Homework Answers
Add Answer to:
of 47.88cm You have a cube of gold colored beads with a mass of 416.87g and...
A gold colored metal is found to conduct an electric current. Can you say with certainty...
A gold colored metal is found to conduct an electric current. Can you say with certainty that it is gold? Why or why not? No. A gold colored metal could be gold, but it may also be an alloy of gold. No. A gold colored metal could be gold, but it may also be a silver. No. A gold is not a good conductor. Yes. A gold colored metal is gold. b A gold colored metal is found to conduct...
A gold cubehas the edge length x and mass y. the cube is submerged in water...
A gold cubehas the edge length x and mass y. the cube is submerged in water with a density of about 1000 kg/m^3. 1. how much wnergy is needed to raise the cube by a distance of delta y? use x,y,mass and the density of water 2. if the edge lenght is 20 cm and the mass is 25 kg and the water is 1 m deep how much energy is needed to raise the top face of cube to...
Determine the temperature at which a cube of gold 3 nm on a side becomes quantum confined (via the metal to insulator transition). Gold has a density of 19,300 kg per cubic meter and its atomic mass i...
Determine the temperature at which a cube of gold 3 nm on a side becomes quantum confined (via the metal to insulator transition). Gold has a density of 19,300 kg per cubic meter and its atomic mass is 197 g/mol. The Fermi energy of gold is 5.53 eV.
The students in the previous problem (attatched) determine the mass of the metal cube to be...
The students in the previous problem (attatched) determine the
mass of the metal cube to be 21.60 pm.05 gm How should they report
the density of the material?
A group of students is determining the density of a cube of metal. Using a calipers, they measure all three sides of the cube to be 2.000+ .002 cm. What is the volume they calculate, including the uncertainty? Do Expert Answer Anonymous 12 minutes later The length of the side of the...
If the density of aluminum and gold are 2.70 E3 and 193 E3 kg/m^3 respectively. How...
If the density of aluminum and gold are 2.70 E3 and 193 E3 kg/m^3 respectively. How much aluminium by volume would you need in order to have the same weight as a 4.20 kg piece of gold? Number Units If this piece of gold were a cube it would have sides measuring 6.01 cm, What would the sides of the aluminum be if it were also a cube? Number Units
Imagine (quite unrealistically) removing one electron from every atom in a tiny cube of gold 1...
Imagine (quite unrealistically) removing one electron from every atom in a tiny cube of gold 1 mm on a side. (Never mind how you would hold the resulting positively charged cube together.) Do the same thing with another such cube a meter away. What is the repulsive force between the two cubes? How many aircraft carriers would you need in order to have their total weight equal this force? Some data: The density of gold is 19.3 g/cm3, and its...
(10) 14. What is the mass of a gold cube (19.3g/cm^3) that is 23mm on a...
(10) 14. What is the mass of a gold cube (19.3g/cm^3) that is 23mm on a side? 15. What mass of gold (0.126 J/g degree C) requires 26984J of heat to raise the temperature 25.0 degree C?
You have two objects made of the same substance. Object 1 is a cube with a...
You have two objects made of the same substance. Object 1 is a cube with a mass of 465.5 g. You measure the side of the cube using a ruler and find it to be 3.17 cm. Object 2 is a sphere with a mass of 232.8 g. You find the volume of the sphere using water displacement. The volume of the water in a graduated cylinder initially is 120.0 mL, and when the sphere is added the new volume...
A silver cube with an edge length of 2.25 cm and a gold cube with an...
A silver cube with an edge length of 2.25 cm and a gold cube with an edge length of 2.72 cm are both heated to 88.8C and placed in 101.5 mL of water at 19.6'C. What is the final temperature of the water when thermal equilibrium is reached? Substance gold silver water Specific heat (J/g.°C) 0.1256 0.2386 4.184 Density (g/cm) 19.3 10.5 1.00 Tonal 11 'C Using the standard enthalpies of formation, what is the standard enthalpy of reaction? CO(g)...
1. If another group measured the density of a cube made out of the same material...
1. If another group measured the density of a cube made out of the same material as you did, should they come out with the same density? Could you have measured the volume of your cube using volume displacement? 2. 3. Could you have measured the volume of your irregularly shaped object using an equation? If a substance has a density of 1.345 g/mL, how many grams would the substance weigh if the sample 4. has a volume of 22.1...
The students in the previous problem (attatched) determine the
mass of the metal cube to be 21.60 pm.05 gm How should they report
the density of the material?
A group of students is determining the density of a cube of metal. Using a calipers, they measure all three sides of the cube to be 2.000+ .002 cm. What is the volume they calculate, including the uncertainty? Do Expert Answer Anonymous 12 minutes later The length of the side of the...
If the density of aluminum and gold are 2.70 E3 and 193 E3 kg/m^3 respectively. How much aluminium by volume would you need in order to have the same weight as a 4.20 kg piece of gold? Number Units If this piece of gold were a cube it would have sides measuring 6.01 cm, What would the sides of the aluminum be if it were also a cube? Number Units
(10) 14. What is the mass of a gold cube (19.3g/cm^3) that is 23mm on a side? 15. What mass of gold (0.126 J/g degree C) requires 26984J of heat to raise the temperature 25.0 degree C?
You have two objects made of the same substance. Object 1 is a cube with a mass of 465.5 g. You measure the side of the cube using a ruler and find it to be 3.17 cm. Object 2 is a sphere with a mass of 232.8 g. You find the volume of the sphere using water displacement. The volume of the water in a graduated cylinder initially is 120.0 mL, and when the sphere is added the new volume...
A silver cube with an edge length of 2.25 cm and a gold cube with an edge length of 2.72 cm are both heated to 88.8C and placed in 101.5 mL of water at 19.6'C. What is the final temperature of the water when thermal equilibrium is reached? Substance gold silver water Specific heat (J/g.°C) 0.1256 0.2386 4.184 Density (g/cm) 19.3 10.5 1.00 Tonal 11 'C Using the standard enthalpies of formation, what is the standard enthalpy of reaction? CO(g)...
1. If another group measured the density of a cube made out of the same material as you did, should they come out with the same density? Could you have measured the volume of your cube using volume displacement? 2. 3. Could you have measured the volume of your irregularly shaped object using an equation? If a substance has a density of 1.345 g/mL, how many grams would the substance weigh if the sample 4. has a volume of 22.1...
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 10 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 11 hours ago