Homework Answers
Add Answer to:
mult help
In the oxidation-reduction reaction, 3Fe_3 O_4 + 8Al rightarrow 4Al_2 O_3 + 9Fe 1)...
RODOX EXAMINATION An oxidation-reduction reaction involves the (1) sharing of electrons &n
RODOX EXAMINATION An oxidation-reduction reaction involves the (1) sharing of electrons (3) transfer of electrons (2) sharing of protons (4) transfer of protons In this reaction, CO→ 2 CO + O2 the oxidation number of carbon changes from: (1) 0 to +4 (3) +3 to 0 (2) +2 to +4 (4) +4 to +2 Which balanced equation represents a redox reaction? AgNO3 (aq) +NaCl (aq) →AgCl (s) +NaNO3 (aq) H2CO3 (aq)...
1.Oxidation is defined as the ___ of electrons, while reduction is the ____ of electrons. fill...
1.Oxidation is defined as the ___ of electrons, while reduction is the ____ of electrons. fill in the blanks. 2. Consider the reaction 2Mg + O2 --> 2MgO, what is oxidized and what is reduced? 3. Consider the reaction 2Fe3+ + Sn2+ --> 2 Fe2+ + Sn 4+ what is oxidized and what is reduced? 4. What is a mnemonic to help you remember oxidation & reduction?
Name Chapter 4 Classwork Part 2 Chemical Reactions 1. In the following redox reaction, identify the oxidation and r...
Name Chapter 4 Classwork Part 2 Chemical Reactions 1. In the following redox reaction, identify the oxidation and reduction half-reactions. Which element is oxidized and which element is reduced? 4NH,+3Ca(CI)2N2+6H2O+3CaCl 2. The oxidation number of N in NaNO, is 3. The oxidation number of S in K2SO, is 4. The oxidation number of Mn in KMnO4 is 5. The oxidation number of Fe in KaFe(CN)s is 6. The oxidation number of Cr in CrO is 7. The oxidation number of...
oxidation question - please help me fill out all the blanks Question 3 6 pts When...
oxidation question - please help me fill out all the blanks
Question 3 6 pts When answering this question: • For the element being oxidized or reduced: use the standard abbreviation for elements (e.g. F for fluorine, Fe for iron), using the correct upper case or lower case letters. You are being asked for the element of an oxidized/reduced atom, not the name or formula for a molecule. Give oxidation numbers in the format such as "+1", "-2", "O" etc....
When a substance is oxidized, it electrons and its oxidation number When a substance is reduced,...
When a substance is oxidized, it electrons and its oxidation number When a substance is reduced, it electrons and its oxidation number Determine the oxidation number of each clement in: HCIO_4 C-2O_4^2- In each of the following redox reactions, determine which element is oxidized and which is reduced. Cl_2 (aq) + 2 I (aq) rightarrow I_2 (aq) + 2 Cl' (aq) Fe_2O_3 (s) + 3 CO (g)rightarrow 2 Fe (s) + 3 CO_2 (g) Write balanced molecular and net ionic...
4. (6 pts.) Oxidation-Reduction Reactions: write out two ways you can identify the species that has...
4. (6 pts.) Oxidation-Reduction Reactions: write out two ways you can identify the species that has been oxidized in a redox reaction: b. Identify the element reduced and the element oxidized in the following oxidation- reduction reactions. Fe(s) + CuCl2(aq) FeCl2(aq) + Cu(s) Element Oxidized: Element Reduced: C(s) + O2(g) → C02(g) Element Oxidized: Element Reduced:
#15 Assign oxidation states to al the elements In this unbalanced reaction: Ag^+(aq) + Cu(s) rightarrow...
#15
Assign oxidation states to al the elements In this unbalanced reaction: Ag^+(aq) + Cu(s) rightarrow Ag(s) + Cu^2+ (aq) Which substance gets oxidized? Ag^+(aq) Cu(s) Ag(s) Cu^2+(aq) Which substance gets reduced? Balance the redox reaction: Ag^+(aq) Cu(s) Ag(s) Cu^2+(aq)
Chem 2A: Oxidation Numbers, Oxidation/Reduction rium 1. Determine the oxidation number of chlorine in the f...
Chem 2A: Oxidation Numbers, Oxidation/Reduction rium 1. Determine the oxidation number of chlorine in the following: a) Cl b) C c) CIO d) MgCl e) ClO ) KCIO g) HCI h) NaCIO 2. Write a balanced, chemical equation for the reaction that occurs between aluminum and hydrochloric acid. Write the total and net ionic equation. b) Using the net ionic equation, determine the oxidation number on each reactant and product. Write them underneath the formulas. Determine who is oxidized/reduced. c)...
2. This chemical reaction is an oxidation reduction reaction. a. What is being oxidized in this...
2. This chemical reaction is an oxidation reduction reaction. a. What is being oxidized in this reaction? b. What is being reduced in this reaction? c. What is the oxidizing agent?
2. Oxidation and Reduction: Answer the following questions by circling the appropriate choice. [A] A substance...
2. Oxidation and Reduction: Answer the following questions by circling the appropriate choice. [A] A substance is oxidized when it... gains electrons loses electrons [B] A substance is reduced when it... gains electrons loses electrons (C) In this reaction, identify which reactant was oxidized and which product was reduced. 2 Fe2O3 + 3 S→ 4 Fe + 3 SO2 3. Energy Diagrams: Using the axes below, draw an energy diagram for an endothermic reaction. Label the following in your diagram:...
Name Chapter 4 Classwork Part 2 Chemical Reactions 1. In the following redox reaction, identify the oxidation and reduction half-reactions. Which element is oxidized and which element is reduced? 4NH,+3Ca(CI)2N2+6H2O+3CaCl 2. The oxidation number of N in NaNO, is 3. The oxidation number of S in K2SO, is 4. The oxidation number of Mn in KMnO4 is 5. The oxidation number of Fe in KaFe(CN)s is 6. The oxidation number of Cr in CrO is 7. The oxidation number of...
oxidation question - please help me fill out all the blanks
Question 3 6 pts When answering this question: • For the element being oxidized or reduced: use the standard abbreviation for elements (e.g. F for fluorine, Fe for iron), using the correct upper case or lower case letters. You are being asked for the element of an oxidized/reduced atom, not the name or formula for a molecule. Give oxidation numbers in the format such as "+1", "-2", "O" etc....
When a substance is oxidized, it electrons and its oxidation number When a substance is reduced, it electrons and its oxidation number Determine the oxidation number of each clement in: HCIO_4 C-2O_4^2- In each of the following redox reactions, determine which element is oxidized and which is reduced. Cl_2 (aq) + 2 I (aq) rightarrow I_2 (aq) + 2 Cl' (aq) Fe_2O_3 (s) + 3 CO (g)rightarrow 2 Fe (s) + 3 CO_2 (g) Write balanced molecular and net ionic...
4. (6 pts.) Oxidation-Reduction Reactions: write out two ways you can identify the species that has been oxidized in a redox reaction: b. Identify the element reduced and the element oxidized in the following oxidation- reduction reactions. Fe(s) + CuCl2(aq) FeCl2(aq) + Cu(s) Element Oxidized: Element Reduced: C(s) + O2(g) → C02(g) Element Oxidized: Element Reduced:
#15
Assign oxidation states to al the elements In this unbalanced reaction: Ag^+(aq) + Cu(s) rightarrow Ag(s) + Cu^2+ (aq) Which substance gets oxidized? Ag^+(aq) Cu(s) Ag(s) Cu^2+(aq) Which substance gets reduced? Balance the redox reaction: Ag^+(aq) Cu(s) Ag(s) Cu^2+(aq)
Chem 2A: Oxidation Numbers, Oxidation/Reduction rium 1. Determine the oxidation number of chlorine in the following: a) Cl b) C c) CIO d) MgCl e) ClO ) KCIO g) HCI h) NaCIO 2. Write a balanced, chemical equation for the reaction that occurs between aluminum and hydrochloric acid. Write the total and net ionic equation. b) Using the net ionic equation, determine the oxidation number on each reactant and product. Write them underneath the formulas. Determine who is oxidized/reduced. c)...
2. This chemical reaction is an oxidation reduction reaction. a. What is being oxidized in this reaction? b. What is being reduced in this reaction? c. What is the oxidizing agent?
2. Oxidation and Reduction: Answer the following questions by circling the appropriate choice. [A] A substance is oxidized when it... gains electrons loses electrons [B] A substance is reduced when it... gains electrons loses electrons (C) In this reaction, identify which reactant was oxidized and which product was reduced. 2 Fe2O3 + 3 S→ 4 Fe + 3 SO2 3. Energy Diagrams: Using the axes below, draw an energy diagram for an endothermic reaction. Label the following in your diagram:...
Most questions answered within 3 hours.
-
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 10 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 10 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 24 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago