can be accomplished using sodium ethoxide and then potassium tert-butoxide, you would write your answer as 49. HBr 1) Hg(OAC)2, H2O...
please explain why the answer is the answer step by step
Retrosynthetic Analysis Give a reasonable synthesis for each of the following compounds from the indicated starting materials. You may use any other organic or inorganic reagents you wish unless otherwise indicated. The desired product for each reaction you propose must be the one of the predominant products. Give the reactants, conditions (where appropriate) and products of each synthetic step. If equal mixtures are anticipated (ie. ortho/para products) then indicate...
Electrophilic Aromatic Substitution: Reagents 1. Each of the following transformations can be carried out in one or two steps. Fill in the reagents required for each step. If a second step is not needed, please put an "X" through the second box 2. CI 2. OH 2. CH, CHE SO,H 2. 2.
Can you please answer all of them?
Section B: Free Response (you must show your work for full credit) 1. Draw Frost circle diagrams for each compound shown. Assume that all atoms in the ring are sp2 hybridized. Populate the pi electrons in the corresponding MO's. Identify the compound as aromatic or antiaromatic. (5 pts) 2. What is the Hückel number of pi electrons for the molecule shown below? How many pi electron pairs does it have? Would you expect...
Show the most efficient synthesis of the product from the starting material. Show all reagents your need over each arrow, and draw all products and intermediates (do not combine steps). You do not need to show the mechanism for any steps. Show all molecules synthesized along the way, and pay attention to stereochemistry. If a racemic mixture is produced in any step, show both products formed. If you make a mixture of regioisomers in any of the steps, place a...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 40 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago