Homework Answers
Add Answer to:
17. What is true about this equilibrium? 0 0 0 Dan A) It lies to the...
please answer the following 15. Consider the MAJOR product outcomes when 8 reacts with Nal vs....
please answer the following
15. Consider the MAJOR product outcomes when 8 reacts with Nal vs. NaOH. Select the correct outcomes from the table. (Hint 1: for both Sn2 and E2 leaving group must be axial; for E2, the B-hydrogen must be 180° away from leaving group). (Hint 2: For 2 RX substrates, products depend on conjugate acid; i.e.strong acids have weak conj. bases compare to problem #20, 21). 8+ Nal yields products with --- ? 8 + NaOH yields...
11) Indicate whether the statement about nucleophilicity is or True or False: a) A species with a...
11) Indicate whether the statement about nucleophilicity is or True or False: a) A species with a negative charge is a stronger nucleophile than a similar neutral species. (True / False) b) In particular, a base is a stronger nucleophile than its conjugate acid. (True / False) c) Nucleophilicity decreases from left to right in the periodic table, following the increase in electronegativity from left to right. (True / False) d) The more electronegative elements have more tightly held nonbonding electrons...
Answer true or false. 1. Atoms that lose electrons to achieve a filled valence shell become...
Answer true or false. 1. Atoms that lose electrons to achieve a filled valence shell become cations and form ionic bonds with anions. 2. Ionic bonds tend to form between elements on the left side of the Periodic Table, and covalent bonds tend to form between elements on the right side of the Periodic Table. 3. Electronegativity is a measure of an atom's attraction for the electrons it shares in a chemical bond with another atom. 4. Fluorine, in the...
7. Which statement is true about the acid/base equilibrium reaction? ASH OH (A) The right side...
7. Which statement is true about the acid/base equilibrium reaction? ASH OH (A) The right side is favored because the base on the right side is the stronger of the two bases. (B) The right side is favored because the base on the right side is more stable. (C) The left side is favored because the base on the left side is weaker. (D) The right side is favored because we always draw reactions such that the right side is...
3. Electronegativity (the ability of an atom to pull electrons toward itself in a chemical bond) and Ionization Ene...
3. Electronegativity (the ability of an atom to pull electrons toward itself in a chemical bond) and Ionization Energy (the amount of energy required to remove an electron from an atom) have the same trend on the periodic table. The largest electronegativities and ionization energies are found in the region of the periodic table. Report the letter (A, B, C, etc) of your answer in the space beside the question number. A. upper left B. upper right C. lower left...
Classify each statement about effective nuclear charge, Zeff, as true or false. True False Effective nuclear...
Classify each statement about effective nuclear charge, Zeff, as true or false. True False Effective nuclear charge is dependent on the number of electrons present in an atom. In a N atom, a ls electron has a greater Zer than a 2s electron. Electrons in a p orbital are more effective than those in other orbitals at shielding other electrons from the nuclear charge. Als electron in a B atom has a smaller Zeff than a ls electron in a...
Which of the following about equilibrium constant of a reaction are true. It can change if...
Which of the following about equilibrium constant of a reaction are true. It can change if the concentration of reactants and products are changed. It can be used to calculate the biochemical standard free energy change (Delta G degree). It can be used to calculate the actual free energy change (Delta G). It is the same as the mass action ratio (Q) when the reaction is in equilibrium. It is always a constant regardless of temperature change. Which of these...
Please answer ALL of the following questions!!! Thanks!!! And please briefly explain how you got the...
Please answer ALL of the following questions!!!
Thanks!!! And please briefly explain how you got the answer to each
question.
1)
2)
3)
4)
5)
6)
7)
8)
9)
10)
11)
12)
13)
14)
15)
16)
17)
18)
The trend for electronegativity values decreases A. Down a group and left to right across a period B. Up a group and left to right across a period Down a group and right to left across a period D.Up a group and...
please i need quick help these questions are due so soon and i dont know the answers please help me thanks . Que...
please i need quick help these questions are due so soon and i
dont know the answers please help me thanks .
Question Completion Status: QUESTION Consider the following acid-base reaction. Equilibrium for this reaction lies to the: OH H-CEC + H-CEC-H + A. right. B. Equilibrium favors neither forward nor reverse reaction. O C. left. D. It cannot be determined. QUESTION 2 Does the equilibrium of this reaction lie to the left or right? BF OH BF3 + A,...
Classify each statement about effective nuclear charge, Zeff, as true or false Effective nuclear charge is...
Classify each statement about effective nuclear charge, Zeff, as true or false Effective nuclear charge is dependent on the number of electrons present in the atom In a Be atom, a 1s electron has a greater Zeff than a 2s electron Across a period, as Zeff increases atomic size decreases Electrons in a p orbital are more effective than those in other orbitals at shielding other electrons from the nuclear charge A 1s electron in a Be atom has a...
please answer the following
15. Consider the MAJOR product outcomes when 8 reacts with Nal vs. NaOH. Select the correct outcomes from the table. (Hint 1: for both Sn2 and E2 leaving group must be axial; for E2, the B-hydrogen must be 180° away from leaving group). (Hint 2: For 2 RX substrates, products depend on conjugate acid; i.e.strong acids have weak conj. bases compare to problem #20, 21). 8+ Nal yields products with --- ? 8 + NaOH yields...
7. Which statement is true about the acid/base equilibrium reaction? ASH OH (A) The right side is favored because the base on the right side is the stronger of the two bases. (B) The right side is favored because the base on the right side is more stable. (C) The left side is favored because the base on the left side is weaker. (D) The right side is favored because we always draw reactions such that the right side is...
3. Electronegativity (the ability of an atom to pull electrons toward itself in a chemical bond) and Ionization Energy (the amount of energy required to remove an electron from an atom) have the same trend on the periodic table. The largest electronegativities and ionization energies are found in the region of the periodic table. Report the letter (A, B, C, etc) of your answer in the space beside the question number. A. upper left B. upper right C. lower left...
Classify each statement about effective nuclear charge, Zeff, as true or false. True False Effective nuclear charge is dependent on the number of electrons present in an atom. In a N atom, a ls electron has a greater Zer than a 2s electron. Electrons in a p orbital are more effective than those in other orbitals at shielding other electrons from the nuclear charge. Als electron in a B atom has a smaller Zeff than a ls electron in a...
Which of the following about equilibrium constant of a reaction are true. It can change if the concentration of reactants and products are changed. It can be used to calculate the biochemical standard free energy change (Delta G degree). It can be used to calculate the actual free energy change (Delta G). It is the same as the mass action ratio (Q) when the reaction is in equilibrium. It is always a constant regardless of temperature change. Which of these...
Please answer ALL of the following questions!!!
Thanks!!! And please briefly explain how you got the answer to each
question.
1)
2)
3)
4)
5)
6)
7)
8)
9)
10)
11)
12)
13)
14)
15)
16)
17)
18)
The trend for electronegativity values decreases A. Down a group and left to right across a period B. Up a group and left to right across a period Down a group and right to left across a period D.Up a group and...
please i need quick help these questions are due so soon and i
dont know the answers please help me thanks .
Question Completion Status: QUESTION Consider the following acid-base reaction. Equilibrium for this reaction lies to the: OH H-CEC + H-CEC-H + A. right. B. Equilibrium favors neither forward nor reverse reaction. O C. left. D. It cannot be determined. QUESTION 2 Does the equilibrium of this reaction lie to the left or right? BF OH BF3 + A,...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 34 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago