Homework Answers
Add Answer to:
6. The foul odor of rancid butter is caused by butanoic acid. (a) Write its condensed...
Butanoic acid has an acrid taste and a terribly unpleasant odor. It is found in rancid...
Butanoic acid has an acrid taste and a terribly unpleasant odor. It is found in rancid butter and Parmesan cheese. In aqeuous solution, butanoic acid undergoes the reversible reaction shown. Label the conjugate acid-base pairs. H H H o H-C-C-C-O-OH + H20 _!_! I H H H 0 H-C-C-C-0-0 : +H30* HHH HHH Butanoic acid water Butanoate ion Hydronium ion Answer Bank conjugate acid conjugate base base acid Which species are present at equilibrium? O water butanoate ion butanoic acid...
1)Butanoic acid has an acrid taste and a terribly unpleasant odor. It is found in rancid...
1)Butanoic acid has an acrid
taste and a terribly unpleasant odor. It is found in rancid butter
and Parmesan cheese. In aqeuous solution, butanoic acid undergoes
the reversible reaction shown.
Label the conjugate
acid–base pairs.
Answer Bank
conjugate base
conjugate acid
acid
base
2)Which species are present at
equilibrium?
butanoate ion
water
hydronium ion
butanoic acid
Label the conjugate acid-base pairs. H H H 0 H H H ** H-6-6-6——OH + H20 I-0-I H-6-6-6-6—0: +H30* HA HH Butanoic acid water...
Carboxylic Acids and Esters B. Esters 1. Use condensed structural formulas to write the equation for...
Carboxylic Acids and Esters B. Esters 1. Use condensed structural formulas to write the equation for the formato methyl acetate. equation for the formation of 4. Condensed Structural Formula and Name of Ester 2. Alcohol and Carboxylie 3. Odor of Acid Ester A. Methanol and salicylic acid B. 1-Pentanol and acetic acid C. 1-Octanol and acetic acid D. Benzyl alcohol and acetic acid E. 1-Propanol and acetic acid
4. Name the functional group that links two monosaccharides in a disaccharide. Would that be the ...
4. Name the functional group that links two monosaccharides in a disaccharide. Would that be the same kind of functional group linking monosaccharides in long-chain polysaccharides like amylose? Postlab Questions 1a) Formic acid or methanoic acid is completely soluble in water. Draw the secondary interaction of formic acid and water molecules. Be sure to specify what interaction takes place (e e dipole-dipole bond etc) n sodium hydroxide, NaoH is added to formic acid, the pH raised to 12. What happened...
Experiment #6 Ester Synthesis PRE-LAB ASSIGNMENT This pre-lab assignment is worth 5 points for this Experiment...
Experiment #6 Ester Synthesis PRE-LAB ASSIGNMENT This pre-lab assignment is worth 5 points for this Experiment and should be completed on a separate page and turned in at the beginning of lab. 1. Read the experiment carefully 2. Safety Considerations: Summarize O safety and health hazards for working with glacial acetic acid, butanoic acid and petroleum ether. 3. Procedure: Summarize the procedure using a bullet list. Assume you are summarizing the procedure to a fully qualified chemist, i.e. don't include...
6) Linalool (IUPAC name 3,7 -dimethylocta-1,6-dien-3 -ol) is a naturally occurring terpene alcohol found in many...
6) Linalool (IUPAC name 3,7 -dimethylocta-1,6-dien-3 -ol) is a naturally occurring terpene alcohol found in many flowers and spice plants with many commercial applications, the majority of which are based on its pleasant scent (floral, with a touch of spiciness). When esterified with butanoic acid, the product often has a "peachy" smell. Use condensed structures to show the acid catalyzed condensation reaction that would produce linayl butanoate belovw 7) Offering a troubled house guest a hot beverage is a well-established...
write the con Chapter 16 Carboxylic Acids and Esters Name: 1) Write the condense structural formulas...
write the con
Chapter 16 Carboxylic Acids and Esters Name: 1) Write the condense structural formulas of the following compounds: Date: 3 methylpentanoic acid p-ethylbenzoic acid 4 m-hydroxylhexanoic acid 2) Which of the following compounds has the higher boiling point: butane, butanol, butanoic acid, and methyl ethanoate? Briefly explain why. 3) From the compounds of previous question, which is more soluble in water? Briefly explain why 4) Give the name of the carboxylic acid and alcohol used to prepare the...
2) Which of the following compounds has the higher boiling point: butane, butanol, butanoic acid, and...
2) Which of the following compounds has the higher boiling point: butane, butanol, butanoic acid, and methyl ethanoate? Briefly explain why. Batanoic acold Because of molecula weight and long a strong hydrogen bonding 3) From the compounds of previous question, which is more soluble in water? Briefly explain why. 4) Give the name of the carboxylic acid and alcohol used to prepare the ester methyl benzoate - Esterification 5) Write the reaction of acid hydrolysis between methyl ethanoate and water.
1-6 were the esters made. im confused how to write their structural formulas for each ....
1-6
were the esters made. im confused how to write their structural
formulas for each
. Using structural formulas, write chemical equa- ions to represent the formation of each ester you made. Label the structural formula of each ester with he name of the ester. Some esters and their characteristic odors Table 1 formed from: alcohol acid ester odor ethyl aloohol acetic acid nail polish remover ethyl acetate butyric acid ethyl alcohol ethyl butyrate pineapple methyl salicylate methyl alcohol salicylic...
use condensed structural formulas to write the balance equation for the reaction of salicylic acid with...
use condensed structural formulas to write the balance
equation for the reaction of salicylic acid with acetic
anhydride.
Use the models to demonstrate the reaction
use condensed structural formulas to write the balance
equation for the reaction of salicylic acid with methanol.
Use the models to demonstrate the reaction
Describe the appearance of aspirin product
REPORT SHEET: ASPIRIN Name Partner(s) Date Section Instructor A. Molecular models Use condensed Ne condensed structural formulas to write the balanced equation for the reaction...
Butanoic acid has an acrid taste and a terribly unpleasant odor. It is found in rancid butter and Parmesan cheese. In aqeuous solution, butanoic acid undergoes the reversible reaction shown. Label the conjugate acid-base pairs. H H H o H-C-C-C-O-OH + H20 _!_! I H H H 0 H-C-C-C-0-0 : +H30* HHH HHH Butanoic acid water Butanoate ion Hydronium ion Answer Bank conjugate acid conjugate base base acid Which species are present at equilibrium? O water butanoate ion butanoic acid...
1)Butanoic acid has an acrid
taste and a terribly unpleasant odor. It is found in rancid butter
and Parmesan cheese. In aqeuous solution, butanoic acid undergoes
the reversible reaction shown.
Label the conjugate
acid–base pairs.
Answer Bank
conjugate base
conjugate acid
acid
base
2)Which species are present at
equilibrium?
butanoate ion
water
hydronium ion
butanoic acid
Label the conjugate acid-base pairs. H H H 0 H H H ** H-6-6-6——OH + H20 I-0-I H-6-6-6-6—0: +H30* HA HH Butanoic acid water...
Carboxylic Acids and Esters B. Esters 1. Use condensed structural formulas to write the equation for the formato methyl acetate. equation for the formation of 4. Condensed Structural Formula and Name of Ester 2. Alcohol and Carboxylie 3. Odor of Acid Ester A. Methanol and salicylic acid B. 1-Pentanol and acetic acid C. 1-Octanol and acetic acid D. Benzyl alcohol and acetic acid E. 1-Propanol and acetic acid
4. Name the functional group that links two monosaccharides in a disaccharide. Would that be the same kind of functional group linking monosaccharides in long-chain polysaccharides like amylose? Postlab Questions 1a) Formic acid or methanoic acid is completely soluble in water. Draw the secondary interaction of formic acid and water molecules. Be sure to specify what interaction takes place (e e dipole-dipole bond etc) n sodium hydroxide, NaoH is added to formic acid, the pH raised to 12. What happened...
Experiment #6 Ester Synthesis PRE-LAB ASSIGNMENT This pre-lab assignment is worth 5 points for this Experiment and should be completed on a separate page and turned in at the beginning of lab. 1. Read the experiment carefully 2. Safety Considerations: Summarize O safety and health hazards for working with glacial acetic acid, butanoic acid and petroleum ether. 3. Procedure: Summarize the procedure using a bullet list. Assume you are summarizing the procedure to a fully qualified chemist, i.e. don't include...
6) Linalool (IUPAC name 3,7 -dimethylocta-1,6-dien-3 -ol) is a naturally occurring terpene alcohol found in many flowers and spice plants with many commercial applications, the majority of which are based on its pleasant scent (floral, with a touch of spiciness). When esterified with butanoic acid, the product often has a "peachy" smell. Use condensed structures to show the acid catalyzed condensation reaction that would produce linayl butanoate belovw 7) Offering a troubled house guest a hot beverage is a well-established...
write the con
Chapter 16 Carboxylic Acids and Esters Name: 1) Write the condense structural formulas of the following compounds: Date: 3 methylpentanoic acid p-ethylbenzoic acid 4 m-hydroxylhexanoic acid 2) Which of the following compounds has the higher boiling point: butane, butanol, butanoic acid, and methyl ethanoate? Briefly explain why. 3) From the compounds of previous question, which is more soluble in water? Briefly explain why 4) Give the name of the carboxylic acid and alcohol used to prepare the...
2) Which of the following compounds has the higher boiling point: butane, butanol, butanoic acid, and methyl ethanoate? Briefly explain why. Batanoic acold Because of molecula weight and long a strong hydrogen bonding 3) From the compounds of previous question, which is more soluble in water? Briefly explain why. 4) Give the name of the carboxylic acid and alcohol used to prepare the ester methyl benzoate - Esterification 5) Write the reaction of acid hydrolysis between methyl ethanoate and water.
1-6
were the esters made. im confused how to write their structural
formulas for each
. Using structural formulas, write chemical equa- ions to represent the formation of each ester you made. Label the structural formula of each ester with he name of the ester. Some esters and their characteristic odors Table 1 formed from: alcohol acid ester odor ethyl aloohol acetic acid nail polish remover ethyl acetate butyric acid ethyl alcohol ethyl butyrate pineapple methyl salicylate methyl alcohol salicylic...
use condensed structural formulas to write the balance
equation for the reaction of salicylic acid with acetic
anhydride.
Use the models to demonstrate the reaction
use condensed structural formulas to write the balance
equation for the reaction of salicylic acid with methanol.
Use the models to demonstrate the reaction
Describe the appearance of aspirin product
REPORT SHEET: ASPIRIN Name Partner(s) Date Section Instructor A. Molecular models Use condensed Ne condensed structural formulas to write the balanced equation for the reaction...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 9 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 59 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago