Homework Answers
Add Answer to:
Click in the answer box to display choices. Classify the following reaction as decomposition (D double-replacement...
1. Classify each of the following as a combination, decomposition, single replacement, double replacement, or combustion...
1. Classify each of the following as a combination,
decomposition, single replacement, double replacement, or
combustion reaction:
_______________
2 Fe2O3(s) + 3 C(s)
3 CO2(g) + 4 Fe(s)
_______________
2 KClO3(s)
2 KCl(s) + 3 O2(g)
_______________
2 C3H6(g) + 9 O2(g)
6 CO2(g) + 6H2O(g) + energy
_______________
N2(g) + 2 O2(g)
2 NO2(g)
_______________
BaCl2(aq) + K2SO4(aq)
BaSO4(s) + 2 KCl(aq)
2. Identify as an oxidation or reduction reaction:
Oxidation
Reduction
O2 + 4 e-
2...
Classify each of the following as a combination, decomposition, single replacement, double replacement, or combustion reaction:...
Classify each of the following as a combination, decomposition, single replacement, double replacement, or combustion reaction: Part A 4Fe(s)+3O2(g)→2Fe2O3(s) combination, decomposition, single replacement, double replacement, or combustion Part B 2Al(s)+3CuCl2(aq)→2AlCl3(aq)+3Cu(s) combination decomposition single replacement double replacement combustion Part C ZnCO3(s)⟶ΔCO2(g)+ZnO(s) combination decomposition single replacement double replacement combustion Part D CuCl2(aq)+2KOH(aq)→Cu(OH)2(s)+2KCl(aq) combination decomposition single replacement double replacement combustion Part E C3H8(g)+5O2(g)⟶Δ3CO2(g)+4H2O(g) combination decomposition single replacement double replacement combustion
Part A Classify each of the following as a combination, decomposition, single replacement, double replacement, or...
Part A Classify each of the following as a combination, decomposition, single replacement, double replacement, or combustion reaction. Sort these reactions into the proper categories. AgNO3(aq) + NaCl(aq) AgCl(s) + NaNO3(aq) +. 2C6H6(1) + 1502 (g) 4. 12CO2(g) + 6H2O(g) Zn(s) + H2SO4(aq) ZnSO4(aq) + H2(g) 2H2O2 (aq) + 2H2O(1) + O2(g) H2(g) + Br2(g) → 2HBr(g) Combination Decomposition Single replacement Double replacement Combustion
Balance the reaction and classify it as a combination, decomposition, single replacement or double replacement. Na(s)...
Balance the reaction and classify it as a combination, decomposition, single replacement or double replacement. Na(s) + H2O(l) -> NaOH(aq) + H2(g)
- Part A Classify each of the following as a combination, decomposition, single replacement, double replacement,...
- Part A Classify each of the following as a combination, decomposition, single replacement, double replacement, or combustion reaction: Sort these reactions into the proper categories. CuO(s) + 2HCl(aq) → CuCl2(aq) + H2O(l) C6H12O6(aq) + 2C2H6O(aq) + 2CO2(g) Fe3O4(s) + 4C(s) + 3Fe(s) + 4CO(g) 2C2H2(g) + 502 (9) 4 4C02(g) + 2H2O(g) 2Fe(s) + 3Cl2(g) + 2FeCl3(s) Combination Decomposition Single replacement Double replacement Combustion
Balance and classify the following reactions: combination (C), decomposition (D), single replacement (SR), double replacement (DR)...
Balance and classify the following reactions: combination (C), decomposition (D), single replacement (SR), double replacement (DR) or combustion (CB). ____H2O2 (l) → ____H2O (l) + ____O2 (g)
Balance the following reactions and then classify the reactions as combination, decomposition (D), single replacement (S...
Balance the following reactions and then classify the reactions as combination, decomposition (D), single replacement (SR), double replacement (DR), or neither. a) CaBr2(aq) + K3PO4(aq)-->Ca3(PO4 )2(s) + KBr(aq) b) Li(s) + O2(g)--> Li2O(s) c) CH4(g) + O2(g)--->CO2(g) + H2O(g) d) AgBr(s)-->Ag(s) + Br2 (l) e) Na2CO3(aq) + HNO3(aq)---> CO2(g) + H2O(g) + NaNO3(aq)
1. Balance and classify the following reactions: combination (C), decomposition (D), single replacement (SR), double replacement...
1. Balance and classify the following reactions: combination (C), decomposition (D), single replacement (SR), double replacement (DR) or combustion (CB). a. ____C3H8 (g) + ____O2 (g) → ____CO2 (g) + ____H2O (l) b. ____K (s) + ____H2O (l) → ____KOH (aq) + ___H2 (g) c. ____MgSO4 (aq) + ____Na2CO3 (aq) → ____MgCO3 (s) + ____Na2SO4 (aq) d. ____Cl2 (g) + ____NaI (s) → ____NaCl (s) + ____I2 (s) e. . ____NaNO3 (s) → ____NaNO2 (s) + ____O2 (g) f. ____H2 (g)...
check my work type of reaction options are combination, decomposition, single replacement, or double replacement. Experiment...
check my work type of reaction
options are combination, decomposition, single
replacement, or double replacement.
Experiment 8 PRE-LAB QUESTIONS For each of the reactions below, classify as a combination, decomposition, single replacement, or double replacement. 1. Ca(s) + Cl (g) - CaCl (s) 2. 2Cu(s) + 0,8) — 2CuO(s) 3. Ca(NO),(aq) + H SO. (aq) - 2HNO (aq) + Caso (s) 4. NH,(aq) + HCl(aq) — NH Cl(aq) 5. Hg(NO3),(aq) + 2Nal(aq) — HgI_(s) + 2NaNO,(aq) Combination Combination Double replacement...
5.44 Classify each reaction as combination, decomposition, single replacement, or double replacement. a. 2 Al +...
5.44 Classify each reaction as combination, decomposition, single replacement, or double replacement. a. 2 Al + 6 HCI — 2 AlCl3 + 3 H, b. H.S04 - SO3 + H2O c. H2SO4 + 2 NaOH -- Na, SO4 + 2 H2O d. 2 Ca + 0,42 Cao
1. Classify each of the following as a combination,
decomposition, single replacement, double replacement, or
combustion reaction:
_______________
2 Fe2O3(s) + 3 C(s)
3 CO2(g) + 4 Fe(s)
_______________
2 KClO3(s)
2 KCl(s) + 3 O2(g)
_______________
2 C3H6(g) + 9 O2(g)
6 CO2(g) + 6H2O(g) + energy
_______________
N2(g) + 2 O2(g)
2 NO2(g)
_______________
BaCl2(aq) + K2SO4(aq)
BaSO4(s) + 2 KCl(aq)
2. Identify as an oxidation or reduction reaction:
Oxidation
Reduction
O2 + 4 e-
2...
Part A Classify each of the following as a combination, decomposition, single replacement, double replacement, or combustion reaction. Sort these reactions into the proper categories. AgNO3(aq) + NaCl(aq) AgCl(s) + NaNO3(aq) +. 2C6H6(1) + 1502 (g) 4. 12CO2(g) + 6H2O(g) Zn(s) + H2SO4(aq) ZnSO4(aq) + H2(g) 2H2O2 (aq) + 2H2O(1) + O2(g) H2(g) + Br2(g) → 2HBr(g) Combination Decomposition Single replacement Double replacement Combustion
- Part A Classify each of the following as a combination, decomposition, single replacement, double replacement, or combustion reaction: Sort these reactions into the proper categories. CuO(s) + 2HCl(aq) → CuCl2(aq) + H2O(l) C6H12O6(aq) + 2C2H6O(aq) + 2CO2(g) Fe3O4(s) + 4C(s) + 3Fe(s) + 4CO(g) 2C2H2(g) + 502 (9) 4 4C02(g) + 2H2O(g) 2Fe(s) + 3Cl2(g) + 2FeCl3(s) Combination Decomposition Single replacement Double replacement Combustion
check my work type of reaction
options are combination, decomposition, single
replacement, or double replacement.
Experiment 8 PRE-LAB QUESTIONS For each of the reactions below, classify as a combination, decomposition, single replacement, or double replacement. 1. Ca(s) + Cl (g) - CaCl (s) 2. 2Cu(s) + 0,8) — 2CuO(s) 3. Ca(NO),(aq) + H SO. (aq) - 2HNO (aq) + Caso (s) 4. NH,(aq) + HCl(aq) — NH Cl(aq) 5. Hg(NO3),(aq) + 2Nal(aq) — HgI_(s) + 2NaNO,(aq) Combination Combination Double replacement...
5.44 Classify each reaction as combination, decomposition, single replacement, or double replacement. a. 2 Al + 6 HCI — 2 AlCl3 + 3 H, b. H.S04 - SO3 + H2O c. H2SO4 + 2 NaOH -- Na, SO4 + 2 H2O d. 2 Ca + 0,42 Cao
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 minutes ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 24 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago