Which of the following compounds is consistent with an M** peak at 73 m/z ratio? a....
3/26/2020 Name! 1. Which of the m/z values correspond to the molecular ion for the following compound? a. 18 b. 82 C 102 d. 103 2. Which of the m/z values correspond to the molecular ion peak in the following mass spectrum? 100- Intensity miz a. 45 c. d. 29 15 3. Which of the following will produce an M** and an (M+2)** of the same intensity? a. Nitrogen b. Chlorine c. Bromine d. lodine 4. Which of the following...
Question 5 (2 points) For which of the following compounds will the M+2 peak intensity be equal to the intensity of the molecular ion peak M? a) CH3CH2CH OH 0 b) CHỊCH CHANH, Oc) CH3CH2CH_Br d) CH,CH2CH2C1 Question 6 (2 points) What is the product of the reaction below? "OH PCC o OH O OH TV a) Obiy c)
3.6: Which of the following compounds can exist as cis–trans isomers? Draw each cis–trans pair. (a) CH3CH=CH2 (b) (CH3)2C=CHCH3 (c) ClCH=CHCl (d) CH3CH2CH=CHCH3 (e) CH3CH2CH=C(Br)CH3 (f) 3-Methylhept-3-ene The answer is c, d, e ,f but I'm not sure how it works
1) Name each of the following organic compounds: (a-b-c-e-f-g-j-k-I-m-n) a) CH3CH2CH2CH3 j) CH3CHBOCHBrCH3 b) CH3CH2CH2C(CH3)3 c) CH2=CHCH2CH2CH3 d) CH3CHCICH(CH3)2 k) CH2BrCH(CH3)CHCICH2CH3 1) CH2CH(OH)CH(CH3)2 m) (CH3)2CHCHO n) CH3CH2CH2COCH3 e) (CH3)2C(OH)CH2CH3 f) CH3CHO o) (CH3)2CHCOOH p) CH3CH2CN g) CH3CH2COCH2CH3 h) CH3CH2COOH 9) CH3CHBCH(OH)CH3 i) CH3CH(OH)CH2CHO r) CH3COCH(CH3)CHBCH3
5. Indicate whether the following compounds are cis-, trans, E or Z isomers and write their names 2 x 2= 4 marks a) CH2CH3 CH3 - CH2 - C=C-CH2CH2CH3 ... CH3CI b) CH3 - C = C- CH3 / CI CI
1. Which is the formula for an alkyne? a. CH3CH2CCH2 b. CH3CH2CH2CH3 C. CH3CH2CCH d. CH3CH2CCH2 2. Which of the following compounds is not possible? a. Brb. Bi C. Brd . BI, Br 3. What is the correct classification for the alcohol shown? CH3-CH=CH-CH-CH2 Сн,ОН a. Primary b. Secondary c. Tertiary d. Quaternary 4. Which of the following compounds is correctly classified as a tertiary alcohol? a. 3-methyl-1-butanol b. 2-methyl-1-butanol c. 3-methyl-2-butanol d. 2-methyl-2-butanol 5. Which of the following compounds...
Which of the following compounds will have the (M+2)** peak intensity being equal to that of M** ? NH2 CI OH Br a) b) d)
For each of the following compounds, draw its isomeric pair that represents a chain, positional and functional group isomerism: CH3CH2CH=CH2 CH3CH(CH3)CH(CH3)CH CH:CHCH:CHCH2OH (b) (c) 10. (a) Draw all posibble isomers of compound with the molecular formula C4H100 and identify the types of isomerism present.
IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i. a. CH3CH2CHCH2CHCH2CH2CH3 CH3 CH2CH3 CH2CH3 CH3 b. CH3CH2CCH_CH2CHCHCH2CH2CH3 CH2CH3 CH2CH3 C. CH3CH,CH,C(CH3)2C(CH3)2CH2CH3 d. CH3CH2C(CH2CH3)2CH(CH3)CH(CH2CH2CH3)2 e. (CH3CH2),CCH(CH3)CH2CH2CH3 f. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3 g. (CH2CH2CH2)4C more on mo .
53) What alkene is formed in greatest yield in the following Hofmann elimination? он CH3 CH3 CH 3CH2CH2N CCH3? CH3 CH3 lheat A) CH3CH2CH-CH2 B) CH3CH2C=CH2 CH3 C) CH3-C-CH3 CH2 D) CH3CHCH CH2 CH3 E) CH3CH-CH2 54) What is the product of the following reaction sequence? (CH3)2Culi Ho C CCH CCH CH2OH C CCHCH CH OH IIL. CH,OCH,CH,