Write out the molecular formula for the following molecules: OH CO2H b. 2. Draw the molecules...
i need help finding the molecular formula and how to draw the
line angle structure.
e. CH2CH=CHCH=CHCH=CH, CH3 CH3 f. CH2CH=CCH.CHCH OH
Select all the molecules that have an ether and the molecular formula CH1,0. CH,OCHCH,CH.CH (CH3)2CHCHCH,CHE OH OH (CH3)2CCH(CH3)2 CH3 CH,(CH2)O(CH2),CH OH CH3CH2CHCH2CH3 (CH3),CHCHOCH CH,OC(CH3) CH CH3 CH,CH,CHCHCHOH (CH3),CHOCH(CH3)2 CH,CH,CH.CH.CHCH
Draw a structural formula for the major product of the reaction shown. CH3CH2 S=CHCH2 The CH3CH2 Draw a structural formula for the major product of the reaction shown. CH3 CH3CHCH=CH2 Draw a structural formula for the major product of the reaction shown. Cl2 CH3CH2CH2CH=CH2 - H2O Draw structural formulas for all alkenes that could be used to prepare the alcohol shown below by oxymercuration. H3COH , 1. Hg(OAc)2, H2O 2. NaBH4 Draw the structure of the major organic product of...
Bond-line notation is an efficient representation of molecules that is commonly used by chemists. Molecules represented in bond-line notation are also known as "skeletal structures," "stick figures," or "line-angle" formulas. For the following molecules shown in bond-line notation, draw the appropriate Lewis structure and write out the correct molecular formula for the compound. The first problem is solved for you as an example. Bond-line notation Lewis structure Molecular formula C, H2 1. 2 3
#3 Write the formula(s) for the product(s) of the following reaction. CH3-CH2-CH2-CO-OH + CH3-OH PLUS H1+ & HEAT #4 Write the formula(s) for the product(s) of the following reaction. HCO-O-CH2-CH2-CH2-CH3 + H2O PLUS H1+ & HEAT #5 Write the formula(s) for the product(s) of the following reaction. CH3-CH2-CO-OH + NaOH #6 Write the formula(s) for the product(s) of the following reaction. HCO-O-CH2-CH3 + NaOH PLUS HEAT
How many types of nonequivalent protons are present in each of the following molecules? Molecule #1 Molecule #2 Molecule #3 H3Q CH, CH3CH,CECH CH3CH2C(CH3)2CH2CH3
3. Draw line-bond diagrams for linoleic, linolenic and arachidonic acids. TABLE 23.1 Structures of Some Common Fatty Acids Name No. of carbons Melting point("C) Structure 43.2 53.9 63.1 68.8 76.5 CH3(CH2) 10CO2H CH3(CH2)12CO2H CH3(CH2) 14CO2H CH3(CH2) 16CO2H CH(CH2)18CO2H Saturated Lauric Myristic Palmitic Stearic Arachidic Unsaturated Palmitoleic Oleic Linoleic Linolenic Arachidonic -0.1 13.4 -12 -11 -49.5 (Z)-CH(CH2)-CH-CH(CH2hCO2H (Z)-CH(CH2CH=CH(CH2);CO2H (Z.Z)-CH3(CH2),(CH-CHCH2)2(CH2)CO2H (all Z)-CH3CH2CH=CHCH2)2(CH2).CO2H (all Z)-CH(CH2)-(CH-CHCH2 CH2CH2CO2H 20
Homework Problems 8.1 Draw the structural formula for each of the following: a. 5-chloro-4-methyl-2-hexanol b. 2,3-dimethylcyclopentanol c. 5,5-diethyl-1-heptanol d. 2-ethyl-4-isopropylcyclohexanol e. 4-ethylphenol f. 2-nitrophenol g. cyclopropyl methyl ether h. isopropyl propyl ether 8.2 Give the product for the dehydration of each of the following alcohols. CH-CH2-CH3 a. ОН b. ОН C. OH d. 8.3 What product would result from the oxidation of each of the following alcohols? Write the chemical equations. a. 2-butanol b. 2-methyl-2-pentanol c. cyclohexanol d. 3-ethylcyclopentanol Name...
nework9 olem 18.53 Draw the line-angle formula for the products obtained from the hydrolysis of the following with HCl NH2 Draw the molecules on the canvas by choosing buttons from the Tools (for bonds and charges needed. e Ht 20 + Marvin IS I Problem 18.53 Draw the condensed structural formula for the products obtained from the hydrolysis of the following with CH3-CH2-C- NH2 Draw the molecules on the canvas by choosing buttons from the Tools (for bonds and charges),...
EOC Problem 8.011 Draw a skeletal structure for each of the following molecules. a. CH3CH2C(CH3)3 Edit b. CH3CH2CH(CH3)CH(CH3)CH2CH3 ? Edit Edit