Homework Answers
Add Answer to:
9. Calculate both the maximum amount of non-P-V work and maximum amount of work per mole...
7. Calculate the maximum non-expansion work per mole that may be obtained from the combustion of...
7. Calculate the maximum non-expansion work per mole that may be obtained from the combustion of methanol at 298 K. (10 pts) 2CH,OH (g) + O2 (g) 2002 (g) + 4H20 (1) CH,OH (g) 0:(8) CO2(g) H20 (1) A, Gº (kJ mol) -161.96 0 -394.36 -273.13
(2) (24 pts) A fuel cell produces electricity via a combustion reaction. A DMFC is a...
(2) (24 pts) A fuel cell produces electricity via a combustion reaction. A DMFC is a proton-exchange fuel cell that uses methanol CH3OH) as the fuel, which reacts with molecular oxygen to produce carbon dioxide and water. (a) (4 pts) Write the balanced combustion reaction for this methanol fuel cell. (b) (4 pts) Write the balanced half-reactions occurring at the cathode and anode of this fuel cell (assume standard acidic conditions) (e) (4 pts) Evaluate AGº (kJ) and AE° (V)...
(2) (24 pts) A fuel cell produces electricity via a combustion reaction. A DMFC is a...
(2) (24 pts) A fuel cell produces electricity via a combustion reaction. A DMFC is a proton-exchange fuel cell that uses methanol CH OH() as the fuel, which reacts with molecular oxygen to produce carbon dioxide and water. (a) (4 pts) Write the balanced combustion reaction for this methanol fuel cell (b) (4 pts) Write the balanced half-reactions occurring at the cathode and anode of this fuel cell (assume standard acidic conditions). (c) (4 pts) Evaluate AG° (kJ) and AE...
Methanol, CH3OH (l), combusts according to the following equation: 2 CH3OH (l) + 3 O2 (g)...
Methanol, CH3OH (l), combusts according to the following equation: 2 CH3OH (l) + 3 O2 (g) → 2 CO2 (g) + 4 H2O (l) ∆rHo (298 K) = −1452 kJ Here is a list of Entropies of formation: S (J K-1 mol-1) at 298 K CH3OH (l) =126.8 O2 (g) = 205.14 CO2 (g) = 213.74 H2O = (l) 69.91 (a) If the above reaction was used in a fuel cell, say, to perform work, what will be the maximum...
(a) A muscle can be thought of as a fuel cell, producing work from the metabolism...
(a) A muscle can be thought of as a fuel cell, producing work from the metabolism of glucose (C6H1206): C6H1206 (glucose) +202(9) + 2H2O(l) + CO2(g). (0.1) Here g and I refer to the gaseous and liquid states, respectively. Using data given in the table, please determine the values of AH and AG for this reaction for one mole of glucose, assuming that the reaction takes place at room temperature and atmospheric pressure. Substance CH 20. (glucose) 0 (9) H200...
General Chemistry II Part II. Fuel efficiency (6 pts) Fuel efficiency is the efficiency of the...
General Chemistry II Part II. Fuel efficiency (6 pts) Fuel efficiency is the efficiency of the conversion of chemical energy contained in a fuel into work. Let's see which one of these fuels (hydrogen gas or liquid propane) will allow us to do more electrical work. Use the thermodynamic data provided to answer the following questions: 1. First determine the amount of heat released in direct combustion of (a) 1 mole of hydrogen gas; (b) 1 mole of liquid propane...
MHE Reader Propane, C3Hs(&), reacts with oxygen gas to produce carbon dioxide gas and water vapor....
MHE Reader Propane, C3Hs(&), reacts with oxygen gas to produce carbon dioxide gas and water vapor. a) b) 2. Write a balanced equation including states of matter for the reaction. If 4.55 g of propane reacts with excess oxygen under standard conditions, calculate the theoretical yields (in grams) for both carbon dioxide and water, and · the total amount of heat released/absorbed when the reaction is complete. c) Ethanol is currently being used as a replenishable fuel alternative/supplement because it...
1. The standard enthalpy change for the combustion of mole of propane is -2043.0 kJ. CH_(g)...
1. The standard enthalpy change for the combustion of mole of propane is -2043.0 kJ. CH_(g) +5 0 (g) →3002(g) + 4H2O(g) Calculate Hº for propane based on the following standard molar enthalpies of formation. molecule CO (9) H2O(g) AH (kJ/mol-rxn) -393.5 -241.8 a. +1407.7 kJ/mol-rxn b. +104.7 kJ/mol-rxn c.-104.7 kJ/mol-rxn d -4190.7 kJ/mol-rxn e. -1407.7 kJ/mol-rxn 2. Which of the following statements is/are CORRECT? 1. If a reaction occurs at constant pressure, 4-AH. 2. The change in energy for...
can you answe both 1 and 2 with all work 1. The Ksp for Ba(103)2 is...
can you answe both 1 and 2 with all work
1. The Ksp for Ba(103)2 is 6.0 x 10-10 at 25°C. What is the solubility of this salt in water in grams per liter. (10 pts) 2. Iron(III) oxide can be reduced by carbon monoxide. Fe,O3(s) + 3CO(g) 2Fe(s) + 3C02(g) Use the following thermodynamic data at 298 K to determine the AGº and the equilibrium constant (Kc) at 350 K. (12 pts) Substance: Fe 0,(s) CO(g) Fe(s) CO(g) AH”...
A) Calculate the net work output per kmol fuel. In your analysis, assume that the fuel is introdu...
A) Calculate the net work output per kmol fuel. In your
analysis, assume that the fuel is introduced as a gas at 298K.
Now consider an Ideal Diesel Cycle that has the same compression
ratio and produces the same net work output as in Problem 1. If the
cycle has a cut-off ratio of 2:
B) Calculate the required heat input per unit mass of air.
C) Find the temperature at each state of the cycle.
Problem 1 (65 pts):...
7. Calculate the maximum non-expansion work per mole that may be obtained from the combustion of methanol at 298 K. (10 pts) 2CH,OH (g) + O2 (g) 2002 (g) + 4H20 (1) CH,OH (g) 0:(8) CO2(g) H20 (1) A, Gº (kJ mol) -161.96 0 -394.36 -273.13
(2) (24 pts) A fuel cell produces electricity via a combustion reaction. A DMFC is a proton-exchange fuel cell that uses methanol CH3OH) as the fuel, which reacts with molecular oxygen to produce carbon dioxide and water. (a) (4 pts) Write the balanced combustion reaction for this methanol fuel cell. (b) (4 pts) Write the balanced half-reactions occurring at the cathode and anode of this fuel cell (assume standard acidic conditions) (e) (4 pts) Evaluate AGº (kJ) and AE° (V)...
(2) (24 pts) A fuel cell produces electricity via a combustion reaction. A DMFC is a proton-exchange fuel cell that uses methanol CH OH() as the fuel, which reacts with molecular oxygen to produce carbon dioxide and water. (a) (4 pts) Write the balanced combustion reaction for this methanol fuel cell (b) (4 pts) Write the balanced half-reactions occurring at the cathode and anode of this fuel cell (assume standard acidic conditions). (c) (4 pts) Evaluate AG° (kJ) and AE...
(a) A muscle can be thought of as a fuel cell, producing work from the metabolism of glucose (C6H1206): C6H1206 (glucose) +202(9) + 2H2O(l) + CO2(g). (0.1) Here g and I refer to the gaseous and liquid states, respectively. Using data given in the table, please determine the values of AH and AG for this reaction for one mole of glucose, assuming that the reaction takes place at room temperature and atmospheric pressure. Substance CH 20. (glucose) 0 (9) H200...
General Chemistry II Part II. Fuel efficiency (6 pts) Fuel efficiency is the efficiency of the conversion of chemical energy contained in a fuel into work. Let's see which one of these fuels (hydrogen gas or liquid propane) will allow us to do more electrical work. Use the thermodynamic data provided to answer the following questions: 1. First determine the amount of heat released in direct combustion of (a) 1 mole of hydrogen gas; (b) 1 mole of liquid propane...
MHE Reader Propane, C3Hs(&), reacts with oxygen gas to produce carbon dioxide gas and water vapor. a) b) 2. Write a balanced equation including states of matter for the reaction. If 4.55 g of propane reacts with excess oxygen under standard conditions, calculate the theoretical yields (in grams) for both carbon dioxide and water, and · the total amount of heat released/absorbed when the reaction is complete. c) Ethanol is currently being used as a replenishable fuel alternative/supplement because it...
1. The standard enthalpy change for the combustion of mole of propane is -2043.0 kJ. CH_(g) +5 0 (g) →3002(g) + 4H2O(g) Calculate Hº for propane based on the following standard molar enthalpies of formation. molecule CO (9) H2O(g) AH (kJ/mol-rxn) -393.5 -241.8 a. +1407.7 kJ/mol-rxn b. +104.7 kJ/mol-rxn c.-104.7 kJ/mol-rxn d -4190.7 kJ/mol-rxn e. -1407.7 kJ/mol-rxn 2. Which of the following statements is/are CORRECT? 1. If a reaction occurs at constant pressure, 4-AH. 2. The change in energy for...
can you answe both 1 and 2 with all work
1. The Ksp for Ba(103)2 is 6.0 x 10-10 at 25°C. What is the solubility of this salt in water in grams per liter. (10 pts) 2. Iron(III) oxide can be reduced by carbon monoxide. Fe,O3(s) + 3CO(g) 2Fe(s) + 3C02(g) Use the following thermodynamic data at 298 K to determine the AGº and the equilibrium constant (Kc) at 350 K. (12 pts) Substance: Fe 0,(s) CO(g) Fe(s) CO(g) AH”...
A) Calculate the net work output per kmol fuel. In your
analysis, assume that the fuel is introduced as a gas at 298K.
Now consider an Ideal Diesel Cycle that has the same compression
ratio and produces the same net work output as in Problem 1. If the
cycle has a cut-off ratio of 2:
B) Calculate the required heat input per unit mass of air.
C) Find the temperature at each state of the cycle.
Problem 1 (65 pts):...
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 25 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 1 hour ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 4 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago